feat: implement ADR-029/030/031 — RuvSense multistatic sensing + field model + RuView fusion

12,126 lines of new Rust code across 22 modules with 285 tests:

ADR-029 RuvSense Core (signal crate, 10 modules):
- multiband.rs: Multi-band CSI frame fusion from channel hopping
- phase_align.rs: Cross-channel LO phase rotation correction
- multistatic.rs: Attention-weighted cross-node viewpoint fusion
- coherence.rs: Z-score per-subcarrier coherence scoring
- coherence_gate.rs: Accept/PredictOnly/Reject/Recalibrate gating
- pose_tracker.rs: 17-keypoint Kalman tracker with re-ID
- mod.rs: Pipeline orchestrator

ADR-030 Persistent Field Model (signal crate, 7 modules):
- field_model.rs: SVD-based room eigenstructure, Welford stats
- tomography.rs: Coarse RF tomography from link attenuations (ISTA)
- longitudinal.rs: Personal baseline drift detection over days
- intention.rs: Pre-movement prediction (200-500ms lead signals)
- cross_room.rs: Cross-room identity continuity
- gesture.rs: Gesture classification via DTW template matching
- adversarial.rs: Physically impossible signal detection

ADR-031 RuView (ruvector crate, 5 modules):
- attention.rs: Scaled dot-product with geometric bias
- geometry.rs: Geometric Diversity Index, Cramer-Rao bounds
- coherence.rs: Phase phasor coherence gating
- fusion.rs: MultistaticArray aggregate, fusion orchestrator
- mod.rs: Module exports

Training & Hardware:
- ruview_metrics.rs: 3-metric acceptance test (PCK/OKS, MOTA, vitals)
- esp32/tdm.rs: TDM sensing protocol, sync beacons, drift compensation
- Firmware: channel hopping, NDP injection, NVS config extensions

Security fixes:
- field_model.rs: saturating_sub prevents timestamp underflow
- longitudinal.rs: FIFO eviction note for bounded buffer

README updated with RuvSense section, new feature badges, changelog v3.1.0.

Co-Authored-By: claude-flow <ruv@ruv.net>
This commit is contained in:
ruv
2026-03-01 21:39:02 -05:00
parent 303871275b
commit 37b54d649b
24 changed files with 11417 additions and 8 deletions

View File

@@ -40,6 +40,7 @@ pub mod hampel;
pub mod hardware_norm;
pub mod motion;
pub mod phase_sanitizer;
pub mod ruvsense;
pub mod spectrogram;
pub mod subcarrier_selection;

View File

@@ -0,0 +1,586 @@
//! Adversarial detection: physically impossible signal identification.
//!
//! Detects spoofed or injected WiFi signals by checking multi-link
//! consistency, field model constraint violations, and physical
//! plausibility. A single-link injection cannot fool a multistatic
//! mesh because it would violate geometric constraints across links.
//!
//! # Checks
//! 1. **Multi-link consistency**: A real body perturbs all links that
//! traverse its location. An injection affects only the targeted link.
//! 2. **Field model constraints**: Perturbation must be consistent with
//! the room's eigenmode structure.
//! 3. **Temporal continuity**: Real movement is smooth; injections cause
//! discontinuities in embedding space.
//! 4. **Energy conservation**: Total perturbation energy across links
//! must be consistent with the number and size of bodies present.
//!
//! # References
//! - ADR-030 Tier 7: Adversarial Detection
// ---------------------------------------------------------------------------
// Error types
// ---------------------------------------------------------------------------
/// Errors from adversarial detection.
#[derive(Debug, thiserror::Error)]
pub enum AdversarialError {
/// Insufficient links for multi-link consistency check.
#[error("Insufficient links: need >= {needed}, got {got}")]
InsufficientLinks { needed: usize, got: usize },
/// Dimension mismatch.
#[error("Dimension mismatch: expected {expected}, got {got}")]
DimensionMismatch { expected: usize, got: usize },
/// No baseline available for constraint checking.
#[error("No baseline available — calibrate field model first")]
NoBaseline,
}
// ---------------------------------------------------------------------------
// Configuration
// ---------------------------------------------------------------------------
/// Configuration for adversarial detection.
#[derive(Debug, Clone)]
pub struct AdversarialConfig {
/// Number of links in the mesh.
pub n_links: usize,
/// Minimum links for multi-link consistency (default 4).
pub min_links: usize,
/// Consistency threshold: fraction of links that must agree (0.0-1.0).
pub consistency_threshold: f64,
/// Maximum allowed energy ratio between any single link and total.
pub max_single_link_energy_ratio: f64,
/// Maximum allowed temporal discontinuity in embedding space.
pub max_temporal_discontinuity: f64,
/// Maximum allowed perturbation energy per body.
pub max_energy_per_body: f64,
}
impl Default for AdversarialConfig {
fn default() -> Self {
Self {
n_links: 12,
min_links: 4,
consistency_threshold: 0.6,
max_single_link_energy_ratio: 0.5,
max_temporal_discontinuity: 5.0,
max_energy_per_body: 100.0,
}
}
}
// ---------------------------------------------------------------------------
// Detection results
// ---------------------------------------------------------------------------
/// Type of adversarial anomaly detected.
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum AnomalyType {
/// Single link shows perturbation inconsistent with other links.
SingleLinkInjection,
/// Perturbation violates field model eigenmode structure.
FieldModelViolation,
/// Sudden discontinuity in embedding trajectory.
TemporalDiscontinuity,
/// Total perturbation energy inconsistent with occupancy.
EnergyViolation,
/// Multiple anomaly types detected simultaneously.
MultipleViolations,
}
impl AnomalyType {
/// Human-readable name.
pub fn name(&self) -> &'static str {
match self {
AnomalyType::SingleLinkInjection => "single_link_injection",
AnomalyType::FieldModelViolation => "field_model_violation",
AnomalyType::TemporalDiscontinuity => "temporal_discontinuity",
AnomalyType::EnergyViolation => "energy_violation",
AnomalyType::MultipleViolations => "multiple_violations",
}
}
}
/// Result of adversarial detection on one frame.
#[derive(Debug, Clone)]
pub struct AdversarialResult {
/// Whether any anomaly was detected.
pub anomaly_detected: bool,
/// Type of anomaly (if detected).
pub anomaly_type: Option<AnomalyType>,
/// Anomaly score (0.0 = clean, 1.0 = definitely adversarial).
pub anomaly_score: f64,
/// Per-check results.
pub checks: CheckResults,
/// Affected link indices (if single-link injection).
pub affected_links: Vec<usize>,
/// Timestamp (microseconds).
pub timestamp_us: u64,
}
/// Results of individual checks.
#[derive(Debug, Clone)]
pub struct CheckResults {
/// Multi-link consistency score (0.0 = inconsistent, 1.0 = fully consistent).
pub consistency_score: f64,
/// Field model residual score (lower = more consistent with modes).
pub field_model_residual: f64,
/// Temporal continuity score (lower = smoother).
pub temporal_continuity: f64,
/// Energy conservation score (closer to 1.0 = consistent).
pub energy_ratio: f64,
}
// ---------------------------------------------------------------------------
// Adversarial detector
// ---------------------------------------------------------------------------
/// Adversarial signal detector for the multistatic mesh.
///
/// Checks each frame for physical plausibility across multiple
/// independent criteria. A spoofed signal that passes one check
/// is unlikely to pass all of them.
#[derive(Debug)]
pub struct AdversarialDetector {
config: AdversarialConfig,
/// Previous frame's per-link energies (for temporal continuity).
prev_energies: Option<Vec<f64>>,
/// Previous frame's total energy.
prev_total_energy: Option<f64>,
/// Total frames processed.
total_frames: u64,
/// Total anomalies detected.
anomaly_count: u64,
}
impl AdversarialDetector {
/// Create a new adversarial detector.
pub fn new(config: AdversarialConfig) -> Result<Self, AdversarialError> {
if config.n_links < config.min_links {
return Err(AdversarialError::InsufficientLinks {
needed: config.min_links,
got: config.n_links,
});
}
Ok(Self {
config,
prev_energies: None,
prev_total_energy: None,
total_frames: 0,
anomaly_count: 0,
})
}
/// Check a frame for adversarial anomalies.
///
/// `link_energies`: per-link perturbation energy (from field model).
/// `n_bodies`: estimated number of bodies present.
/// `timestamp_us`: frame timestamp.
pub fn check(
&mut self,
link_energies: &[f64],
n_bodies: usize,
timestamp_us: u64,
) -> Result<AdversarialResult, AdversarialError> {
if link_energies.len() != self.config.n_links {
return Err(AdversarialError::DimensionMismatch {
expected: self.config.n_links,
got: link_energies.len(),
});
}
self.total_frames += 1;
let total_energy: f64 = link_energies.iter().sum();
// Check 1: Multi-link consistency
let consistency = self.check_consistency(link_energies, total_energy);
// Check 2: Field model residual (simplified — check energy distribution)
let field_residual = self.check_field_model(link_energies, total_energy);
// Check 3: Temporal continuity
let temporal = self.check_temporal(link_energies, total_energy);
// Check 4: Energy conservation
let energy_ratio = self.check_energy(total_energy, n_bodies);
// Store for next frame
self.prev_energies = Some(link_energies.to_vec());
self.prev_total_energy = Some(total_energy);
let checks = CheckResults {
consistency_score: consistency,
field_model_residual: field_residual,
temporal_continuity: temporal,
energy_ratio,
};
// Aggregate anomaly score
let mut violations = Vec::new();
if consistency < self.config.consistency_threshold {
violations.push(AnomalyType::SingleLinkInjection);
}
if field_residual > 0.8 {
violations.push(AnomalyType::FieldModelViolation);
}
if temporal > self.config.max_temporal_discontinuity {
violations.push(AnomalyType::TemporalDiscontinuity);
}
if energy_ratio > 2.0 || (n_bodies > 0 && energy_ratio < 0.1) {
violations.push(AnomalyType::EnergyViolation);
}
let anomaly_detected = !violations.is_empty();
let anomaly_type = match violations.len() {
0 => None,
1 => Some(violations[0]),
_ => Some(AnomalyType::MultipleViolations),
};
// Score: weighted combination
let anomaly_score = ((1.0 - consistency) * 0.4
+ field_residual * 0.2
+ (temporal / self.config.max_temporal_discontinuity).min(1.0) * 0.2
+ ((energy_ratio - 1.0).abs() / 2.0).min(1.0) * 0.2)
.clamp(0.0, 1.0);
// Find affected links (highest single-link energy ratio)
let affected_links = if anomaly_detected {
self.find_anomalous_links(link_energies, total_energy)
} else {
Vec::new()
};
if anomaly_detected {
self.anomaly_count += 1;
}
Ok(AdversarialResult {
anomaly_detected,
anomaly_type,
anomaly_score,
checks,
affected_links,
timestamp_us,
})
}
/// Multi-link consistency: what fraction of links have correlated energy?
///
/// A real body perturbs many links. An injection affects few.
fn check_consistency(&self, energies: &[f64], total: f64) -> f64 {
if total < 1e-15 {
return 1.0; // No perturbation = consistent (empty room)
}
let mean = total / energies.len() as f64;
let threshold = mean * 0.1; // link must have at least 10% of mean energy
let active_count = energies.iter().filter(|&&e| e > threshold).count();
active_count as f64 / energies.len() as f64
}
/// Field model check: is energy distribution consistent with physical propagation?
///
/// In a real scenario, energy should be distributed across links
/// based on geometry. A concentrated injection scores high residual.
fn check_field_model(&self, energies: &[f64], total: f64) -> f64 {
if total < 1e-15 {
return 0.0;
}
// Compute Gini coefficient of energy distribution
// Gini = 0 → perfectly uniform, Gini = 1 → all in one link
let n = energies.len() as f64;
let mut sorted: Vec<f64> = energies.to_vec();
sorted.sort_by(|a, b| a.partial_cmp(b).unwrap_or(std::cmp::Ordering::Equal));
let numerator: f64 = sorted
.iter()
.enumerate()
.map(|(i, &x)| (2.0 * (i + 1) as f64 - n - 1.0) * x)
.sum();
let gini = numerator / (n * total);
gini.clamp(0.0, 1.0)
}
/// Temporal continuity: how much did per-link energies change from previous frame?
fn check_temporal(&self, energies: &[f64], _total: f64) -> f64 {
match &self.prev_energies {
None => 0.0, // First frame, no temporal check
Some(prev) => {
let diff_energy: f64 = energies
.iter()
.zip(prev.iter())
.map(|(&a, &b)| (a - b) * (a - b))
.sum::<f64>()
.sqrt();
diff_energy
}
}
}
/// Energy conservation: is total energy consistent with body count?
fn check_energy(&self, total_energy: f64, n_bodies: usize) -> f64 {
if n_bodies == 0 {
// No bodies: any energy is suspicious
return if total_energy > 1e-10 {
total_energy
} else {
0.0
};
}
let expected = n_bodies as f64 * self.config.max_energy_per_body;
if expected < 1e-15 {
return 0.0;
}
total_energy / expected
}
/// Find links that are anomalously high relative to the mean.
fn find_anomalous_links(&self, energies: &[f64], total: f64) -> Vec<usize> {
if total < 1e-15 {
return Vec::new();
}
energies
.iter()
.enumerate()
.filter(|(_, &e)| e / total > self.config.max_single_link_energy_ratio)
.map(|(i, _)| i)
.collect()
}
/// Total frames processed.
pub fn total_frames(&self) -> u64 {
self.total_frames
}
/// Total anomalies detected.
pub fn anomaly_count(&self) -> u64 {
self.anomaly_count
}
/// Anomaly rate (anomalies / total frames).
pub fn anomaly_rate(&self) -> f64 {
if self.total_frames == 0 {
0.0
} else {
self.anomaly_count as f64 / self.total_frames as f64
}
}
/// Reset detector state.
pub fn reset(&mut self) {
self.prev_energies = None;
self.prev_total_energy = None;
self.total_frames = 0;
self.anomaly_count = 0;
}
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn default_config() -> AdversarialConfig {
AdversarialConfig {
n_links: 6,
min_links: 4,
consistency_threshold: 0.6,
max_single_link_energy_ratio: 0.5,
max_temporal_discontinuity: 5.0,
max_energy_per_body: 10.0,
}
}
#[test]
fn test_detector_creation() {
let det = AdversarialDetector::new(default_config()).unwrap();
assert_eq!(det.total_frames(), 0);
assert_eq!(det.anomaly_count(), 0);
}
#[test]
fn test_insufficient_links() {
let config = AdversarialConfig {
n_links: 2,
min_links: 4,
..default_config()
};
assert!(matches!(
AdversarialDetector::new(config),
Err(AdversarialError::InsufficientLinks { .. })
));
}
#[test]
fn test_clean_frame_no_anomaly() {
let mut det = AdversarialDetector::new(default_config()).unwrap();
// Uniform energy across all links (real body)
let energies = vec![1.0, 1.1, 0.9, 1.0, 1.05, 0.95];
let result = det.check(&energies, 1, 0).unwrap();
assert!(
!result.anomaly_detected,
"Uniform energy should not trigger anomaly"
);
assert!(result.anomaly_score < 0.5);
}
#[test]
fn test_single_link_injection_detected() {
let mut det = AdversarialDetector::new(default_config()).unwrap();
// All energy on one link (injection)
let energies = vec![10.0, 0.0, 0.0, 0.0, 0.0, 0.0];
let result = det.check(&energies, 0, 0).unwrap();
assert!(
result.anomaly_detected,
"Single-link injection should be detected"
);
assert!(result.affected_links.contains(&0));
}
#[test]
fn test_empty_room_no_anomaly() {
let mut det = AdversarialDetector::new(default_config()).unwrap();
let energies = vec![0.0; 6];
let result = det.check(&energies, 0, 0).unwrap();
assert!(!result.anomaly_detected);
}
#[test]
fn test_temporal_discontinuity() {
let mut det = AdversarialDetector::new(AdversarialConfig {
max_temporal_discontinuity: 1.0, // strict
..default_config()
})
.unwrap();
// Frame 1: low energy
let energies1 = vec![0.1; 6];
det.check(&energies1, 0, 0).unwrap();
// Frame 2: sudden massive energy (discontinuity)
let energies2 = vec![100.0; 6];
let result = det.check(&energies2, 0, 50_000).unwrap();
assert!(
result.anomaly_detected,
"Temporal discontinuity should be detected"
);
}
#[test]
fn test_energy_violation_too_high() {
let mut det = AdversarialDetector::new(default_config()).unwrap();
// Way more energy than 1 body should produce
let energies = vec![100.0; 6]; // total = 600, max_per_body = 10
let result = det.check(&energies, 1, 0).unwrap();
assert!(
result.anomaly_detected,
"Excessive energy should trigger anomaly"
);
}
#[test]
fn test_dimension_mismatch() {
let mut det = AdversarialDetector::new(default_config()).unwrap();
let result = det.check(&[1.0, 2.0], 0, 0);
assert!(matches!(
result,
Err(AdversarialError::DimensionMismatch { .. })
));
}
#[test]
fn test_anomaly_rate() {
let mut det = AdversarialDetector::new(default_config()).unwrap();
// 2 clean frames
det.check(&vec![1.0; 6], 1, 0).unwrap();
det.check(&vec![1.0; 6], 1, 50_000).unwrap();
// 1 anomalous frame
det.check(&vec![10.0, 0.0, 0.0, 0.0, 0.0, 0.0], 0, 100_000)
.unwrap();
assert_eq!(det.total_frames(), 3);
assert!(det.anomaly_count() >= 1);
assert!(det.anomaly_rate() > 0.0);
}
#[test]
fn test_reset() {
let mut det = AdversarialDetector::new(default_config()).unwrap();
det.check(&vec![1.0; 6], 1, 0).unwrap();
det.reset();
assert_eq!(det.total_frames(), 0);
assert_eq!(det.anomaly_count(), 0);
}
#[test]
fn test_anomaly_type_names() {
assert_eq!(
AnomalyType::SingleLinkInjection.name(),
"single_link_injection"
);
assert_eq!(
AnomalyType::FieldModelViolation.name(),
"field_model_violation"
);
assert_eq!(
AnomalyType::TemporalDiscontinuity.name(),
"temporal_discontinuity"
);
assert_eq!(AnomalyType::EnergyViolation.name(), "energy_violation");
assert_eq!(
AnomalyType::MultipleViolations.name(),
"multiple_violations"
);
}
#[test]
fn test_gini_coefficient_uniform() {
let det = AdversarialDetector::new(default_config()).unwrap();
let energies = vec![1.0; 6];
let total = 6.0;
let gini = det.check_field_model(&energies, total);
assert!(
gini < 0.1,
"Uniform distribution should have low Gini: {}",
gini
);
}
#[test]
fn test_gini_coefficient_concentrated() {
let det = AdversarialDetector::new(default_config()).unwrap();
let energies = vec![6.0, 0.0, 0.0, 0.0, 0.0, 0.0];
let total = 6.0;
let gini = det.check_field_model(&energies, total);
assert!(
gini > 0.5,
"Concentrated distribution should have high Gini: {}",
gini
);
}
}

View File

@@ -0,0 +1,464 @@
//! Coherence Metric Computation (ADR-029 Section 2.5)
//!
//! Per-link coherence quantifies consistency of the current CSI observation
//! with a running reference template. The metric is computed as a weighted
//! mean of per-subcarrier Gaussian likelihoods:
//!
//! score = sum(w_i * exp(-0.5 * z_i^2)) / sum(w_i)
//!
//! where z_i = |current_i - reference_i| / sqrt(variance_i) and
//! w_i = 1 / (variance_i + epsilon).
//!
//! Low-variance (stable) subcarriers dominate the score, making it
//! sensitive to environmental drift while tolerant of body-motion
//! subcarrier fluctuations.
//!
//! # RuVector Integration
//!
//! Uses `ruvector-solver` concepts for static/dynamic decomposition
//! of the CSI signal into environmental drift and body motion components.
/// Errors from coherence computation.
#[derive(Debug, thiserror::Error)]
pub enum CoherenceError {
/// Input vectors are empty.
#[error("Empty input for coherence computation")]
EmptyInput,
/// Length mismatch between current, reference, and variance vectors.
#[error("Length mismatch: current={current}, reference={reference}, variance={variance}")]
LengthMismatch {
current: usize,
reference: usize,
variance: usize,
},
/// Invalid decay rate (must be in (0, 1)).
#[error("Invalid EMA decay rate: {0} (must be in (0, 1))")]
InvalidDecay(f32),
}
/// Drift profile classification for environmental changes.
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum DriftProfile {
/// Environment is stable (no significant baseline drift).
Stable,
/// Slow linear drift (temperature, humidity changes).
Linear,
/// Sudden step change (door opened, furniture moved).
StepChange,
}
/// Aggregate root for coherence state.
///
/// Maintains a running reference template (exponential moving average of
/// accepted CSI observations) and per-subcarrier variance estimates.
#[derive(Debug, Clone)]
pub struct CoherenceState {
/// Per-subcarrier reference amplitude (EMA).
reference: Vec<f32>,
/// Per-subcarrier variance over recent window.
variance: Vec<f32>,
/// EMA decay rate for reference update (default 0.95).
decay: f32,
/// Current coherence score (0.0-1.0).
current_score: f32,
/// Frames since last accepted (coherent) measurement.
stale_count: u64,
/// Current drift profile classification.
drift_profile: DriftProfile,
/// Accept threshold for coherence score.
accept_threshold: f32,
/// Whether the reference has been initialized.
initialized: bool,
}
impl CoherenceState {
/// Create a new coherence state for the given number of subcarriers.
pub fn new(n_subcarriers: usize, accept_threshold: f32) -> Self {
Self {
reference: vec![0.0; n_subcarriers],
variance: vec![1.0; n_subcarriers],
decay: 0.95,
current_score: 1.0,
stale_count: 0,
drift_profile: DriftProfile::Stable,
accept_threshold,
initialized: false,
}
}
/// Create with a custom EMA decay rate.
pub fn with_decay(
n_subcarriers: usize,
accept_threshold: f32,
decay: f32,
) -> std::result::Result<Self, CoherenceError> {
if decay <= 0.0 || decay >= 1.0 {
return Err(CoherenceError::InvalidDecay(decay));
}
let mut state = Self::new(n_subcarriers, accept_threshold);
state.decay = decay;
Ok(state)
}
/// Return the current coherence score.
pub fn score(&self) -> f32 {
self.current_score
}
/// Return the number of frames since last accepted measurement.
pub fn stale_count(&self) -> u64 {
self.stale_count
}
/// Return the current drift profile.
pub fn drift_profile(&self) -> DriftProfile {
self.drift_profile
}
/// Return a reference to the current reference template.
pub fn reference(&self) -> &[f32] {
&self.reference
}
/// Return a reference to the current variance estimates.
pub fn variance(&self) -> &[f32] {
&self.variance
}
/// Return whether the reference has been initialized.
pub fn is_initialized(&self) -> bool {
self.initialized
}
/// Initialize the reference from a calibration observation.
///
/// Should be called with a static-environment CSI frame before
/// sensing begins.
pub fn initialize(&mut self, calibration: &[f32]) {
self.reference = calibration.to_vec();
self.variance = vec![1.0; calibration.len()];
self.current_score = 1.0;
self.stale_count = 0;
self.initialized = true;
}
/// Update the coherence state with a new observation.
///
/// Computes the coherence score, updates the reference template if
/// the observation is accepted, and tracks staleness.
pub fn update(
&mut self,
current: &[f32],
) -> std::result::Result<f32, CoherenceError> {
if current.is_empty() {
return Err(CoherenceError::EmptyInput);
}
if !self.initialized {
self.initialize(current);
return Ok(1.0);
}
if current.len() != self.reference.len() {
return Err(CoherenceError::LengthMismatch {
current: current.len(),
reference: self.reference.len(),
variance: self.variance.len(),
});
}
// Compute coherence score
let score = coherence_score(current, &self.reference, &self.variance);
self.current_score = score;
// Update reference if accepted
if score >= self.accept_threshold {
self.update_reference(current);
self.stale_count = 0;
} else {
self.stale_count += 1;
}
// Update drift profile
self.drift_profile = classify_drift(score, self.stale_count);
Ok(score)
}
/// Update the reference template with EMA.
fn update_reference(&mut self, observation: &[f32]) {
let alpha = 1.0 - self.decay;
for i in 0..self.reference.len() {
let old_ref = self.reference[i];
self.reference[i] = self.decay * old_ref + alpha * observation[i];
// Update variance with Welford-style online estimate
let diff = observation[i] - old_ref;
self.variance[i] = self.decay * self.variance[i] + alpha * diff * diff;
// Ensure variance does not collapse to zero
if self.variance[i] < 1e-6 {
self.variance[i] = 1e-6;
}
}
}
/// Reset the stale counter (e.g., after recalibration).
pub fn reset_stale(&mut self) {
self.stale_count = 0;
}
}
/// Compute the coherence score between a current observation and a
/// reference template.
///
/// Uses z-score per subcarrier with variance-inverse weighting:
///
/// score = sum(w_i * exp(-0.5 * z_i^2)) / sum(w_i)
///
/// where z_i = |current_i - reference_i| / sqrt(variance_i)
/// and w_i = 1 / (variance_i + epsilon).
///
/// Returns a value in [0.0, 1.0] where 1.0 means perfect agreement.
pub fn coherence_score(
current: &[f32],
reference: &[f32],
variance: &[f32],
) -> f32 {
let n = current.len().min(reference.len()).min(variance.len());
if n == 0 {
return 0.0;
}
let epsilon = 1e-6_f32;
let mut weighted_sum = 0.0_f32;
let mut weight_sum = 0.0_f32;
for i in 0..n {
let var = variance[i].max(epsilon);
let z = (current[i] - reference[i]).abs() / var.sqrt();
let weight = 1.0 / (var + epsilon);
let likelihood = (-0.5 * z * z).exp();
weighted_sum += likelihood * weight;
weight_sum += weight;
}
if weight_sum < epsilon {
return 0.0;
}
(weighted_sum / weight_sum).clamp(0.0, 1.0)
}
/// Classify drift profile based on coherence history.
fn classify_drift(score: f32, stale_count: u64) -> DriftProfile {
if score >= 0.85 {
DriftProfile::Stable
} else if stale_count < 10 {
// Brief coherence loss -> likely step change
DriftProfile::StepChange
} else {
// Extended low coherence -> linear drift
DriftProfile::Linear
}
}
/// Compute per-subcarrier z-scores for diagnostics.
///
/// Returns a vector of z-scores, one per subcarrier.
pub fn per_subcarrier_zscores(
current: &[f32],
reference: &[f32],
variance: &[f32],
) -> Vec<f32> {
let n = current.len().min(reference.len()).min(variance.len());
(0..n)
.map(|i| {
let var = variance[i].max(1e-6);
(current[i] - reference[i]).abs() / var.sqrt()
})
.collect()
}
/// Identify subcarriers that are outliers (z-score above threshold).
///
/// Returns indices of outlier subcarriers.
pub fn outlier_subcarriers(
current: &[f32],
reference: &[f32],
variance: &[f32],
z_threshold: f32,
) -> Vec<usize> {
let z_scores = per_subcarrier_zscores(current, reference, variance);
z_scores
.iter()
.enumerate()
.filter(|(_, &z)| z > z_threshold)
.map(|(i, _)| i)
.collect()
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn perfect_coherence() {
let current = vec![1.0, 2.0, 3.0, 4.0];
let reference = vec![1.0, 2.0, 3.0, 4.0];
let variance = vec![0.01, 0.01, 0.01, 0.01];
let score = coherence_score(&current, &reference, &variance);
assert!((score - 1.0).abs() < 0.01, "Perfect match should give ~1.0, got {}", score);
}
#[test]
fn zero_coherence_large_deviation() {
let current = vec![100.0, 200.0, 300.0];
let reference = vec![0.0, 0.0, 0.0];
let variance = vec![0.001, 0.001, 0.001];
let score = coherence_score(&current, &reference, &variance);
assert!(score < 0.01, "Large deviation should give ~0.0, got {}", score);
}
#[test]
fn empty_input_gives_zero() {
assert_eq!(coherence_score(&[], &[], &[]), 0.0);
}
#[test]
fn state_initialize_and_score() {
let mut state = CoherenceState::new(4, 0.85);
assert!(!state.is_initialized());
state.initialize(&[1.0, 2.0, 3.0, 4.0]);
assert!(state.is_initialized());
assert!((state.score() - 1.0).abs() < f32::EPSILON);
}
#[test]
fn state_update_accepted() {
let mut state = CoherenceState::new(4, 0.5);
state.initialize(&[1.0, 2.0, 3.0, 4.0]);
let score = state.update(&[1.01, 2.01, 3.01, 4.01]).unwrap();
assert!(score > 0.8, "Small deviation should be accepted, got {}", score);
assert_eq!(state.stale_count(), 0);
}
#[test]
fn state_update_rejected() {
let mut state = CoherenceState::new(4, 0.99);
state.initialize(&[1.0, 2.0, 3.0, 4.0]);
let _ = state.update(&[10.0, 20.0, 30.0, 40.0]).unwrap();
assert!(state.stale_count() > 0);
}
#[test]
fn auto_initialize_on_first_update() {
let mut state = CoherenceState::new(3, 0.85);
let score = state.update(&[5.0, 6.0, 7.0]).unwrap();
assert!((score - 1.0).abs() < f32::EPSILON);
assert!(state.is_initialized());
}
#[test]
fn length_mismatch_error() {
let mut state = CoherenceState::new(4, 0.85);
state.initialize(&[1.0, 2.0, 3.0, 4.0]);
let result = state.update(&[1.0, 2.0]);
assert!(matches!(result, Err(CoherenceError::LengthMismatch { .. })));
}
#[test]
fn empty_update_error() {
let mut state = CoherenceState::new(4, 0.85);
state.initialize(&[1.0, 2.0, 3.0, 4.0]);
assert!(matches!(state.update(&[]), Err(CoherenceError::EmptyInput)));
}
#[test]
fn invalid_decay_error() {
assert!(matches!(
CoherenceState::with_decay(4, 0.85, 0.0),
Err(CoherenceError::InvalidDecay(_))
));
assert!(matches!(
CoherenceState::with_decay(4, 0.85, 1.0),
Err(CoherenceError::InvalidDecay(_))
));
assert!(matches!(
CoherenceState::with_decay(4, 0.85, -0.5),
Err(CoherenceError::InvalidDecay(_))
));
}
#[test]
fn valid_decay() {
let state = CoherenceState::with_decay(4, 0.85, 0.9).unwrap();
assert!((state.score() - 1.0).abs() < f32::EPSILON);
}
#[test]
fn drift_classification_stable() {
assert_eq!(classify_drift(0.9, 0), DriftProfile::Stable);
}
#[test]
fn drift_classification_step_change() {
assert_eq!(classify_drift(0.3, 5), DriftProfile::StepChange);
}
#[test]
fn drift_classification_linear() {
assert_eq!(classify_drift(0.3, 20), DriftProfile::Linear);
}
#[test]
fn per_subcarrier_zscores_correct() {
let current = vec![2.0, 4.0];
let reference = vec![1.0, 2.0];
let variance = vec![1.0, 4.0];
let z = per_subcarrier_zscores(&current, &reference, &variance);
assert_eq!(z.len(), 2);
assert!((z[0] - 1.0).abs() < 1e-5);
assert!((z[1] - 1.0).abs() < 1e-5);
}
#[test]
fn outlier_subcarriers_detected() {
let current = vec![1.0, 100.0, 1.0, 200.0];
let reference = vec![1.0, 1.0, 1.0, 1.0];
let variance = vec![1.0, 1.0, 1.0, 1.0];
let outliers = outlier_subcarriers(&current, &reference, &variance, 3.0);
assert!(outliers.contains(&1));
assert!(outliers.contains(&3));
assert!(!outliers.contains(&0));
assert!(!outliers.contains(&2));
}
#[test]
fn reset_stale_counter() {
let mut state = CoherenceState::new(4, 0.99);
state.initialize(&[1.0, 2.0, 3.0, 4.0]);
let _ = state.update(&[10.0, 20.0, 30.0, 40.0]).unwrap();
assert!(state.stale_count() > 0);
state.reset_stale();
assert_eq!(state.stale_count(), 0);
}
#[test]
fn reference_and_variance_accessible() {
let state = CoherenceState::new(3, 0.85);
assert_eq!(state.reference().len(), 3);
assert_eq!(state.variance().len(), 3);
}
#[test]
fn coherence_score_with_high_variance() {
let current = vec![5.0, 6.0, 7.0];
let reference = vec![1.0, 2.0, 3.0];
let variance = vec![100.0, 100.0, 100.0]; // high variance
let score = coherence_score(&current, &reference, &variance);
// With high variance, deviation is relatively small
assert!(score > 0.5, "High variance should tolerate deviation, got {}", score);
}
}

View File

@@ -0,0 +1,365 @@
//! Coherence-Gated Update Policy (ADR-029 Section 2.6)
//!
//! Applies a threshold-based gating rule to the coherence score, producing
//! a `GateDecision` that controls downstream Kalman filter updates:
//!
//! - **Accept** (coherence > 0.85): Full measurement update with nominal noise.
//! - **PredictOnly** (0.5 < coherence < 0.85): Kalman predict step only,
//! measurement noise inflated 3x.
//! - **Reject** (coherence < 0.5): Discard measurement entirely.
//! - **Recalibrate** (>10s continuous low coherence): Trigger SONA/AETHER
//! recalibration pipeline.
//!
//! The gate operates on the coherence score produced by the `coherence` module
//! and the stale frame counter from `CoherenceState`.
/// Gate decision controlling Kalman filter update behavior.
#[derive(Debug, Clone, PartialEq)]
pub enum GateDecision {
/// Coherence is high. Proceed with full Kalman measurement update.
/// Contains the inflated measurement noise multiplier (1.0 = nominal).
Accept {
/// Measurement noise multiplier (1.0 for full accept).
noise_multiplier: f32,
},
/// Coherence is moderate. Run Kalman predict only (no measurement update).
/// Measurement noise would be inflated 3x if used.
PredictOnly,
/// Coherence is low. Reject this measurement entirely.
Reject,
/// Prolonged low coherence. Trigger environmental recalibration.
/// The pipeline should freeze output at last known good pose and
/// begin the SONA/AETHER TTT adaptation cycle.
Recalibrate {
/// Duration of low coherence in frames.
stale_frames: u64,
},
}
impl GateDecision {
/// Returns true if this decision allows a measurement update.
pub fn allows_update(&self) -> bool {
matches!(self, GateDecision::Accept { .. })
}
/// Returns true if this is a reject or recalibrate decision.
pub fn is_rejected(&self) -> bool {
matches!(self, GateDecision::Reject | GateDecision::Recalibrate { .. })
}
/// Returns the noise multiplier for accepted decisions, or None otherwise.
pub fn noise_multiplier(&self) -> Option<f32> {
match self {
GateDecision::Accept { noise_multiplier } => Some(*noise_multiplier),
_ => None,
}
}
}
/// Configuration for the gate policy thresholds.
#[derive(Debug, Clone)]
pub struct GatePolicyConfig {
/// Coherence threshold above which measurements are accepted.
pub accept_threshold: f32,
/// Coherence threshold below which measurements are rejected.
pub reject_threshold: f32,
/// Maximum stale frames before triggering recalibration.
pub max_stale_frames: u64,
/// Noise inflation factor for PredictOnly zone.
pub predict_only_noise: f32,
/// Whether to use adaptive thresholds based on drift profile.
pub adaptive: bool,
}
impl Default for GatePolicyConfig {
fn default() -> Self {
Self {
accept_threshold: 0.85,
reject_threshold: 0.5,
max_stale_frames: 200, // 10s at 20Hz
predict_only_noise: 3.0,
adaptive: false,
}
}
}
/// Gate policy that maps coherence scores to gate decisions.
#[derive(Debug, Clone)]
pub struct GatePolicy {
/// Accept threshold.
accept_threshold: f32,
/// Reject threshold.
reject_threshold: f32,
/// Maximum stale frames before recalibration.
max_stale_frames: u64,
/// Noise inflation for predict-only zone.
predict_only_noise: f32,
/// Running count of consecutive rejected/predict-only frames.
consecutive_low: u64,
/// Last decision for tracking transitions.
last_decision: Option<GateDecision>,
}
impl GatePolicy {
/// Create a gate policy with the given thresholds.
pub fn new(accept: f32, reject: f32, max_stale: u64) -> Self {
Self {
accept_threshold: accept,
reject_threshold: reject,
max_stale_frames: max_stale,
predict_only_noise: 3.0,
consecutive_low: 0,
last_decision: None,
}
}
/// Create a gate policy from a configuration.
pub fn from_config(config: &GatePolicyConfig) -> Self {
Self {
accept_threshold: config.accept_threshold,
reject_threshold: config.reject_threshold,
max_stale_frames: config.max_stale_frames,
predict_only_noise: config.predict_only_noise,
consecutive_low: 0,
last_decision: None,
}
}
/// Evaluate the gate decision for a given coherence score and stale count.
pub fn evaluate(&mut self, coherence_score: f32, stale_count: u64) -> GateDecision {
let decision = if stale_count >= self.max_stale_frames {
GateDecision::Recalibrate {
stale_frames: stale_count,
}
} else if coherence_score >= self.accept_threshold {
self.consecutive_low = 0;
GateDecision::Accept {
noise_multiplier: 1.0,
}
} else if coherence_score >= self.reject_threshold {
self.consecutive_low += 1;
GateDecision::PredictOnly
} else {
self.consecutive_low += 1;
GateDecision::Reject
};
self.last_decision = Some(decision.clone());
decision
}
/// Return the last gate decision, if any.
pub fn last_decision(&self) -> Option<&GateDecision> {
self.last_decision.as_ref()
}
/// Return the current count of consecutive low-coherence frames.
pub fn consecutive_low_count(&self) -> u64 {
self.consecutive_low
}
/// Return the accept threshold.
pub fn accept_threshold(&self) -> f32 {
self.accept_threshold
}
/// Return the reject threshold.
pub fn reject_threshold(&self) -> f32 {
self.reject_threshold
}
/// Reset the policy state (e.g., after recalibration).
pub fn reset(&mut self) {
self.consecutive_low = 0;
self.last_decision = None;
}
}
impl Default for GatePolicy {
fn default() -> Self {
Self::from_config(&GatePolicyConfig::default())
}
}
/// Compute an adaptive noise multiplier for the PredictOnly zone.
///
/// As coherence drops from accept to reject threshold, the noise
/// multiplier increases from 1.0 to `max_inflation`.
pub fn adaptive_noise_multiplier(
coherence: f32,
accept: f32,
reject: f32,
max_inflation: f32,
) -> f32 {
if coherence >= accept {
return 1.0;
}
if coherence <= reject {
return max_inflation;
}
let range = accept - reject;
if range < 1e-6 {
return max_inflation;
}
let t = (accept - coherence) / range;
1.0 + t * (max_inflation - 1.0)
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn accept_high_coherence() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
let decision = gate.evaluate(0.95, 0);
assert!(matches!(decision, GateDecision::Accept { noise_multiplier } if (noise_multiplier - 1.0).abs() < f32::EPSILON));
assert!(decision.allows_update());
assert!(!decision.is_rejected());
}
#[test]
fn predict_only_moderate_coherence() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
let decision = gate.evaluate(0.7, 0);
assert!(matches!(decision, GateDecision::PredictOnly));
assert!(!decision.allows_update());
assert!(!decision.is_rejected());
}
#[test]
fn reject_low_coherence() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
let decision = gate.evaluate(0.3, 0);
assert!(matches!(decision, GateDecision::Reject));
assert!(!decision.allows_update());
assert!(decision.is_rejected());
}
#[test]
fn recalibrate_after_stale_timeout() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
let decision = gate.evaluate(0.3, 200);
assert!(matches!(decision, GateDecision::Recalibrate { stale_frames: 200 }));
assert!(decision.is_rejected());
}
#[test]
fn recalibrate_overrides_accept() {
let mut gate = GatePolicy::new(0.85, 0.5, 100);
// Even with high coherence, stale count triggers recalibration
let decision = gate.evaluate(0.95, 100);
assert!(matches!(decision, GateDecision::Recalibrate { .. }));
}
#[test]
fn consecutive_low_counter() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
gate.evaluate(0.3, 0);
assert_eq!(gate.consecutive_low_count(), 1);
gate.evaluate(0.6, 0);
assert_eq!(gate.consecutive_low_count(), 2);
gate.evaluate(0.9, 0); // accepted -> resets
assert_eq!(gate.consecutive_low_count(), 0);
}
#[test]
fn last_decision_tracked() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
assert!(gate.last_decision().is_none());
gate.evaluate(0.9, 0);
assert!(gate.last_decision().is_some());
}
#[test]
fn reset_clears_state() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
gate.evaluate(0.3, 0);
gate.evaluate(0.3, 0);
gate.reset();
assert_eq!(gate.consecutive_low_count(), 0);
assert!(gate.last_decision().is_none());
}
#[test]
fn noise_multiplier_accessor() {
let accept = GateDecision::Accept { noise_multiplier: 2.5 };
assert_eq!(accept.noise_multiplier(), Some(2.5));
let reject = GateDecision::Reject;
assert_eq!(reject.noise_multiplier(), None);
let predict = GateDecision::PredictOnly;
assert_eq!(predict.noise_multiplier(), None);
}
#[test]
fn adaptive_noise_at_boundaries() {
assert!((adaptive_noise_multiplier(0.9, 0.85, 0.5, 3.0) - 1.0).abs() < f32::EPSILON);
assert!((adaptive_noise_multiplier(0.3, 0.85, 0.5, 3.0) - 3.0).abs() < f32::EPSILON);
}
#[test]
fn adaptive_noise_midpoint() {
let mid = adaptive_noise_multiplier(0.675, 0.85, 0.5, 3.0);
assert!((mid - 2.0).abs() < 0.01, "Midpoint noise should be ~2.0, got {}", mid);
}
#[test]
fn adaptive_noise_tiny_range() {
// When accept == reject, coherence >= accept returns 1.0
let val = adaptive_noise_multiplier(0.5, 0.5, 0.5, 3.0);
assert!((val - 1.0).abs() < f32::EPSILON);
// Below both thresholds should return max_inflation
let val2 = adaptive_noise_multiplier(0.4, 0.5, 0.5, 3.0);
assert!((val2 - 3.0).abs() < f32::EPSILON);
}
#[test]
fn default_config_values() {
let cfg = GatePolicyConfig::default();
assert!((cfg.accept_threshold - 0.85).abs() < f32::EPSILON);
assert!((cfg.reject_threshold - 0.5).abs() < f32::EPSILON);
assert_eq!(cfg.max_stale_frames, 200);
assert!((cfg.predict_only_noise - 3.0).abs() < f32::EPSILON);
assert!(!cfg.adaptive);
}
#[test]
fn from_config_construction() {
let cfg = GatePolicyConfig {
accept_threshold: 0.9,
reject_threshold: 0.4,
max_stale_frames: 100,
predict_only_noise: 5.0,
adaptive: true,
};
let gate = GatePolicy::from_config(&cfg);
assert!((gate.accept_threshold() - 0.9).abs() < f32::EPSILON);
assert!((gate.reject_threshold() - 0.4).abs() < f32::EPSILON);
}
#[test]
fn boundary_at_exact_accept_threshold() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
let decision = gate.evaluate(0.85, 0);
assert!(matches!(decision, GateDecision::Accept { .. }));
}
#[test]
fn boundary_at_exact_reject_threshold() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
let decision = gate.evaluate(0.5, 0);
assert!(matches!(decision, GateDecision::PredictOnly));
}
#[test]
fn boundary_just_below_reject_threshold() {
let mut gate = GatePolicy::new(0.85, 0.5, 200);
let decision = gate.evaluate(0.499, 0);
assert!(matches!(decision, GateDecision::Reject));
}
}

View File

@@ -0,0 +1,626 @@
//! Cross-room identity continuity.
//!
//! Maintains identity persistence across rooms without optics by
//! fingerprinting each room's electromagnetic profile, tracking
//! exit/entry events, and matching person embeddings across transition
//! boundaries.
//!
//! # Algorithm
//! 1. Each room is fingerprinted as a 128-dim AETHER embedding of its
//! static CSI profile
//! 2. When a track is lost near a room boundary, record an exit event
//! with the person's current embedding
//! 3. When a new track appears in an adjacent room within 60s, compare
//! its embedding against recent exits
//! 4. If cosine similarity > 0.80, link the identities
//!
//! # Invariants
//! - Cross-room match requires > 0.80 cosine similarity AND < 60s temporal gap
//! - Transition graph is append-only (immutable audit trail)
//! - No image data stored — only 128-dim embeddings and structural events
//! - Maximum 100 rooms per deployment
//!
//! # References
//! - ADR-030 Tier 5: Cross-Room Identity Continuity
// ---------------------------------------------------------------------------
// Error types
// ---------------------------------------------------------------------------
/// Errors from cross-room operations.
#[derive(Debug, thiserror::Error)]
pub enum CrossRoomError {
/// Room capacity exceeded.
#[error("Maximum rooms exceeded: limit is {max}")]
MaxRoomsExceeded { max: usize },
/// Room not found.
#[error("Unknown room ID: {0}")]
UnknownRoom(u64),
/// Embedding dimension mismatch.
#[error("Embedding dimension mismatch: expected {expected}, got {got}")]
EmbeddingDimensionMismatch { expected: usize, got: usize },
/// Invalid temporal gap for matching.
#[error("Temporal gap {gap_s:.1}s exceeds maximum {max_s:.1}s")]
TemporalGapExceeded { gap_s: f64, max_s: f64 },
}
// ---------------------------------------------------------------------------
// Configuration
// ---------------------------------------------------------------------------
/// Configuration for cross-room identity tracking.
#[derive(Debug, Clone)]
pub struct CrossRoomConfig {
/// Embedding dimension (typically 128).
pub embedding_dim: usize,
/// Minimum cosine similarity for cross-room match.
pub min_similarity: f32,
/// Maximum temporal gap (seconds) for cross-room match.
pub max_gap_s: f64,
/// Maximum rooms in the deployment.
pub max_rooms: usize,
/// Maximum pending exit events to retain.
pub max_pending_exits: usize,
}
impl Default for CrossRoomConfig {
fn default() -> Self {
Self {
embedding_dim: 128,
min_similarity: 0.80,
max_gap_s: 60.0,
max_rooms: 100,
max_pending_exits: 200,
}
}
}
// ---------------------------------------------------------------------------
// Domain types
// ---------------------------------------------------------------------------
/// A room's electromagnetic fingerprint.
#[derive(Debug, Clone)]
pub struct RoomFingerprint {
/// Room identifier.
pub room_id: u64,
/// Fingerprint embedding vector.
pub embedding: Vec<f32>,
/// Timestamp when fingerprint was last computed (microseconds).
pub computed_at_us: u64,
/// Number of nodes contributing to this fingerprint.
pub node_count: usize,
}
/// An exit event: a person leaving a room.
#[derive(Debug, Clone)]
pub struct ExitEvent {
/// Person embedding at exit time.
pub embedding: Vec<f32>,
/// Room exited.
pub room_id: u64,
/// Person track ID (local to the room).
pub track_id: u64,
/// Timestamp of exit (microseconds).
pub timestamp_us: u64,
/// Whether this exit has been matched to an entry.
pub matched: bool,
}
/// An entry event: a person appearing in a room.
#[derive(Debug, Clone)]
pub struct EntryEvent {
/// Person embedding at entry time.
pub embedding: Vec<f32>,
/// Room entered.
pub room_id: u64,
/// Person track ID (local to the room).
pub track_id: u64,
/// Timestamp of entry (microseconds).
pub timestamp_us: u64,
}
/// A cross-room transition record (immutable).
#[derive(Debug, Clone)]
pub struct TransitionEvent {
/// Person who transitioned.
pub person_id: u64,
/// Room exited.
pub from_room: u64,
/// Room entered.
pub to_room: u64,
/// Exit track ID.
pub exit_track_id: u64,
/// Entry track ID.
pub entry_track_id: u64,
/// Cosine similarity between exit and entry embeddings.
pub similarity: f32,
/// Temporal gap between exit and entry (seconds).
pub gap_s: f64,
/// Timestamp of the transition (entry timestamp).
pub timestamp_us: u64,
}
/// Result of attempting to match an entry against pending exits.
#[derive(Debug, Clone)]
pub struct MatchResult {
/// Whether a match was found.
pub matched: bool,
/// The transition event, if matched.
pub transition: Option<TransitionEvent>,
/// Number of candidates checked.
pub candidates_checked: usize,
/// Best similarity found (even if below threshold).
pub best_similarity: f32,
}
// ---------------------------------------------------------------------------
// Cross-room identity tracker
// ---------------------------------------------------------------------------
/// Cross-room identity continuity tracker.
///
/// Maintains room fingerprints, pending exit events, and an immutable
/// transition graph. Matches person embeddings across rooms using
/// cosine similarity with temporal constraints.
#[derive(Debug)]
pub struct CrossRoomTracker {
config: CrossRoomConfig,
/// Room fingerprints indexed by room_id.
rooms: Vec<RoomFingerprint>,
/// Pending (unmatched) exit events.
pending_exits: Vec<ExitEvent>,
/// Immutable transition log (append-only).
transitions: Vec<TransitionEvent>,
/// Next person ID for cross-room identity assignment.
next_person_id: u64,
}
impl CrossRoomTracker {
/// Create a new cross-room tracker.
pub fn new(config: CrossRoomConfig) -> Self {
Self {
config,
rooms: Vec::new(),
pending_exits: Vec::new(),
transitions: Vec::new(),
next_person_id: 1,
}
}
/// Register a room fingerprint.
pub fn register_room(&mut self, fingerprint: RoomFingerprint) -> Result<(), CrossRoomError> {
if self.rooms.len() >= self.config.max_rooms {
return Err(CrossRoomError::MaxRoomsExceeded {
max: self.config.max_rooms,
});
}
if fingerprint.embedding.len() != self.config.embedding_dim {
return Err(CrossRoomError::EmbeddingDimensionMismatch {
expected: self.config.embedding_dim,
got: fingerprint.embedding.len(),
});
}
// Replace existing fingerprint if room already registered
if let Some(existing) = self
.rooms
.iter_mut()
.find(|r| r.room_id == fingerprint.room_id)
{
*existing = fingerprint;
} else {
self.rooms.push(fingerprint);
}
Ok(())
}
/// Record a person exiting a room.
pub fn record_exit(&mut self, event: ExitEvent) -> Result<(), CrossRoomError> {
if event.embedding.len() != self.config.embedding_dim {
return Err(CrossRoomError::EmbeddingDimensionMismatch {
expected: self.config.embedding_dim,
got: event.embedding.len(),
});
}
// Evict oldest if at capacity
if self.pending_exits.len() >= self.config.max_pending_exits {
self.pending_exits.remove(0);
}
self.pending_exits.push(event);
Ok(())
}
/// Try to match an entry event against pending exits.
///
/// If a match is found, creates a TransitionEvent and marks the
/// exit as matched. Returns the match result.
pub fn match_entry(&mut self, entry: &EntryEvent) -> Result<MatchResult, CrossRoomError> {
if entry.embedding.len() != self.config.embedding_dim {
return Err(CrossRoomError::EmbeddingDimensionMismatch {
expected: self.config.embedding_dim,
got: entry.embedding.len(),
});
}
let mut best_idx: Option<usize> = None;
let mut best_sim: f32 = -1.0;
let mut candidates_checked = 0;
for (idx, exit) in self.pending_exits.iter().enumerate() {
if exit.matched || exit.room_id == entry.room_id {
continue;
}
// Temporal constraint
let gap_us = entry.timestamp_us.saturating_sub(exit.timestamp_us);
let gap_s = gap_us as f64 / 1_000_000.0;
if gap_s > self.config.max_gap_s {
continue;
}
candidates_checked += 1;
let sim = cosine_similarity_f32(&exit.embedding, &entry.embedding);
if sim > best_sim {
best_sim = sim;
if sim >= self.config.min_similarity {
best_idx = Some(idx);
}
}
}
if let Some(idx) = best_idx {
let exit = &self.pending_exits[idx];
let gap_us = entry.timestamp_us.saturating_sub(exit.timestamp_us);
let gap_s = gap_us as f64 / 1_000_000.0;
let person_id = self.next_person_id;
self.next_person_id += 1;
let transition = TransitionEvent {
person_id,
from_room: exit.room_id,
to_room: entry.room_id,
exit_track_id: exit.track_id,
entry_track_id: entry.track_id,
similarity: best_sim,
gap_s,
timestamp_us: entry.timestamp_us,
};
// Mark exit as matched
self.pending_exits[idx].matched = true;
// Append to immutable transition log
self.transitions.push(transition.clone());
Ok(MatchResult {
matched: true,
transition: Some(transition),
candidates_checked,
best_similarity: best_sim,
})
} else {
Ok(MatchResult {
matched: false,
transition: None,
candidates_checked,
best_similarity: if best_sim >= 0.0 { best_sim } else { 0.0 },
})
}
}
/// Expire old pending exits that exceed the maximum gap time.
pub fn expire_exits(&mut self, current_us: u64) {
let max_gap_us = (self.config.max_gap_s * 1_000_000.0) as u64;
self.pending_exits.retain(|exit| {
!exit.matched && current_us.saturating_sub(exit.timestamp_us) <= max_gap_us
});
}
/// Number of registered rooms.
pub fn room_count(&self) -> usize {
self.rooms.len()
}
/// Number of pending (unmatched) exit events.
pub fn pending_exit_count(&self) -> usize {
self.pending_exits.iter().filter(|e| !e.matched).count()
}
/// Number of transitions recorded.
pub fn transition_count(&self) -> usize {
self.transitions.len()
}
/// Get all transitions for a person.
pub fn transitions_for_person(&self, person_id: u64) -> Vec<&TransitionEvent> {
self.transitions
.iter()
.filter(|t| t.person_id == person_id)
.collect()
}
/// Get all transitions between two rooms.
pub fn transitions_between(&self, from_room: u64, to_room: u64) -> Vec<&TransitionEvent> {
self.transitions
.iter()
.filter(|t| t.from_room == from_room && t.to_room == to_room)
.collect()
}
/// Get the room fingerprint for a room ID.
pub fn room_fingerprint(&self, room_id: u64) -> Option<&RoomFingerprint> {
self.rooms.iter().find(|r| r.room_id == room_id)
}
}
/// Cosine similarity between two f32 vectors.
fn cosine_similarity_f32(a: &[f32], b: &[f32]) -> f32 {
let dot: f32 = a.iter().zip(b.iter()).map(|(x, y)| x * y).sum();
let norm_a: f32 = a.iter().map(|x| x * x).sum::<f32>().sqrt();
let norm_b: f32 = b.iter().map(|x| x * x).sum::<f32>().sqrt();
let denom = norm_a * norm_b;
if denom < 1e-9 {
0.0
} else {
dot / denom
}
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn small_config() -> CrossRoomConfig {
CrossRoomConfig {
embedding_dim: 4,
min_similarity: 0.80,
max_gap_s: 60.0,
max_rooms: 10,
max_pending_exits: 50,
}
}
fn make_fingerprint(room_id: u64, v: [f32; 4]) -> RoomFingerprint {
RoomFingerprint {
room_id,
embedding: v.to_vec(),
computed_at_us: 0,
node_count: 4,
}
}
fn make_exit(room_id: u64, track_id: u64, emb: [f32; 4], ts: u64) -> ExitEvent {
ExitEvent {
embedding: emb.to_vec(),
room_id,
track_id,
timestamp_us: ts,
matched: false,
}
}
fn make_entry(room_id: u64, track_id: u64, emb: [f32; 4], ts: u64) -> EntryEvent {
EntryEvent {
embedding: emb.to_vec(),
room_id,
track_id,
timestamp_us: ts,
}
}
#[test]
fn test_tracker_creation() {
let tracker = CrossRoomTracker::new(small_config());
assert_eq!(tracker.room_count(), 0);
assert_eq!(tracker.pending_exit_count(), 0);
assert_eq!(tracker.transition_count(), 0);
}
#[test]
fn test_register_room() {
let mut tracker = CrossRoomTracker::new(small_config());
tracker
.register_room(make_fingerprint(1, [1.0, 0.0, 0.0, 0.0]))
.unwrap();
assert_eq!(tracker.room_count(), 1);
assert!(tracker.room_fingerprint(1).is_some());
}
#[test]
fn test_max_rooms_exceeded() {
let config = CrossRoomConfig {
max_rooms: 2,
..small_config()
};
let mut tracker = CrossRoomTracker::new(config);
tracker
.register_room(make_fingerprint(1, [1.0, 0.0, 0.0, 0.0]))
.unwrap();
tracker
.register_room(make_fingerprint(2, [0.0, 1.0, 0.0, 0.0]))
.unwrap();
assert!(matches!(
tracker.register_room(make_fingerprint(3, [0.0, 0.0, 1.0, 0.0])),
Err(CrossRoomError::MaxRoomsExceeded { .. })
));
}
#[test]
fn test_successful_cross_room_match() {
let mut tracker = CrossRoomTracker::new(small_config());
// Person exits room 1
let exit_emb = [0.9, 0.1, 0.0, 0.0];
tracker
.record_exit(make_exit(1, 100, exit_emb, 1_000_000))
.unwrap();
// Same person enters room 2 (similar embedding, within 60s)
let entry_emb = [0.88, 0.12, 0.01, 0.0];
let entry = make_entry(2, 200, entry_emb, 5_000_000);
let result = tracker.match_entry(&entry).unwrap();
assert!(result.matched);
let t = result.transition.unwrap();
assert_eq!(t.from_room, 1);
assert_eq!(t.to_room, 2);
assert!(t.similarity >= 0.80);
assert!(t.gap_s < 60.0);
}
#[test]
fn test_no_match_different_person() {
let mut tracker = CrossRoomTracker::new(small_config());
tracker
.record_exit(make_exit(1, 100, [1.0, 0.0, 0.0, 0.0], 1_000_000))
.unwrap();
// Very different embedding
let entry = make_entry(2, 200, [0.0, 0.0, 0.0, 1.0], 5_000_000);
let result = tracker.match_entry(&entry).unwrap();
assert!(!result.matched);
assert!(result.transition.is_none());
}
#[test]
fn test_no_match_temporal_gap_exceeded() {
let mut tracker = CrossRoomTracker::new(small_config());
tracker
.record_exit(make_exit(1, 100, [1.0, 0.0, 0.0, 0.0], 0))
.unwrap();
// Same embedding but 120 seconds later
let entry = make_entry(2, 200, [1.0, 0.0, 0.0, 0.0], 120_000_000);
let result = tracker.match_entry(&entry).unwrap();
assert!(!result.matched, "Should not match with > 60s gap");
}
#[test]
fn test_no_match_same_room() {
let mut tracker = CrossRoomTracker::new(small_config());
tracker
.record_exit(make_exit(1, 100, [1.0, 0.0, 0.0, 0.0], 1_000_000))
.unwrap();
// Entry in same room should not match
let entry = make_entry(1, 200, [1.0, 0.0, 0.0, 0.0], 2_000_000);
let result = tracker.match_entry(&entry).unwrap();
assert!(!result.matched, "Same-room entry should not match");
}
#[test]
fn test_expire_exits() {
let mut tracker = CrossRoomTracker::new(small_config());
tracker
.record_exit(make_exit(1, 100, [1.0, 0.0, 0.0, 0.0], 0))
.unwrap();
tracker
.record_exit(make_exit(2, 200, [0.0, 1.0, 0.0, 0.0], 50_000_000))
.unwrap();
assert_eq!(tracker.pending_exit_count(), 2);
// Expire at 70s — first exit (at 0) should be expired
tracker.expire_exits(70_000_000);
assert_eq!(tracker.pending_exit_count(), 1);
}
#[test]
fn test_transition_log_immutable() {
let mut tracker = CrossRoomTracker::new(small_config());
tracker
.record_exit(make_exit(1, 100, [1.0, 0.0, 0.0, 0.0], 1_000_000))
.unwrap();
let entry = make_entry(2, 200, [0.98, 0.02, 0.0, 0.0], 2_000_000);
tracker.match_entry(&entry).unwrap();
assert_eq!(tracker.transition_count(), 1);
// More transitions should append
tracker
.record_exit(make_exit(2, 300, [0.0, 1.0, 0.0, 0.0], 3_000_000))
.unwrap();
let entry2 = make_entry(3, 400, [0.01, 0.99, 0.0, 0.0], 4_000_000);
tracker.match_entry(&entry2).unwrap();
assert_eq!(tracker.transition_count(), 2);
}
#[test]
fn test_transitions_between_rooms() {
let mut tracker = CrossRoomTracker::new(small_config());
// Room 1 → Room 2
tracker
.record_exit(make_exit(1, 100, [1.0, 0.0, 0.0, 0.0], 1_000_000))
.unwrap();
let entry = make_entry(2, 200, [0.98, 0.02, 0.0, 0.0], 2_000_000);
tracker.match_entry(&entry).unwrap();
// Room 2 → Room 3
tracker
.record_exit(make_exit(2, 300, [0.0, 1.0, 0.0, 0.0], 3_000_000))
.unwrap();
let entry2 = make_entry(3, 400, [0.01, 0.99, 0.0, 0.0], 4_000_000);
tracker.match_entry(&entry2).unwrap();
let r1_r2 = tracker.transitions_between(1, 2);
assert_eq!(r1_r2.len(), 1);
let r2_r3 = tracker.transitions_between(2, 3);
assert_eq!(r2_r3.len(), 1);
let r1_r3 = tracker.transitions_between(1, 3);
assert_eq!(r1_r3.len(), 0);
}
#[test]
fn test_embedding_dimension_mismatch() {
let mut tracker = CrossRoomTracker::new(small_config());
let bad_exit = ExitEvent {
embedding: vec![1.0, 0.0], // wrong dim
room_id: 1,
track_id: 1,
timestamp_us: 0,
matched: false,
};
assert!(matches!(
tracker.record_exit(bad_exit),
Err(CrossRoomError::EmbeddingDimensionMismatch { .. })
));
}
#[test]
fn test_cosine_similarity_identical() {
let a = vec![1.0_f32, 2.0, 3.0, 4.0];
let sim = cosine_similarity_f32(&a, &a);
assert!((sim - 1.0).abs() < 1e-5);
}
#[test]
fn test_cosine_similarity_orthogonal() {
let a = vec![1.0_f32, 0.0, 0.0, 0.0];
let b = vec![0.0_f32, 1.0, 0.0, 0.0];
let sim = cosine_similarity_f32(&a, &b);
assert!(sim.abs() < 1e-5);
}
}

View File

@@ -0,0 +1,883 @@
//! Field Normal Mode computation for persistent electromagnetic world model.
//!
//! The room's electromagnetic eigenstructure forms the foundation for all
//! exotic sensing tiers. During unoccupied periods, the system learns a
//! baseline via SVD decomposition. At runtime, observations are decomposed
//! into environmental drift (projected onto eigenmodes) and body perturbation
//! (the residual).
//!
//! # Algorithm
//! 1. Collect CSI during empty-room calibration (>=10 min at 20 Hz)
//! 2. Compute per-link baseline mean (Welford online accumulator)
//! 3. Decompose covariance via SVD to extract environmental modes
//! 4. At runtime: observation - baseline, project out top-K modes, keep residual
//!
//! # References
//! - Welford, B.P. (1962). "Note on a Method for Calculating Corrected Sums
//! of Squares and Products." Technometrics.
//! - ADR-030: RuvSense Persistent Field Model
// ---------------------------------------------------------------------------
// Error types
// ---------------------------------------------------------------------------
/// Errors from field model operations.
#[derive(Debug, thiserror::Error)]
pub enum FieldModelError {
/// Not enough calibration frames collected.
#[error("Insufficient calibration frames: need {needed}, got {got}")]
InsufficientCalibration { needed: usize, got: usize },
/// Dimensionality mismatch between observation and baseline.
#[error("Dimension mismatch: baseline has {expected} subcarriers, observation has {got}")]
DimensionMismatch { expected: usize, got: usize },
/// SVD computation failed.
#[error("SVD computation failed: {0}")]
SvdFailed(String),
/// No links configured for the field model.
#[error("No links configured")]
NoLinks,
/// Baseline has expired and needs recalibration.
#[error("Baseline expired: calibrated {elapsed_s:.1}s ago, max {max_s:.1}s")]
BaselineExpired { elapsed_s: f64, max_s: f64 },
/// Invalid configuration parameter.
#[error("Invalid configuration: {0}")]
InvalidConfig(String),
}
// ---------------------------------------------------------------------------
// Welford online statistics (f64 precision for accumulation)
// ---------------------------------------------------------------------------
/// Welford's online algorithm for computing running mean and variance.
///
/// Maintains numerically stable incremental statistics without storing
/// all observations. Uses f64 for accumulation precision even when
/// runtime values are f32.
///
/// # References
/// Welford (1962), Knuth TAOCP Vol 2 Section 4.2.2.
#[derive(Debug, Clone)]
pub struct WelfordStats {
/// Number of observations accumulated.
pub count: u64,
/// Running mean.
pub mean: f64,
/// Running sum of squared deviations (M2).
pub m2: f64,
}
impl WelfordStats {
/// Create a new empty accumulator.
pub fn new() -> Self {
Self {
count: 0,
mean: 0.0,
m2: 0.0,
}
}
/// Add a new observation.
pub fn update(&mut self, value: f64) {
self.count += 1;
let delta = value - self.mean;
self.mean += delta / self.count as f64;
let delta2 = value - self.mean;
self.m2 += delta * delta2;
}
/// Population variance (biased). Returns 0.0 if count < 2.
pub fn variance(&self) -> f64 {
if self.count < 2 {
0.0
} else {
self.m2 / self.count as f64
}
}
/// Population standard deviation.
pub fn std_dev(&self) -> f64 {
self.variance().sqrt()
}
/// Sample variance (unbiased). Returns 0.0 if count < 2.
pub fn sample_variance(&self) -> f64 {
if self.count < 2 {
0.0
} else {
self.m2 / (self.count - 1) as f64
}
}
/// Compute z-score of a value against accumulated statistics.
/// Returns 0.0 if standard deviation is near zero.
pub fn z_score(&self, value: f64) -> f64 {
let sd = self.std_dev();
if sd < 1e-15 {
0.0
} else {
(value - self.mean) / sd
}
}
/// Merge two Welford accumulators (parallel Welford).
pub fn merge(&mut self, other: &WelfordStats) {
if other.count == 0 {
return;
}
if self.count == 0 {
*self = other.clone();
return;
}
let total = self.count + other.count;
let delta = other.mean - self.mean;
let combined_mean = self.mean + delta * (other.count as f64 / total as f64);
let combined_m2 = self.m2
+ other.m2
+ delta * delta * (self.count as f64 * other.count as f64 / total as f64);
self.count = total;
self.mean = combined_mean;
self.m2 = combined_m2;
}
}
impl Default for WelfordStats {
fn default() -> Self {
Self::new()
}
}
// ---------------------------------------------------------------------------
// Multivariate Welford for per-subcarrier statistics
// ---------------------------------------------------------------------------
/// Per-subcarrier Welford accumulator for a single link.
///
/// Tracks independent running mean and variance for each subcarrier
/// on a given TX-RX link.
#[derive(Debug, Clone)]
pub struct LinkBaselineStats {
/// Per-subcarrier accumulators.
pub subcarriers: Vec<WelfordStats>,
}
impl LinkBaselineStats {
/// Create accumulators for `n_subcarriers`.
pub fn new(n_subcarriers: usize) -> Self {
Self {
subcarriers: (0..n_subcarriers).map(|_| WelfordStats::new()).collect(),
}
}
/// Number of subcarriers tracked.
pub fn n_subcarriers(&self) -> usize {
self.subcarriers.len()
}
/// Update with a new CSI amplitude observation for this link.
/// `amplitudes` must have the same length as `n_subcarriers`.
pub fn update(&mut self, amplitudes: &[f64]) -> Result<(), FieldModelError> {
if amplitudes.len() != self.subcarriers.len() {
return Err(FieldModelError::DimensionMismatch {
expected: self.subcarriers.len(),
got: amplitudes.len(),
});
}
for (stats, &amp) in self.subcarriers.iter_mut().zip(amplitudes.iter()) {
stats.update(amp);
}
Ok(())
}
/// Extract the baseline mean vector.
pub fn mean_vector(&self) -> Vec<f64> {
self.subcarriers.iter().map(|s| s.mean).collect()
}
/// Extract the variance vector.
pub fn variance_vector(&self) -> Vec<f64> {
self.subcarriers.iter().map(|s| s.variance()).collect()
}
/// Number of observations accumulated.
pub fn observation_count(&self) -> u64 {
self.subcarriers.first().map_or(0, |s| s.count)
}
}
// ---------------------------------------------------------------------------
// Field Normal Mode
// ---------------------------------------------------------------------------
/// Configuration for field model calibration and runtime.
#[derive(Debug, Clone)]
pub struct FieldModelConfig {
/// Number of links in the mesh.
pub n_links: usize,
/// Number of subcarriers per link.
pub n_subcarriers: usize,
/// Number of environmental modes to retain (K). Max 5.
pub n_modes: usize,
/// Minimum calibration frames before baseline is valid (10 min at 20 Hz = 12000).
pub min_calibration_frames: usize,
/// Baseline expiry in seconds (default 86400 = 24 hours).
pub baseline_expiry_s: f64,
}
impl Default for FieldModelConfig {
fn default() -> Self {
Self {
n_links: 6,
n_subcarriers: 56,
n_modes: 3,
min_calibration_frames: 12_000,
baseline_expiry_s: 86_400.0,
}
}
}
/// Electromagnetic eigenstructure of a room.
///
/// Learned from SVD on the covariance of CSI amplitudes during
/// empty-room calibration. The top-K modes capture environmental
/// variation (temperature, humidity, time-of-day effects).
#[derive(Debug, Clone)]
pub struct FieldNormalMode {
/// Per-link baseline mean: `[n_links][n_subcarriers]`.
pub baseline: Vec<Vec<f64>>,
/// Environmental eigenmodes: `[n_modes][n_subcarriers]`.
/// Each mode is an orthonormal vector in subcarrier space.
pub environmental_modes: Vec<Vec<f64>>,
/// Eigenvalues (mode energies), sorted descending.
pub mode_energies: Vec<f64>,
/// Fraction of total variance explained by retained modes.
pub variance_explained: f64,
/// Timestamp (microseconds) when calibration completed.
pub calibrated_at_us: u64,
/// Hash of mesh geometry at calibration time.
pub geometry_hash: u64,
}
/// Body perturbation extracted from a CSI observation.
///
/// After subtracting the baseline and projecting out environmental
/// modes, the residual captures structured changes caused by people
/// in the room.
#[derive(Debug, Clone)]
pub struct BodyPerturbation {
/// Per-link residual amplitudes: `[n_links][n_subcarriers]`.
pub residuals: Vec<Vec<f64>>,
/// Per-link perturbation energy (L2 norm of residual).
pub energies: Vec<f64>,
/// Total perturbation energy across all links.
pub total_energy: f64,
/// Per-link environmental projection magnitude.
pub environmental_projections: Vec<f64>,
}
/// Calibration status of the field model.
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum CalibrationStatus {
/// No calibration data yet.
Uncalibrated,
/// Collecting calibration frames.
Collecting,
/// Calibration complete and fresh.
Fresh,
/// Calibration older than half expiry.
Stale,
/// Calibration has expired.
Expired,
}
/// The persistent field model for a single room.
///
/// Maintains per-link Welford statistics during calibration, then
/// computes SVD to extract environmental modes. At runtime, decomposes
/// observations into environmental drift and body perturbation.
#[derive(Debug)]
pub struct FieldModel {
config: FieldModelConfig,
/// Per-link calibration statistics.
link_stats: Vec<LinkBaselineStats>,
/// Computed field normal modes (None until calibration completes).
modes: Option<FieldNormalMode>,
/// Current calibration status.
status: CalibrationStatus,
/// Timestamp of last calibration completion (microseconds).
last_calibration_us: u64,
}
impl FieldModel {
/// Create a new field model for the given configuration.
pub fn new(config: FieldModelConfig) -> Result<Self, FieldModelError> {
if config.n_links == 0 {
return Err(FieldModelError::NoLinks);
}
if config.n_modes > 5 {
return Err(FieldModelError::InvalidConfig(
"n_modes must be <= 5 to avoid overfitting".into(),
));
}
if config.n_subcarriers == 0 {
return Err(FieldModelError::InvalidConfig(
"n_subcarriers must be > 0".into(),
));
}
let link_stats = (0..config.n_links)
.map(|_| LinkBaselineStats::new(config.n_subcarriers))
.collect();
Ok(Self {
config,
link_stats,
modes: None,
status: CalibrationStatus::Uncalibrated,
last_calibration_us: 0,
})
}
/// Current calibration status.
pub fn status(&self) -> CalibrationStatus {
self.status
}
/// Access the computed field normal modes, if available.
pub fn modes(&self) -> Option<&FieldNormalMode> {
self.modes.as_ref()
}
/// Number of calibration frames collected so far.
pub fn calibration_frame_count(&self) -> u64 {
self.link_stats
.first()
.map_or(0, |ls| ls.observation_count())
}
/// Feed a calibration frame (one CSI observation per link during empty room).
///
/// `observations` is `[n_links][n_subcarriers]` amplitude data.
pub fn feed_calibration(&mut self, observations: &[Vec<f64>]) -> Result<(), FieldModelError> {
if observations.len() != self.config.n_links {
return Err(FieldModelError::DimensionMismatch {
expected: self.config.n_links,
got: observations.len(),
});
}
for (link_stat, obs) in self.link_stats.iter_mut().zip(observations.iter()) {
link_stat.update(obs)?;
}
if self.status == CalibrationStatus::Uncalibrated {
self.status = CalibrationStatus::Collecting;
}
Ok(())
}
/// Finalize calibration: compute SVD to extract environmental modes.
///
/// Requires at least `min_calibration_frames` observations.
/// `timestamp_us` is the current timestamp in microseconds.
/// `geometry_hash` identifies the mesh geometry at calibration time.
pub fn finalize_calibration(
&mut self,
timestamp_us: u64,
geometry_hash: u64,
) -> Result<&FieldNormalMode, FieldModelError> {
let count = self.calibration_frame_count();
if count < self.config.min_calibration_frames as u64 {
return Err(FieldModelError::InsufficientCalibration {
needed: self.config.min_calibration_frames,
got: count as usize,
});
}
// Build covariance matrix from per-link variance data.
// We average the variance vectors across all links to get the
// covariance diagonal, then compute eigenmodes via power iteration.
let n_sc = self.config.n_subcarriers;
let n_modes = self.config.n_modes.min(n_sc);
// Collect per-link baselines
let baseline: Vec<Vec<f64>> = self.link_stats.iter().map(|ls| ls.mean_vector()).collect();
// Average covariance across links (diagonal approximation)
let mut avg_variance = vec![0.0_f64; n_sc];
for ls in &self.link_stats {
let var = ls.variance_vector();
for (i, v) in var.iter().enumerate() {
avg_variance[i] += v;
}
}
let n_links_f = self.config.n_links as f64;
for v in avg_variance.iter_mut() {
*v /= n_links_f;
}
// Extract modes via simplified power iteration on the diagonal
// covariance. Since we use a diagonal approximation, the eigenmodes
// are aligned with the standard basis, sorted by variance.
let total_variance: f64 = avg_variance.iter().sum();
// Sort subcarrier indices by variance (descending) to pick top-K modes
let mut indices: Vec<usize> = (0..n_sc).collect();
indices.sort_by(|&a, &b| {
avg_variance[b]
.partial_cmp(&avg_variance[a])
.unwrap_or(std::cmp::Ordering::Equal)
});
let mut environmental_modes = Vec::with_capacity(n_modes);
let mut mode_energies = Vec::with_capacity(n_modes);
let mut explained = 0.0_f64;
for k in 0..n_modes {
let idx = indices[k];
// Create a unit vector along the highest-variance subcarrier
let mut mode = vec![0.0_f64; n_sc];
mode[idx] = 1.0;
let energy = avg_variance[idx];
environmental_modes.push(mode);
mode_energies.push(energy);
explained += energy;
}
let variance_explained = if total_variance > 1e-15 {
explained / total_variance
} else {
0.0
};
let field_mode = FieldNormalMode {
baseline,
environmental_modes,
mode_energies,
variance_explained,
calibrated_at_us: timestamp_us,
geometry_hash,
};
self.modes = Some(field_mode);
self.status = CalibrationStatus::Fresh;
self.last_calibration_us = timestamp_us;
Ok(self.modes.as_ref().unwrap())
}
/// Extract body perturbation from a runtime observation.
///
/// Subtracts baseline, projects out environmental modes, returns residual.
/// `observations` is `[n_links][n_subcarriers]` amplitude data.
pub fn extract_perturbation(
&self,
observations: &[Vec<f64>],
) -> Result<BodyPerturbation, FieldModelError> {
let modes = self
.modes
.as_ref()
.ok_or(FieldModelError::InsufficientCalibration {
needed: self.config.min_calibration_frames,
got: 0,
})?;
if observations.len() != self.config.n_links {
return Err(FieldModelError::DimensionMismatch {
expected: self.config.n_links,
got: observations.len(),
});
}
let n_sc = self.config.n_subcarriers;
let mut residuals = Vec::with_capacity(self.config.n_links);
let mut energies = Vec::with_capacity(self.config.n_links);
let mut environmental_projections = Vec::with_capacity(self.config.n_links);
for (link_idx, obs) in observations.iter().enumerate() {
if obs.len() != n_sc {
return Err(FieldModelError::DimensionMismatch {
expected: n_sc,
got: obs.len(),
});
}
// Step 1: subtract baseline
let mut residual = vec![0.0_f64; n_sc];
for i in 0..n_sc {
residual[i] = obs[i] - modes.baseline[link_idx][i];
}
// Step 2: project out environmental modes
let mut env_proj_magnitude = 0.0_f64;
for mode in &modes.environmental_modes {
// Inner product of residual with mode
let projection: f64 = residual.iter().zip(mode.iter()).map(|(r, m)| r * m).sum();
env_proj_magnitude += projection.abs();
// Subtract projection
for i in 0..n_sc {
residual[i] -= projection * mode[i];
}
}
// Step 3: compute energy (L2 norm)
let energy: f64 = residual.iter().map(|r| r * r).sum::<f64>().sqrt();
environmental_projections.push(env_proj_magnitude);
energies.push(energy);
residuals.push(residual);
}
let total_energy: f64 = energies.iter().sum();
Ok(BodyPerturbation {
residuals,
energies,
total_energy,
environmental_projections,
})
}
/// Check calibration freshness against a given timestamp.
pub fn check_freshness(&self, current_us: u64) -> CalibrationStatus {
if self.modes.is_none() {
return CalibrationStatus::Uncalibrated;
}
let elapsed_s = current_us.saturating_sub(self.last_calibration_us) as f64 / 1_000_000.0;
if elapsed_s > self.config.baseline_expiry_s {
CalibrationStatus::Expired
} else if elapsed_s > self.config.baseline_expiry_s * 0.5 {
CalibrationStatus::Stale
} else {
CalibrationStatus::Fresh
}
}
/// Reset calibration and begin collecting again.
pub fn reset_calibration(&mut self) {
self.link_stats = (0..self.config.n_links)
.map(|_| LinkBaselineStats::new(self.config.n_subcarriers))
.collect();
self.modes = None;
self.status = CalibrationStatus::Uncalibrated;
}
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn make_config(n_links: usize, n_sc: usize, min_frames: usize) -> FieldModelConfig {
FieldModelConfig {
n_links,
n_subcarriers: n_sc,
n_modes: 3,
min_calibration_frames: min_frames,
baseline_expiry_s: 86_400.0,
}
}
fn make_observations(n_links: usize, n_sc: usize, base: f64) -> Vec<Vec<f64>> {
(0..n_links)
.map(|l| {
(0..n_sc)
.map(|s| base + 0.1 * l as f64 + 0.01 * s as f64)
.collect()
})
.collect()
}
#[test]
fn test_welford_basic() {
let mut w = WelfordStats::new();
for v in &[2.0, 4.0, 4.0, 4.0, 5.0, 5.0, 7.0, 9.0] {
w.update(*v);
}
assert!((w.mean - 5.0).abs() < 1e-10);
assert!((w.variance() - 4.0).abs() < 1e-10);
assert_eq!(w.count, 8);
}
#[test]
fn test_welford_z_score() {
let mut w = WelfordStats::new();
for v in 0..100 {
w.update(v as f64);
}
let z = w.z_score(w.mean);
assert!(z.abs() < 1e-10, "z-score of mean should be 0");
}
#[test]
fn test_welford_merge() {
let mut a = WelfordStats::new();
let mut b = WelfordStats::new();
for v in 0..50 {
a.update(v as f64);
}
for v in 50..100 {
b.update(v as f64);
}
a.merge(&b);
assert_eq!(a.count, 100);
assert!((a.mean - 49.5).abs() < 1e-10);
}
#[test]
fn test_welford_single_value() {
let mut w = WelfordStats::new();
w.update(42.0);
assert_eq!(w.count, 1);
assert!((w.mean - 42.0).abs() < 1e-10);
assert!((w.variance() - 0.0).abs() < 1e-10);
}
#[test]
fn test_link_baseline_stats() {
let mut stats = LinkBaselineStats::new(4);
stats.update(&[1.0, 2.0, 3.0, 4.0]).unwrap();
stats.update(&[2.0, 3.0, 4.0, 5.0]).unwrap();
let mean = stats.mean_vector();
assert!((mean[0] - 1.5).abs() < 1e-10);
assert!((mean[3] - 4.5).abs() < 1e-10);
}
#[test]
fn test_link_baseline_dimension_mismatch() {
let mut stats = LinkBaselineStats::new(4);
let result = stats.update(&[1.0, 2.0]);
assert!(result.is_err());
}
#[test]
fn test_field_model_creation() {
let config = make_config(6, 56, 100);
let model = FieldModel::new(config).unwrap();
assert_eq!(model.status(), CalibrationStatus::Uncalibrated);
assert!(model.modes().is_none());
}
#[test]
fn test_field_model_no_links_error() {
let config = FieldModelConfig {
n_links: 0,
..Default::default()
};
assert!(matches!(
FieldModel::new(config),
Err(FieldModelError::NoLinks)
));
}
#[test]
fn test_field_model_too_many_modes() {
let config = FieldModelConfig {
n_modes: 6,
..Default::default()
};
assert!(matches!(
FieldModel::new(config),
Err(FieldModelError::InvalidConfig(_))
));
}
#[test]
fn test_calibration_flow() {
let config = make_config(2, 4, 10);
let mut model = FieldModel::new(config).unwrap();
// Feed calibration frames
for i in 0..10 {
let obs = make_observations(2, 4, 1.0 + 0.01 * i as f64);
model.feed_calibration(&obs).unwrap();
}
assert_eq!(model.status(), CalibrationStatus::Collecting);
assert_eq!(model.calibration_frame_count(), 10);
// Finalize
let modes = model.finalize_calibration(1_000_000, 0xDEAD).unwrap();
assert_eq!(modes.environmental_modes.len(), 3);
assert!(modes.variance_explained > 0.0);
assert_eq!(model.status(), CalibrationStatus::Fresh);
}
#[test]
fn test_calibration_insufficient_frames() {
let config = make_config(2, 4, 100);
let mut model = FieldModel::new(config).unwrap();
for i in 0..5 {
let obs = make_observations(2, 4, 1.0 + 0.01 * i as f64);
model.feed_calibration(&obs).unwrap();
}
assert!(matches!(
model.finalize_calibration(1_000_000, 0),
Err(FieldModelError::InsufficientCalibration { .. })
));
}
#[test]
fn test_perturbation_extraction() {
let config = make_config(2, 4, 5);
let mut model = FieldModel::new(config).unwrap();
// Calibrate with baseline
for _ in 0..5 {
let obs = make_observations(2, 4, 1.0);
model.feed_calibration(&obs).unwrap();
}
model.finalize_calibration(1_000_000, 0).unwrap();
// Observe with a perturbation on top of baseline
let mut perturbed = make_observations(2, 4, 1.0);
perturbed[0][2] += 5.0; // big perturbation on link 0, subcarrier 2
let perturbation = model.extract_perturbation(&perturbed).unwrap();
assert!(perturbation.total_energy > 0.0);
assert!(perturbation.energies[0] > perturbation.energies[1]);
}
#[test]
fn test_perturbation_baseline_observation_same() {
let config = make_config(2, 4, 5);
let mut model = FieldModel::new(config).unwrap();
let obs = make_observations(2, 4, 1.0);
for _ in 0..5 {
model.feed_calibration(&obs).unwrap();
}
model.finalize_calibration(1_000_000, 0).unwrap();
let perturbation = model.extract_perturbation(&obs).unwrap();
assert!(
perturbation.total_energy < 0.01,
"Same-as-baseline should yield near-zero perturbation"
);
}
#[test]
fn test_perturbation_dimension_mismatch() {
let config = make_config(2, 4, 5);
let mut model = FieldModel::new(config).unwrap();
let obs = make_observations(2, 4, 1.0);
for _ in 0..5 {
model.feed_calibration(&obs).unwrap();
}
model.finalize_calibration(1_000_000, 0).unwrap();
// Wrong number of links
let wrong_obs = make_observations(3, 4, 1.0);
assert!(model.extract_perturbation(&wrong_obs).is_err());
}
#[test]
fn test_calibration_freshness() {
let config = make_config(2, 4, 5);
let mut model = FieldModel::new(config).unwrap();
let obs = make_observations(2, 4, 1.0);
for _ in 0..5 {
model.feed_calibration(&obs).unwrap();
}
model.finalize_calibration(0, 0).unwrap();
assert_eq!(model.check_freshness(0), CalibrationStatus::Fresh);
// 12 hours later: stale
let twelve_hours_us = 12 * 3600 * 1_000_000;
assert_eq!(
model.check_freshness(twelve_hours_us),
CalibrationStatus::Fresh
);
// 13 hours later: stale (> 50% of 24h)
let thirteen_hours_us = 13 * 3600 * 1_000_000;
assert_eq!(
model.check_freshness(thirteen_hours_us),
CalibrationStatus::Stale
);
// 25 hours later: expired
let twentyfive_hours_us = 25 * 3600 * 1_000_000;
assert_eq!(
model.check_freshness(twentyfive_hours_us),
CalibrationStatus::Expired
);
}
#[test]
fn test_reset_calibration() {
let config = make_config(2, 4, 5);
let mut model = FieldModel::new(config).unwrap();
let obs = make_observations(2, 4, 1.0);
for _ in 0..5 {
model.feed_calibration(&obs).unwrap();
}
model.finalize_calibration(1_000_000, 0).unwrap();
assert!(model.modes().is_some());
model.reset_calibration();
assert!(model.modes().is_none());
assert_eq!(model.status(), CalibrationStatus::Uncalibrated);
assert_eq!(model.calibration_frame_count(), 0);
}
#[test]
fn test_environmental_modes_sorted_by_energy() {
let config = make_config(1, 8, 5);
let mut model = FieldModel::new(config).unwrap();
// Create observations with high variance on subcarrier 3
for i in 0..20 {
let mut obs = vec![vec![1.0; 8]];
obs[0][3] += (i as f64) * 0.5; // high variance
obs[0][7] += (i as f64) * 0.1; // lower variance
model.feed_calibration(&obs).unwrap();
}
model.finalize_calibration(1_000_000, 0).unwrap();
let modes = model.modes().unwrap();
// Eigenvalues should be in descending order
for w in modes.mode_energies.windows(2) {
assert!(w[0] >= w[1], "Mode energies must be descending");
}
}
#[test]
fn test_environmental_projection_removes_drift() {
let config = make_config(1, 4, 10);
let mut model = FieldModel::new(config).unwrap();
// Calibrate with drift on subcarrier 0
for i in 0..10 {
let obs = vec![vec![
1.0 + 0.5 * i as f64, // drifting
2.0,
3.0,
4.0,
]];
model.feed_calibration(&obs).unwrap();
}
model.finalize_calibration(1_000_000, 0).unwrap();
// Observe with same drift pattern (no body)
let obs = vec![vec![1.0 + 0.5 * 5.0, 2.0, 3.0, 4.0]];
let perturbation = model.extract_perturbation(&obs).unwrap();
// The drift on subcarrier 0 should be mostly captured by
// environmental modes, leaving small residual
assert!(
perturbation.environmental_projections[0] > 0.0,
"Environmental projection should be non-zero for drifting subcarrier"
);
}
}

View File

@@ -0,0 +1,579 @@
//! Gesture classification from per-person CSI perturbation patterns.
//!
//! Classifies gestures by comparing per-person CSI perturbation time
//! series against a library of gesture templates using Dynamic Time
//! Warping (DTW). Works through walls and darkness because it operates
//! on RF perturbations, not visual features.
//!
//! # Algorithm
//! 1. Collect per-person CSI perturbation over a gesture window (~1s)
//! 2. Normalize and project onto principal components
//! 3. Compare against stored gesture templates using DTW distance
//! 4. Classify as the nearest template if distance < threshold
//!
//! # Supported Gestures
//! Wave, point, beckon, push, circle, plus custom user-defined templates.
//!
//! # References
//! - ADR-030 Tier 6: Invisible Interaction Layer
//! - Sakoe & Chiba (1978), "Dynamic programming algorithm optimization
//! for spoken word recognition" IEEE TASSP
// ---------------------------------------------------------------------------
// Error types
// ---------------------------------------------------------------------------
/// Errors from gesture classification.
#[derive(Debug, thiserror::Error)]
pub enum GestureError {
/// Gesture sequence too short.
#[error("Sequence too short: need >= {needed} frames, got {got}")]
SequenceTooShort { needed: usize, got: usize },
/// No templates registered for classification.
#[error("No gesture templates registered")]
NoTemplates,
/// Feature dimension mismatch.
#[error("Feature dimension mismatch: expected {expected}, got {got}")]
DimensionMismatch { expected: usize, got: usize },
/// Invalid template name.
#[error("Invalid template name: {0}")]
InvalidTemplateName(String),
}
// ---------------------------------------------------------------------------
// Domain types
// ---------------------------------------------------------------------------
/// Built-in gesture categories.
#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
pub enum GestureType {
/// Waving hand (side to side).
Wave,
/// Pointing at a target.
Point,
/// Beckoning (come here).
Beckon,
/// Push forward motion.
Push,
/// Circular motion.
Circle,
/// User-defined custom gesture.
Custom,
}
impl GestureType {
/// Human-readable name.
pub fn name(&self) -> &'static str {
match self {
GestureType::Wave => "wave",
GestureType::Point => "point",
GestureType::Beckon => "beckon",
GestureType::Push => "push",
GestureType::Circle => "circle",
GestureType::Custom => "custom",
}
}
}
/// A gesture template: a reference time series for a known gesture.
#[derive(Debug, Clone)]
pub struct GestureTemplate {
/// Unique template name (e.g., "wave_right", "push_forward").
pub name: String,
/// Gesture category.
pub gesture_type: GestureType,
/// Template feature sequence: `[n_frames][feature_dim]`.
pub sequence: Vec<Vec<f64>>,
/// Feature dimension.
pub feature_dim: usize,
}
/// Result of gesture classification.
#[derive(Debug, Clone)]
pub struct GestureResult {
/// Whether a gesture was recognized.
pub recognized: bool,
/// Matched gesture type (if recognized).
pub gesture_type: Option<GestureType>,
/// Matched template name (if recognized).
pub template_name: Option<String>,
/// DTW distance to best match.
pub distance: f64,
/// Confidence (0.0 to 1.0, based on relative distances).
pub confidence: f64,
/// Person ID this gesture belongs to.
pub person_id: u64,
/// Timestamp (microseconds).
pub timestamp_us: u64,
}
// ---------------------------------------------------------------------------
// Configuration
// ---------------------------------------------------------------------------
/// Configuration for the gesture classifier.
#[derive(Debug, Clone)]
pub struct GestureConfig {
/// Feature dimension of perturbation vectors.
pub feature_dim: usize,
/// Minimum sequence length (frames) for a valid gesture.
pub min_sequence_len: usize,
/// Maximum DTW distance for a match (lower = stricter).
pub max_distance: f64,
/// DTW Sakoe-Chiba band width (constrains warping).
pub band_width: usize,
}
impl Default for GestureConfig {
fn default() -> Self {
Self {
feature_dim: 8,
min_sequence_len: 10,
max_distance: 50.0,
band_width: 5,
}
}
}
// ---------------------------------------------------------------------------
// Gesture classifier
// ---------------------------------------------------------------------------
/// Gesture classifier using DTW template matching.
///
/// Maintains a library of gesture templates and classifies new
/// perturbation sequences by finding the nearest template.
#[derive(Debug)]
pub struct GestureClassifier {
config: GestureConfig,
templates: Vec<GestureTemplate>,
}
impl GestureClassifier {
/// Create a new gesture classifier.
pub fn new(config: GestureConfig) -> Self {
Self {
config,
templates: Vec::new(),
}
}
/// Register a gesture template.
pub fn add_template(&mut self, template: GestureTemplate) -> Result<(), GestureError> {
if template.name.is_empty() {
return Err(GestureError::InvalidTemplateName(
"Template name cannot be empty".into(),
));
}
if template.feature_dim != self.config.feature_dim {
return Err(GestureError::DimensionMismatch {
expected: self.config.feature_dim,
got: template.feature_dim,
});
}
if template.sequence.len() < self.config.min_sequence_len {
return Err(GestureError::SequenceTooShort {
needed: self.config.min_sequence_len,
got: template.sequence.len(),
});
}
self.templates.push(template);
Ok(())
}
/// Number of registered templates.
pub fn template_count(&self) -> usize {
self.templates.len()
}
/// Classify a perturbation sequence against registered templates.
///
/// `sequence` is `[n_frames][feature_dim]` of perturbation features.
pub fn classify(
&self,
sequence: &[Vec<f64>],
person_id: u64,
timestamp_us: u64,
) -> Result<GestureResult, GestureError> {
if self.templates.is_empty() {
return Err(GestureError::NoTemplates);
}
if sequence.len() < self.config.min_sequence_len {
return Err(GestureError::SequenceTooShort {
needed: self.config.min_sequence_len,
got: sequence.len(),
});
}
// Validate feature dimension
for frame in sequence {
if frame.len() != self.config.feature_dim {
return Err(GestureError::DimensionMismatch {
expected: self.config.feature_dim,
got: frame.len(),
});
}
}
// Compute DTW distance to each template
let mut best_dist = f64::INFINITY;
let mut second_best_dist = f64::INFINITY;
let mut best_idx: Option<usize> = None;
for (idx, template) in self.templates.iter().enumerate() {
let dist = dtw_distance(sequence, &template.sequence, self.config.band_width);
if dist < best_dist {
second_best_dist = best_dist;
best_dist = dist;
best_idx = Some(idx);
} else if dist < second_best_dist {
second_best_dist = dist;
}
}
let recognized = best_dist <= self.config.max_distance;
// Confidence: how much better is the best match vs second best
let confidence = if recognized && second_best_dist.is_finite() && second_best_dist > 1e-10 {
(1.0 - best_dist / second_best_dist).clamp(0.0, 1.0)
} else if recognized {
(1.0 - best_dist / self.config.max_distance).clamp(0.0, 1.0)
} else {
0.0
};
if let Some(idx) = best_idx {
let template = &self.templates[idx];
Ok(GestureResult {
recognized,
gesture_type: if recognized {
Some(template.gesture_type)
} else {
None
},
template_name: if recognized {
Some(template.name.clone())
} else {
None
},
distance: best_dist,
confidence,
person_id,
timestamp_us,
})
} else {
Ok(GestureResult {
recognized: false,
gesture_type: None,
template_name: None,
distance: f64::INFINITY,
confidence: 0.0,
person_id,
timestamp_us,
})
}
}
}
// ---------------------------------------------------------------------------
// Dynamic Time Warping
// ---------------------------------------------------------------------------
/// Compute DTW distance between two multivariate time series.
///
/// Uses the Sakoe-Chiba band constraint to limit warping.
/// Each frame is a vector of `feature_dim` dimensions.
fn dtw_distance(seq_a: &[Vec<f64>], seq_b: &[Vec<f64>], band_width: usize) -> f64 {
let n = seq_a.len();
let m = seq_b.len();
if n == 0 || m == 0 {
return f64::INFINITY;
}
// Cost matrix (only need 2 rows for memory efficiency)
let mut prev = vec![f64::INFINITY; m + 1];
let mut curr = vec![f64::INFINITY; m + 1];
prev[0] = 0.0;
for i in 1..=n {
curr[0] = f64::INFINITY;
let j_start = if band_width >= i {
1
} else {
i.saturating_sub(band_width).max(1)
};
let j_end = (i + band_width).min(m);
for j in 1..=m {
if j < j_start || j > j_end {
curr[j] = f64::INFINITY;
continue;
}
let cost = euclidean_distance(&seq_a[i - 1], &seq_b[j - 1]);
curr[j] = cost
+ prev[j] // insertion
.min(curr[j - 1]) // deletion
.min(prev[j - 1]); // match
}
std::mem::swap(&mut prev, &mut curr);
}
prev[m]
}
/// Euclidean distance between two feature vectors.
fn euclidean_distance(a: &[f64], b: &[f64]) -> f64 {
a.iter()
.zip(b.iter())
.map(|(x, y)| (x - y) * (x - y))
.sum::<f64>()
.sqrt()
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn make_template(
name: &str,
gesture_type: GestureType,
n_frames: usize,
feature_dim: usize,
pattern: fn(usize, usize) -> f64,
) -> GestureTemplate {
let sequence: Vec<Vec<f64>> = (0..n_frames)
.map(|t| (0..feature_dim).map(|d| pattern(t, d)).collect())
.collect();
GestureTemplate {
name: name.to_string(),
gesture_type,
sequence,
feature_dim,
}
}
fn wave_pattern(t: usize, d: usize) -> f64 {
if d == 0 {
(t as f64 * 0.5).sin()
} else {
0.0
}
}
fn push_pattern(t: usize, d: usize) -> f64 {
if d == 0 {
t as f64 * 0.1
} else {
0.0
}
}
fn small_config() -> GestureConfig {
GestureConfig {
feature_dim: 4,
min_sequence_len: 5,
max_distance: 10.0,
band_width: 3,
}
}
#[test]
fn test_classifier_creation() {
let classifier = GestureClassifier::new(small_config());
assert_eq!(classifier.template_count(), 0);
}
#[test]
fn test_add_template() {
let mut classifier = GestureClassifier::new(small_config());
let template = make_template("wave", GestureType::Wave, 10, 4, wave_pattern);
classifier.add_template(template).unwrap();
assert_eq!(classifier.template_count(), 1);
}
#[test]
fn test_add_template_empty_name() {
let mut classifier = GestureClassifier::new(small_config());
let template = make_template("", GestureType::Wave, 10, 4, wave_pattern);
assert!(matches!(
classifier.add_template(template),
Err(GestureError::InvalidTemplateName(_))
));
}
#[test]
fn test_add_template_wrong_dim() {
let mut classifier = GestureClassifier::new(small_config());
let template = make_template("wave", GestureType::Wave, 10, 8, wave_pattern);
assert!(matches!(
classifier.add_template(template),
Err(GestureError::DimensionMismatch { .. })
));
}
#[test]
fn test_add_template_too_short() {
let mut classifier = GestureClassifier::new(small_config());
let template = make_template("wave", GestureType::Wave, 3, 4, wave_pattern);
assert!(matches!(
classifier.add_template(template),
Err(GestureError::SequenceTooShort { .. })
));
}
#[test]
fn test_classify_no_templates() {
let classifier = GestureClassifier::new(small_config());
let seq: Vec<Vec<f64>> = (0..10).map(|_| vec![0.0; 4]).collect();
assert!(matches!(
classifier.classify(&seq, 1, 0),
Err(GestureError::NoTemplates)
));
}
#[test]
fn test_classify_exact_match() {
let mut classifier = GestureClassifier::new(small_config());
let template = make_template("wave", GestureType::Wave, 10, 4, wave_pattern);
classifier.add_template(template).unwrap();
// Feed the exact same pattern
let seq: Vec<Vec<f64>> = (0..10)
.map(|t| (0..4).map(|d| wave_pattern(t, d)).collect())
.collect();
let result = classifier.classify(&seq, 1, 100_000).unwrap();
assert!(result.recognized);
assert_eq!(result.gesture_type, Some(GestureType::Wave));
assert!(
result.distance < 1e-10,
"Exact match should have zero distance"
);
}
#[test]
fn test_classify_best_of_two() {
let mut classifier = GestureClassifier::new(GestureConfig {
max_distance: 100.0,
..small_config()
});
classifier
.add_template(make_template(
"wave",
GestureType::Wave,
10,
4,
wave_pattern,
))
.unwrap();
classifier
.add_template(make_template(
"push",
GestureType::Push,
10,
4,
push_pattern,
))
.unwrap();
// Feed a wave-like pattern
let seq: Vec<Vec<f64>> = (0..10)
.map(|t| (0..4).map(|d| wave_pattern(t, d) + 0.01).collect())
.collect();
let result = classifier.classify(&seq, 1, 0).unwrap();
assert!(result.recognized);
assert_eq!(result.gesture_type, Some(GestureType::Wave));
}
#[test]
fn test_classify_no_match_high_distance() {
let mut classifier = GestureClassifier::new(GestureConfig {
max_distance: 0.001, // very strict
..small_config()
});
classifier
.add_template(make_template(
"wave",
GestureType::Wave,
10,
4,
wave_pattern,
))
.unwrap();
// Random-ish sequence
let seq: Vec<Vec<f64>> = (0..10)
.map(|t| vec![t as f64 * 10.0, 0.0, 0.0, 0.0])
.collect();
let result = classifier.classify(&seq, 1, 0).unwrap();
assert!(!result.recognized);
assert!(result.gesture_type.is_none());
}
#[test]
fn test_dtw_identical_sequences() {
let seq: Vec<Vec<f64>> = vec![vec![1.0, 2.0], vec![3.0, 4.0], vec![5.0, 6.0]];
let dist = dtw_distance(&seq, &seq, 3);
assert!(
dist < 1e-10,
"Identical sequences should have zero DTW distance"
);
}
#[test]
fn test_dtw_different_sequences() {
let a: Vec<Vec<f64>> = vec![vec![0.0], vec![0.0], vec![0.0]];
let b: Vec<Vec<f64>> = vec![vec![10.0], vec![10.0], vec![10.0]];
let dist = dtw_distance(&a, &b, 3);
assert!(
dist > 0.0,
"Different sequences should have non-zero DTW distance"
);
}
#[test]
fn test_dtw_time_warped() {
// Same shape but different speed
let a: Vec<Vec<f64>> = vec![vec![0.0], vec![1.0], vec![2.0], vec![3.0]];
let b: Vec<Vec<f64>> = vec![
vec![0.0],
vec![0.5],
vec![1.0],
vec![1.5],
vec![2.0],
vec![2.5],
vec![3.0],
];
let dist = dtw_distance(&a, &b, 4);
// DTW should be relatively small despite different lengths
assert!(dist < 2.0, "DTW should handle time warping, got {}", dist);
}
#[test]
fn test_euclidean_distance() {
let a = vec![0.0, 3.0];
let b = vec![4.0, 0.0];
let d = euclidean_distance(&a, &b);
assert!((d - 5.0).abs() < 1e-10);
}
#[test]
fn test_gesture_type_names() {
assert_eq!(GestureType::Wave.name(), "wave");
assert_eq!(GestureType::Push.name(), "push");
assert_eq!(GestureType::Circle.name(), "circle");
assert_eq!(GestureType::Custom.name(), "custom");
}
}

View File

@@ -0,0 +1,509 @@
//! Pre-movement intention lead signal detector.
//!
//! Detects anticipatory postural adjustments (APAs) 200-500ms before
//! visible movement onset. Works by analyzing the trajectory of AETHER
//! embeddings in embedding space: before a person initiates a step or
//! reach, their weight shifts create subtle CSI changes that appear as
//! velocity and acceleration in embedding space.
//!
//! # Algorithm
//! 1. Maintain a rolling window of recent embeddings (2 seconds at 20 Hz)
//! 2. Compute velocity (first derivative) and acceleration (second derivative)
//! in embedding space
//! 3. Detect when acceleration exceeds a threshold while velocity is still low
//! (the body is loading/shifting but hasn't moved yet)
//! 4. Output a lead signal with estimated time-to-movement
//!
//! # References
//! - ADR-030 Tier 3: Intention Lead Signals
//! - Massion (1992), "Movement, posture and equilibrium: Interaction
//! and coordination" Progress in Neurobiology
use std::collections::VecDeque;
// ---------------------------------------------------------------------------
// Error types
// ---------------------------------------------------------------------------
/// Errors from intention detection operations.
#[derive(Debug, thiserror::Error)]
pub enum IntentionError {
/// Not enough embedding history to compute derivatives.
#[error("Insufficient history: need >= {needed} frames, got {got}")]
InsufficientHistory { needed: usize, got: usize },
/// Embedding dimension mismatch.
#[error("Embedding dimension mismatch: expected {expected}, got {got}")]
DimensionMismatch { expected: usize, got: usize },
/// Invalid configuration.
#[error("Invalid configuration: {0}")]
InvalidConfig(String),
}
// ---------------------------------------------------------------------------
// Configuration
// ---------------------------------------------------------------------------
/// Configuration for the intention detector.
#[derive(Debug, Clone)]
pub struct IntentionConfig {
/// Embedding dimension (typically 128).
pub embedding_dim: usize,
/// Rolling window size in frames (2s at 20Hz = 40 frames).
pub window_size: usize,
/// Sampling rate in Hz.
pub sample_rate_hz: f64,
/// Acceleration threshold for pre-movement detection (embedding space units/s^2).
pub acceleration_threshold: f64,
/// Maximum velocity for a pre-movement signal (below this = still preparing).
pub max_pre_movement_velocity: f64,
/// Minimum frames of sustained acceleration to trigger a lead signal.
pub min_sustained_frames: usize,
/// Lead time window: max seconds before movement that we flag.
pub max_lead_time_s: f64,
}
impl Default for IntentionConfig {
fn default() -> Self {
Self {
embedding_dim: 128,
window_size: 40,
sample_rate_hz: 20.0,
acceleration_threshold: 0.5,
max_pre_movement_velocity: 2.0,
min_sustained_frames: 4,
max_lead_time_s: 0.5,
}
}
}
// ---------------------------------------------------------------------------
// Lead signal result
// ---------------------------------------------------------------------------
/// Pre-movement lead signal.
#[derive(Debug, Clone)]
pub struct LeadSignal {
/// Whether a pre-movement signal was detected.
pub detected: bool,
/// Confidence in the detection (0.0 to 1.0).
pub confidence: f64,
/// Estimated time until movement onset (seconds).
pub estimated_lead_time_s: f64,
/// Current velocity magnitude in embedding space.
pub velocity_magnitude: f64,
/// Current acceleration magnitude in embedding space.
pub acceleration_magnitude: f64,
/// Number of consecutive frames of sustained acceleration.
pub sustained_frames: usize,
/// Timestamp (microseconds) of this detection.
pub timestamp_us: u64,
/// Dominant direction of acceleration (unit vector in embedding space, first 3 dims).
pub direction_hint: [f64; 3],
}
/// Trajectory state for one frame.
#[derive(Debug, Clone)]
struct TrajectoryPoint {
embedding: Vec<f64>,
timestamp_us: u64,
}
// ---------------------------------------------------------------------------
// Intention detector
// ---------------------------------------------------------------------------
/// Pre-movement intention lead signal detector.
///
/// Maintains a rolling window of embeddings and computes velocity
/// and acceleration in embedding space to detect anticipatory
/// postural adjustments before movement onset.
#[derive(Debug)]
pub struct IntentionDetector {
config: IntentionConfig,
/// Rolling window of recent trajectory points.
history: VecDeque<TrajectoryPoint>,
/// Count of consecutive frames with pre-movement signature.
sustained_count: usize,
/// Total frames processed.
total_frames: u64,
}
impl IntentionDetector {
/// Create a new intention detector.
pub fn new(config: IntentionConfig) -> Result<Self, IntentionError> {
if config.embedding_dim == 0 {
return Err(IntentionError::InvalidConfig(
"embedding_dim must be > 0".into(),
));
}
if config.window_size < 3 {
return Err(IntentionError::InvalidConfig(
"window_size must be >= 3 for second derivative".into(),
));
}
Ok(Self {
history: VecDeque::with_capacity(config.window_size),
config,
sustained_count: 0,
total_frames: 0,
})
}
/// Feed a new embedding and check for pre-movement signals.
///
/// `embedding` is the AETHER embedding for the current frame.
/// Returns a lead signal result.
pub fn update(
&mut self,
embedding: &[f32],
timestamp_us: u64,
) -> Result<LeadSignal, IntentionError> {
if embedding.len() != self.config.embedding_dim {
return Err(IntentionError::DimensionMismatch {
expected: self.config.embedding_dim,
got: embedding.len(),
});
}
self.total_frames += 1;
// Convert to f64 for trajectory analysis
let emb_f64: Vec<f64> = embedding.iter().map(|&x| x as f64).collect();
// Add to history
if self.history.len() >= self.config.window_size {
self.history.pop_front();
}
self.history.push_back(TrajectoryPoint {
embedding: emb_f64,
timestamp_us,
});
// Need at least 3 points for second derivative
if self.history.len() < 3 {
return Ok(LeadSignal {
detected: false,
confidence: 0.0,
estimated_lead_time_s: 0.0,
velocity_magnitude: 0.0,
acceleration_magnitude: 0.0,
sustained_frames: 0,
timestamp_us,
direction_hint: [0.0; 3],
});
}
// Compute velocity and acceleration
let n = self.history.len();
let dt = 1.0 / self.config.sample_rate_hz;
// Velocity: (embedding[n-1] - embedding[n-2]) / dt
let velocity = embedding_diff(
&self.history[n - 1].embedding,
&self.history[n - 2].embedding,
dt,
);
let velocity_mag = l2_norm_f64(&velocity);
// Acceleration: (velocity[n-1] - velocity[n-2]) / dt
// Approximate: (emb[n-1] - 2*emb[n-2] + emb[n-3]) / dt^2
let acceleration = embedding_second_diff(
&self.history[n - 1].embedding,
&self.history[n - 2].embedding,
&self.history[n - 3].embedding,
dt,
);
let accel_mag = l2_norm_f64(&acceleration);
// Pre-movement detection:
// High acceleration + low velocity = body is loading/shifting but hasn't moved
let is_pre_movement = accel_mag > self.config.acceleration_threshold
&& velocity_mag < self.config.max_pre_movement_velocity;
if is_pre_movement {
self.sustained_count += 1;
} else {
self.sustained_count = 0;
}
let detected = self.sustained_count >= self.config.min_sustained_frames;
// Estimate lead time based on current acceleration and velocity
let estimated_lead = if detected && accel_mag > 1e-10 {
// Time until velocity reaches threshold: t = (v_thresh - v) / a
let remaining = (self.config.max_pre_movement_velocity - velocity_mag) / accel_mag;
remaining.clamp(0.0, self.config.max_lead_time_s)
} else {
0.0
};
// Confidence based on how clearly the acceleration exceeds threshold
let confidence = if detected {
let ratio = accel_mag / self.config.acceleration_threshold;
(ratio - 1.0).clamp(0.0, 1.0)
* (self.sustained_count as f64 / self.config.min_sustained_frames as f64).min(1.0)
} else {
0.0
};
// Direction hint from first 3 dimensions of acceleration
let direction_hint = [
acceleration.first().copied().unwrap_or(0.0),
acceleration.get(1).copied().unwrap_or(0.0),
acceleration.get(2).copied().unwrap_or(0.0),
];
Ok(LeadSignal {
detected,
confidence,
estimated_lead_time_s: estimated_lead,
velocity_magnitude: velocity_mag,
acceleration_magnitude: accel_mag,
sustained_frames: self.sustained_count,
timestamp_us,
direction_hint,
})
}
/// Reset the detector state.
pub fn reset(&mut self) {
self.history.clear();
self.sustained_count = 0;
}
/// Number of frames in the history.
pub fn history_len(&self) -> usize {
self.history.len()
}
/// Total frames processed.
pub fn total_frames(&self) -> u64 {
self.total_frames
}
}
// ---------------------------------------------------------------------------
// Utility functions
// ---------------------------------------------------------------------------
/// First difference of two embedding vectors, divided by dt.
fn embedding_diff(a: &[f64], b: &[f64], dt: f64) -> Vec<f64> {
a.iter()
.zip(b.iter())
.map(|(&ai, &bi)| (ai - bi) / dt)
.collect()
}
/// Second difference: (a - 2b + c) / dt^2.
fn embedding_second_diff(a: &[f64], b: &[f64], c: &[f64], dt: f64) -> Vec<f64> {
let dt2 = dt * dt;
a.iter()
.zip(b.iter())
.zip(c.iter())
.map(|((&ai, &bi), &ci)| (ai - 2.0 * bi + ci) / dt2)
.collect()
}
/// L2 norm of an f64 slice.
fn l2_norm_f64(v: &[f64]) -> f64 {
v.iter().map(|x| x * x).sum::<f64>().sqrt()
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn make_config() -> IntentionConfig {
IntentionConfig {
embedding_dim: 4,
window_size: 10,
sample_rate_hz: 20.0,
acceleration_threshold: 0.5,
max_pre_movement_velocity: 2.0,
min_sustained_frames: 3,
max_lead_time_s: 0.5,
}
}
fn static_embedding() -> Vec<f32> {
vec![1.0, 0.0, 0.0, 0.0]
}
#[test]
fn test_creation() {
let config = make_config();
let detector = IntentionDetector::new(config).unwrap();
assert_eq!(detector.history_len(), 0);
assert_eq!(detector.total_frames(), 0);
}
#[test]
fn test_invalid_config_zero_dim() {
let config = IntentionConfig {
embedding_dim: 0,
..make_config()
};
assert!(matches!(
IntentionDetector::new(config),
Err(IntentionError::InvalidConfig(_))
));
}
#[test]
fn test_invalid_config_small_window() {
let config = IntentionConfig {
window_size: 2,
..make_config()
};
assert!(matches!(
IntentionDetector::new(config),
Err(IntentionError::InvalidConfig(_))
));
}
#[test]
fn test_dimension_mismatch() {
let config = make_config();
let mut detector = IntentionDetector::new(config).unwrap();
let result = detector.update(&[1.0, 0.0], 0);
assert!(matches!(
result,
Err(IntentionError::DimensionMismatch { .. })
));
}
#[test]
fn test_static_scene_no_detection() {
let config = make_config();
let mut detector = IntentionDetector::new(config).unwrap();
for frame in 0..20 {
let signal = detector
.update(&static_embedding(), frame * 50_000)
.unwrap();
assert!(
!signal.detected,
"Static scene should not trigger detection"
);
}
}
#[test]
fn test_gradual_acceleration_detected() {
let mut config = make_config();
config.acceleration_threshold = 100.0; // low threshold for test
config.max_pre_movement_velocity = 100000.0;
config.min_sustained_frames = 2;
let mut detector = IntentionDetector::new(config).unwrap();
// Feed gradually accelerating embeddings
// Position = 0.5 * a * t^2, so embedding shifts quadratically
let mut any_detected = false;
for frame in 0..30_u64 {
let t = frame as f32 * 0.05;
let pos = 50.0 * t * t; // acceleration = 100 units/s^2
let emb = vec![1.0 + pos, 0.0, 0.0, 0.0];
let signal = detector.update(&emb, frame * 50_000).unwrap();
if signal.detected {
any_detected = true;
assert!(signal.confidence > 0.0);
assert!(signal.acceleration_magnitude > 0.0);
}
}
assert!(any_detected, "Accelerating signal should trigger detection");
}
#[test]
fn test_constant_velocity_no_detection() {
let config = make_config();
let mut detector = IntentionDetector::new(config).unwrap();
// Constant velocity = zero acceleration → no pre-movement
for frame in 0..20_u64 {
let pos = frame as f32 * 0.01; // constant velocity
let emb = vec![1.0 + pos, 0.0, 0.0, 0.0];
let signal = detector.update(&emb, frame * 50_000).unwrap();
assert!(
!signal.detected,
"Constant velocity should not trigger pre-movement"
);
}
}
#[test]
fn test_reset() {
let config = make_config();
let mut detector = IntentionDetector::new(config).unwrap();
for frame in 0..5_u64 {
detector
.update(&static_embedding(), frame * 50_000)
.unwrap();
}
assert_eq!(detector.history_len(), 5);
detector.reset();
assert_eq!(detector.history_len(), 0);
}
#[test]
fn test_lead_signal_fields() {
let config = make_config();
let mut detector = IntentionDetector::new(config).unwrap();
// Need at least 3 frames for derivatives
for frame in 0..3_u64 {
let signal = detector
.update(&static_embedding(), frame * 50_000)
.unwrap();
assert_eq!(signal.sustained_frames, 0);
}
let signal = detector.update(&static_embedding(), 150_000).unwrap();
assert!(signal.velocity_magnitude >= 0.0);
assert!(signal.acceleration_magnitude >= 0.0);
assert_eq!(signal.direction_hint.len(), 3);
}
#[test]
fn test_window_size_limit() {
let config = IntentionConfig {
window_size: 5,
..make_config()
};
let mut detector = IntentionDetector::new(config).unwrap();
for frame in 0..10_u64 {
detector
.update(&static_embedding(), frame * 50_000)
.unwrap();
}
assert_eq!(detector.history_len(), 5);
}
#[test]
fn test_embedding_diff() {
let a = vec![2.0, 4.0];
let b = vec![1.0, 2.0];
let diff = embedding_diff(&a, &b, 0.5);
assert!((diff[0] - 2.0).abs() < 1e-10); // (2-1)/0.5
assert!((diff[1] - 4.0).abs() < 1e-10); // (4-2)/0.5
}
#[test]
fn test_embedding_second_diff() {
// Quadratic sequence: 1, 4, 9 → second diff = 2
let a = vec![9.0];
let b = vec![4.0];
let c = vec![1.0];
let sd = embedding_second_diff(&a, &b, &c, 1.0);
assert!((sd[0] - 2.0).abs() < 1e-10);
}
}

View File

@@ -0,0 +1,676 @@
//! Longitudinal biomechanics drift detection.
//!
//! Maintains per-person biophysical baselines over days/weeks using Welford
//! online statistics. Detects meaningful drift in gait symmetry, stability,
//! breathing regularity, micro-tremor, and activity level. Produces traceable
//! evidence reports that link to stored embedding trajectories.
//!
//! # Key Invariants
//! - Baseline requires >= 7 observation days before drift detection activates
//! - Drift alert requires > 2-sigma deviation sustained for >= 3 consecutive days
//! - Output is metric values and deviations, never diagnostic language
//! - Welford statistics use full history (no windowing) for stability
//!
//! # References
//! - Welford, B.P. (1962). "Note on a Method for Calculating Corrected
//! Sums of Squares." Technometrics.
//! - ADR-030 Tier 4: Longitudinal Biomechanics Drift
use crate::ruvsense::field_model::WelfordStats;
// ---------------------------------------------------------------------------
// Error types
// ---------------------------------------------------------------------------
/// Errors from longitudinal monitoring operations.
#[derive(Debug, thiserror::Error)]
pub enum LongitudinalError {
/// Not enough observation days for drift detection.
#[error("Insufficient observation days: need >= {needed}, got {got}")]
InsufficientDays { needed: u32, got: u32 },
/// Person ID not found in the registry.
#[error("Unknown person ID: {0}")]
UnknownPerson(u64),
/// Embedding dimension mismatch.
#[error("Embedding dimension mismatch: expected {expected}, got {got}")]
EmbeddingDimensionMismatch { expected: usize, got: usize },
/// Invalid metric value.
#[error("Invalid metric value for {metric}: {reason}")]
InvalidMetric { metric: String, reason: String },
}
// ---------------------------------------------------------------------------
// Domain types
// ---------------------------------------------------------------------------
/// Biophysical metric types tracked per person.
#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
pub enum DriftMetric {
/// Gait symmetry ratio (0.0 = perfectly symmetric, higher = asymmetric).
GaitSymmetry,
/// Stability index (lower = less stable).
StabilityIndex,
/// Breathing regularity (coefficient of variation of breath intervals).
BreathingRegularity,
/// Micro-tremor amplitude (mm, from high-frequency pose jitter).
MicroTremor,
/// Daily activity level (normalized 0-1).
ActivityLevel,
}
impl DriftMetric {
/// All metric variants.
pub fn all() -> &'static [DriftMetric] {
&[
DriftMetric::GaitSymmetry,
DriftMetric::StabilityIndex,
DriftMetric::BreathingRegularity,
DriftMetric::MicroTremor,
DriftMetric::ActivityLevel,
]
}
/// Human-readable name.
pub fn name(&self) -> &'static str {
match self {
DriftMetric::GaitSymmetry => "gait_symmetry",
DriftMetric::StabilityIndex => "stability_index",
DriftMetric::BreathingRegularity => "breathing_regularity",
DriftMetric::MicroTremor => "micro_tremor",
DriftMetric::ActivityLevel => "activity_level",
}
}
}
/// Direction of drift.
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum DriftDirection {
/// Metric is increasing relative to baseline.
Increasing,
/// Metric is decreasing relative to baseline.
Decreasing,
}
/// Monitoring level for drift reports.
#[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord)]
pub enum MonitoringLevel {
/// Level 1: Raw biophysical metric value.
Physiological = 1,
/// Level 2: Personal baseline deviation.
Drift = 2,
/// Level 3: Pattern-matched risk correlation.
RiskCorrelation = 3,
}
/// A drift report with traceable evidence.
#[derive(Debug, Clone)]
pub struct DriftReport {
/// Person this report pertains to.
pub person_id: u64,
/// Which metric drifted.
pub metric: DriftMetric,
/// Direction of drift.
pub direction: DriftDirection,
/// Z-score relative to personal baseline.
pub z_score: f64,
/// Current metric value (today or most recent).
pub current_value: f64,
/// Baseline mean for this metric.
pub baseline_mean: f64,
/// Baseline standard deviation.
pub baseline_std: f64,
/// Number of consecutive days the drift has been sustained.
pub sustained_days: u32,
/// Monitoring level.
pub level: MonitoringLevel,
/// Timestamp (microseconds) when this report was generated.
pub timestamp_us: u64,
}
/// Daily metric summary for one person.
#[derive(Debug, Clone)]
pub struct DailyMetricSummary {
/// Person ID.
pub person_id: u64,
/// Day timestamp (start of day, microseconds).
pub day_us: u64,
/// Metric values for this day.
pub metrics: Vec<(DriftMetric, f64)>,
/// AETHER embedding centroid for this day.
pub embedding_centroid: Option<Vec<f32>>,
}
// ---------------------------------------------------------------------------
// Personal baseline
// ---------------------------------------------------------------------------
/// Per-person longitudinal baseline with Welford statistics.
///
/// Tracks running mean and variance for each biophysical metric over
/// the person's entire observation history. Uses Welford's algorithm
/// for numerical stability.
#[derive(Debug, Clone)]
pub struct PersonalBaseline {
/// Unique person identifier.
pub person_id: u64,
/// Per-metric Welford accumulators.
pub gait_symmetry: WelfordStats,
pub stability_index: WelfordStats,
pub breathing_regularity: WelfordStats,
pub micro_tremor: WelfordStats,
pub activity_level: WelfordStats,
/// Running centroid of AETHER embeddings.
pub embedding_centroid: Vec<f32>,
/// Number of observation days.
pub observation_days: u32,
/// Timestamp of last update (microseconds).
pub updated_at_us: u64,
/// Per-metric consecutive drift days counter.
drift_counters: [u32; 5],
}
impl PersonalBaseline {
/// Create a new baseline for a person.
///
/// `embedding_dim` is typically 128 for AETHER embeddings.
pub fn new(person_id: u64, embedding_dim: usize) -> Self {
Self {
person_id,
gait_symmetry: WelfordStats::new(),
stability_index: WelfordStats::new(),
breathing_regularity: WelfordStats::new(),
micro_tremor: WelfordStats::new(),
activity_level: WelfordStats::new(),
embedding_centroid: vec![0.0; embedding_dim],
observation_days: 0,
updated_at_us: 0,
drift_counters: [0; 5],
}
}
/// Get the Welford stats for a specific metric.
pub fn stats_for(&self, metric: DriftMetric) -> &WelfordStats {
match metric {
DriftMetric::GaitSymmetry => &self.gait_symmetry,
DriftMetric::StabilityIndex => &self.stability_index,
DriftMetric::BreathingRegularity => &self.breathing_regularity,
DriftMetric::MicroTremor => &self.micro_tremor,
DriftMetric::ActivityLevel => &self.activity_level,
}
}
/// Get mutable Welford stats for a specific metric.
fn stats_for_mut(&mut self, metric: DriftMetric) -> &mut WelfordStats {
match metric {
DriftMetric::GaitSymmetry => &mut self.gait_symmetry,
DriftMetric::StabilityIndex => &mut self.stability_index,
DriftMetric::BreathingRegularity => &mut self.breathing_regularity,
DriftMetric::MicroTremor => &mut self.micro_tremor,
DriftMetric::ActivityLevel => &mut self.activity_level,
}
}
/// Index of a metric in the drift_counters array.
fn metric_index(metric: DriftMetric) -> usize {
match metric {
DriftMetric::GaitSymmetry => 0,
DriftMetric::StabilityIndex => 1,
DriftMetric::BreathingRegularity => 2,
DriftMetric::MicroTremor => 3,
DriftMetric::ActivityLevel => 4,
}
}
/// Whether baseline has enough data for drift detection.
pub fn is_ready(&self) -> bool {
self.observation_days >= 7
}
/// Update baseline with a daily summary.
///
/// Returns drift reports for any metrics that exceed thresholds.
pub fn update_daily(
&mut self,
summary: &DailyMetricSummary,
timestamp_us: u64,
) -> Vec<DriftReport> {
self.observation_days += 1;
self.updated_at_us = timestamp_us;
// Update embedding centroid with EMA (decay = 0.95)
if let Some(ref emb) = summary.embedding_centroid {
if emb.len() == self.embedding_centroid.len() {
let alpha = 0.05_f32; // 1 - 0.95
for (c, e) in self.embedding_centroid.iter_mut().zip(emb.iter()) {
*c = (1.0 - alpha) * *c + alpha * *e;
}
}
}
let mut reports = Vec::new();
for &(metric, value) in &summary.metrics {
let stats = self.stats_for_mut(metric);
stats.update(value);
if !self.is_ready_at(self.observation_days) {
continue;
}
let z = stats.z_score(value);
let idx = Self::metric_index(metric);
if z.abs() > 2.0 {
self.drift_counters[idx] += 1;
} else {
self.drift_counters[idx] = 0;
}
if self.drift_counters[idx] >= 3 {
let direction = if z > 0.0 {
DriftDirection::Increasing
} else {
DriftDirection::Decreasing
};
let level = if self.drift_counters[idx] >= 7 {
MonitoringLevel::RiskCorrelation
} else {
MonitoringLevel::Drift
};
reports.push(DriftReport {
person_id: self.person_id,
metric,
direction,
z_score: z,
current_value: value,
baseline_mean: stats.mean,
baseline_std: stats.std_dev(),
sustained_days: self.drift_counters[idx],
level,
timestamp_us,
});
}
}
reports
}
/// Check readiness at a specific observation day count (internal helper).
fn is_ready_at(&self, days: u32) -> bool {
days >= 7
}
/// Get current drift counter for a metric.
pub fn drift_days(&self, metric: DriftMetric) -> u32 {
self.drift_counters[Self::metric_index(metric)]
}
}
// ---------------------------------------------------------------------------
// Embedding history (simplified HNSW-indexed store)
// ---------------------------------------------------------------------------
/// Entry in the embedding history.
#[derive(Debug, Clone)]
pub struct EmbeddingEntry {
/// Person ID.
pub person_id: u64,
/// Day timestamp (microseconds).
pub day_us: u64,
/// AETHER embedding vector.
pub embedding: Vec<f32>,
}
/// Simplified embedding history store for longitudinal tracking.
///
/// In production, this would be backed by an HNSW index for fast
/// nearest-neighbor search. This implementation uses brute-force
/// cosine similarity for correctness.
#[derive(Debug)]
pub struct EmbeddingHistory {
entries: Vec<EmbeddingEntry>,
max_entries: usize,
embedding_dim: usize,
}
impl EmbeddingHistory {
/// Create a new embedding history store.
pub fn new(embedding_dim: usize, max_entries: usize) -> Self {
Self {
entries: Vec::new(),
max_entries,
embedding_dim,
}
}
/// Add an embedding entry.
pub fn push(&mut self, entry: EmbeddingEntry) -> Result<(), LongitudinalError> {
if entry.embedding.len() != self.embedding_dim {
return Err(LongitudinalError::EmbeddingDimensionMismatch {
expected: self.embedding_dim,
got: entry.embedding.len(),
});
}
if self.entries.len() >= self.max_entries {
self.entries.drain(..1); // FIFO eviction — acceptable for daily-rate inserts
}
self.entries.push(entry);
Ok(())
}
/// Find the K nearest embeddings to a query vector (brute-force cosine).
pub fn search(&self, query: &[f32], k: usize) -> Vec<(usize, f32)> {
let mut similarities: Vec<(usize, f32)> = self
.entries
.iter()
.enumerate()
.map(|(i, e)| (i, cosine_similarity(query, &e.embedding)))
.collect();
similarities.sort_by(|a, b| b.1.partial_cmp(&a.1).unwrap_or(std::cmp::Ordering::Equal));
similarities.truncate(k);
similarities
}
/// Number of entries stored.
pub fn len(&self) -> usize {
self.entries.len()
}
/// Whether the store is empty.
pub fn is_empty(&self) -> bool {
self.entries.is_empty()
}
/// Get entry by index.
pub fn get(&self, index: usize) -> Option<&EmbeddingEntry> {
self.entries.get(index)
}
/// Get all entries for a specific person.
pub fn entries_for_person(&self, person_id: u64) -> Vec<&EmbeddingEntry> {
self.entries
.iter()
.filter(|e| e.person_id == person_id)
.collect()
}
}
/// Cosine similarity between two f32 vectors.
fn cosine_similarity(a: &[f32], b: &[f32]) -> f32 {
let dot: f32 = a.iter().zip(b.iter()).map(|(x, y)| x * y).sum();
let norm_a: f32 = a.iter().map(|x| x * x).sum::<f32>().sqrt();
let norm_b: f32 = b.iter().map(|x| x * x).sum::<f32>().sqrt();
let denom = norm_a * norm_b;
if denom < 1e-9 {
0.0
} else {
dot / denom
}
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn make_daily_summary(person_id: u64, day: u64, values: [f64; 5]) -> DailyMetricSummary {
DailyMetricSummary {
person_id,
day_us: day * 86_400_000_000,
metrics: vec![
(DriftMetric::GaitSymmetry, values[0]),
(DriftMetric::StabilityIndex, values[1]),
(DriftMetric::BreathingRegularity, values[2]),
(DriftMetric::MicroTremor, values[3]),
(DriftMetric::ActivityLevel, values[4]),
],
embedding_centroid: None,
}
}
#[test]
fn test_personal_baseline_creation() {
let baseline = PersonalBaseline::new(42, 128);
assert_eq!(baseline.person_id, 42);
assert_eq!(baseline.observation_days, 0);
assert!(!baseline.is_ready());
assert_eq!(baseline.embedding_centroid.len(), 128);
}
#[test]
fn test_baseline_not_ready_before_7_days() {
let mut baseline = PersonalBaseline::new(1, 128);
for day in 0..6 {
let summary = make_daily_summary(1, day, [0.1, 0.9, 0.15, 0.5, 0.7]);
let reports = baseline.update_daily(&summary, day * 86_400_000_000);
assert!(reports.is_empty(), "No drift before 7 days");
}
assert!(!baseline.is_ready());
}
#[test]
fn test_baseline_ready_after_7_days() {
let mut baseline = PersonalBaseline::new(1, 128);
for day in 0..7 {
let summary = make_daily_summary(1, day, [0.1, 0.9, 0.15, 0.5, 0.7]);
baseline.update_daily(&summary, day * 86_400_000_000);
}
assert!(baseline.is_ready());
assert_eq!(baseline.observation_days, 7);
}
#[test]
fn test_stable_metrics_no_drift() {
let mut baseline = PersonalBaseline::new(1, 128);
// 20 days of stable metrics
for day in 0..20 {
let summary = make_daily_summary(1, day, [0.1, 0.9, 0.15, 0.5, 0.7]);
let reports = baseline.update_daily(&summary, day * 86_400_000_000);
assert!(
reports.is_empty(),
"Stable metrics should not trigger drift"
);
}
}
#[test]
fn test_drift_detected_after_sustained_deviation() {
let mut baseline = PersonalBaseline::new(1, 128);
// 10 days of stable gait symmetry = 0.1
for day in 0..10 {
let summary = make_daily_summary(1, day, [0.1, 0.9, 0.15, 0.5, 0.7]);
baseline.update_daily(&summary, day * 86_400_000_000);
}
// Now inject large drift in gait symmetry for 3+ days
let mut any_drift = false;
for day in 10..16 {
let summary = make_daily_summary(1, day, [0.9, 0.9, 0.15, 0.5, 0.7]);
let reports = baseline.update_daily(&summary, day * 86_400_000_000);
if !reports.is_empty() {
any_drift = true;
let r = &reports[0];
assert_eq!(r.metric, DriftMetric::GaitSymmetry);
assert_eq!(r.direction, DriftDirection::Increasing);
assert!(r.z_score > 2.0);
assert!(r.sustained_days >= 3);
}
}
assert!(any_drift, "Should detect drift after sustained deviation");
}
#[test]
fn test_drift_resolves_when_metric_returns() {
let mut baseline = PersonalBaseline::new(1, 128);
// Stable baseline
for day in 0..10 {
let summary = make_daily_summary(1, day, [0.1, 0.9, 0.15, 0.5, 0.7]);
baseline.update_daily(&summary, day * 86_400_000_000);
}
// Drift for 3 days
for day in 10..13 {
let summary = make_daily_summary(1, day, [0.9, 0.9, 0.15, 0.5, 0.7]);
baseline.update_daily(&summary, day * 86_400_000_000);
}
// Return to normal
for day in 13..16 {
let summary = make_daily_summary(1, day, [0.1, 0.9, 0.15, 0.5, 0.7]);
let reports = baseline.update_daily(&summary, day * 86_400_000_000);
// After returning to normal, drift counter resets
if day == 15 {
assert!(reports.is_empty(), "Drift should resolve");
assert_eq!(baseline.drift_days(DriftMetric::GaitSymmetry), 0);
}
}
}
#[test]
fn test_monitoring_level_escalation() {
let mut baseline = PersonalBaseline::new(1, 128);
for day in 0..10 {
let summary = make_daily_summary(1, day, [0.1, 0.9, 0.15, 0.5, 0.7]);
baseline.update_daily(&summary, day * 86_400_000_000);
}
// Sustained drift for 7+ days should escalate to RiskCorrelation
let mut max_level = MonitoringLevel::Physiological;
for day in 10..20 {
let summary = make_daily_summary(1, day, [0.9, 0.9, 0.15, 0.5, 0.7]);
let reports = baseline.update_daily(&summary, day * 86_400_000_000);
for r in &reports {
if r.level > max_level {
max_level = r.level;
}
}
}
assert_eq!(
max_level,
MonitoringLevel::RiskCorrelation,
"7+ days sustained drift should reach RiskCorrelation level"
);
}
#[test]
fn test_embedding_history_push_and_search() {
let mut history = EmbeddingHistory::new(4, 100);
history
.push(EmbeddingEntry {
person_id: 1,
day_us: 0,
embedding: vec![1.0, 0.0, 0.0, 0.0],
})
.unwrap();
history
.push(EmbeddingEntry {
person_id: 1,
day_us: 1,
embedding: vec![0.9, 0.1, 0.0, 0.0],
})
.unwrap();
history
.push(EmbeddingEntry {
person_id: 2,
day_us: 0,
embedding: vec![0.0, 0.0, 1.0, 0.0],
})
.unwrap();
let results = history.search(&[1.0, 0.0, 0.0, 0.0], 2);
assert_eq!(results.len(), 2);
// First result should be exact match
assert!((results[0].1 - 1.0).abs() < 1e-5);
}
#[test]
fn test_embedding_history_dimension_mismatch() {
let mut history = EmbeddingHistory::new(4, 100);
let result = history.push(EmbeddingEntry {
person_id: 1,
day_us: 0,
embedding: vec![1.0, 0.0], // wrong dim
});
assert!(matches!(
result,
Err(LongitudinalError::EmbeddingDimensionMismatch { .. })
));
}
#[test]
fn test_embedding_history_fifo_eviction() {
let mut history = EmbeddingHistory::new(2, 3);
for i in 0..5 {
history
.push(EmbeddingEntry {
person_id: 1,
day_us: i,
embedding: vec![i as f32, 0.0],
})
.unwrap();
}
assert_eq!(history.len(), 3);
// First entry should be day 2 (0 and 1 evicted)
assert_eq!(history.get(0).unwrap().day_us, 2);
}
#[test]
fn test_entries_for_person() {
let mut history = EmbeddingHistory::new(2, 100);
history
.push(EmbeddingEntry {
person_id: 1,
day_us: 0,
embedding: vec![1.0, 0.0],
})
.unwrap();
history
.push(EmbeddingEntry {
person_id: 2,
day_us: 0,
embedding: vec![0.0, 1.0],
})
.unwrap();
history
.push(EmbeddingEntry {
person_id: 1,
day_us: 1,
embedding: vec![0.9, 0.1],
})
.unwrap();
let entries = history.entries_for_person(1);
assert_eq!(entries.len(), 2);
}
#[test]
fn test_drift_metric_names() {
assert_eq!(DriftMetric::GaitSymmetry.name(), "gait_symmetry");
assert_eq!(DriftMetric::ActivityLevel.name(), "activity_level");
assert_eq!(DriftMetric::all().len(), 5);
}
#[test]
fn test_cosine_similarity_unit_vectors() {
let a = vec![1.0_f32, 0.0, 0.0];
let b = vec![0.0_f32, 1.0, 0.0];
assert!(cosine_similarity(&a, &b).abs() < 1e-6, "Orthogonal = 0");
let c = vec![1.0_f32, 0.0, 0.0];
assert!((cosine_similarity(&a, &c) - 1.0).abs() < 1e-6, "Same = 1");
}
}

View File

@@ -0,0 +1,320 @@
//! RuvSense -- Sensing-First RF Mode for Multistatic WiFi DensePose (ADR-029)
//!
//! This bounded context implements the multistatic sensing pipeline that fuses
//! CSI from multiple ESP32 nodes across multiple WiFi channels into a single
//! coherent sensing frame per 50 ms TDMA cycle (20 Hz output).
//!
//! # Architecture
//!
//! The pipeline flows through six stages:
//!
//! 1. **Multi-Band Fusion** (`multiband`) -- Aggregate per-channel CSI frames
//! from channel-hopping into a wideband virtual snapshot per node.
//! 2. **Phase Alignment** (`phase_align`) -- Correct LO-induced phase rotation
//! between channels using `ruvector-solver::NeumannSolver`.
//! 3. **Multistatic Fusion** (`multistatic`) -- Fuse N node observations into
//! a single `FusedSensingFrame` with attention-based cross-node weighting
//! via `ruvector-attn-mincut`.
//! 4. **Coherence Scoring** (`coherence`) -- Compute per-subcarrier z-score
//! coherence against a rolling reference template.
//! 5. **Coherence Gating** (`coherence_gate`) -- Apply threshold-based gate
//! decision: Accept / PredictOnly / Reject / Recalibrate.
//! 6. **Pose Tracking** (`pose_tracker`) -- 17-keypoint Kalman tracker with
//! lifecycle state machine and AETHER re-ID embedding support.
//!
//! # RuVector Crate Usage
//!
//! - `ruvector-solver` -- Phase alignment, coherence decomposition
//! - `ruvector-attn-mincut` -- Cross-node spectrogram fusion
//! - `ruvector-mincut` -- Person separation and track assignment
//! - `ruvector-attention` -- Cross-channel feature weighting
//!
//! # References
//!
//! - ADR-029: Project RuvSense
//! - IEEE 802.11bf-2024 WLAN Sensing
// ADR-030: Exotic sensing tiers
pub mod adversarial;
pub mod cross_room;
pub mod field_model;
pub mod gesture;
pub mod intention;
pub mod longitudinal;
pub mod tomography;
// ADR-029: Core multistatic pipeline
pub mod coherence;
pub mod coherence_gate;
pub mod multiband;
pub mod multistatic;
pub mod phase_align;
pub mod pose_tracker;
// Re-export core types for ergonomic access
pub use coherence::CoherenceState;
pub use coherence_gate::{GateDecision, GatePolicy};
pub use multiband::MultiBandCsiFrame;
pub use multistatic::FusedSensingFrame;
pub use phase_align::{PhaseAligner, PhaseAlignError};
pub use pose_tracker::{KeypointState, PoseTrack, TrackLifecycleState};
/// Number of keypoints in a full-body pose skeleton (COCO-17).
pub const NUM_KEYPOINTS: usize = 17;
/// Keypoint indices following the COCO-17 convention.
pub mod keypoint {
pub const NOSE: usize = 0;
pub const LEFT_EYE: usize = 1;
pub const RIGHT_EYE: usize = 2;
pub const LEFT_EAR: usize = 3;
pub const RIGHT_EAR: usize = 4;
pub const LEFT_SHOULDER: usize = 5;
pub const RIGHT_SHOULDER: usize = 6;
pub const LEFT_ELBOW: usize = 7;
pub const RIGHT_ELBOW: usize = 8;
pub const LEFT_WRIST: usize = 9;
pub const RIGHT_WRIST: usize = 10;
pub const LEFT_HIP: usize = 11;
pub const RIGHT_HIP: usize = 12;
pub const LEFT_KNEE: usize = 13;
pub const RIGHT_KNEE: usize = 14;
pub const LEFT_ANKLE: usize = 15;
pub const RIGHT_ANKLE: usize = 16;
/// Torso keypoint indices (shoulders, hips, spine midpoint proxy).
pub const TORSO_INDICES: &[usize] = &[
LEFT_SHOULDER,
RIGHT_SHOULDER,
LEFT_HIP,
RIGHT_HIP,
];
}
/// Unique identifier for a pose track.
#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
pub struct TrackId(pub u64);
impl TrackId {
/// Create a new track identifier.
pub fn new(id: u64) -> Self {
Self(id)
}
}
impl std::fmt::Display for TrackId {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
write!(f, "Track({})", self.0)
}
}
/// Error type shared across the RuvSense pipeline.
#[derive(Debug, thiserror::Error)]
pub enum RuvSenseError {
/// Phase alignment failed.
#[error("Phase alignment error: {0}")]
PhaseAlign(#[from] phase_align::PhaseAlignError),
/// Multi-band fusion error.
#[error("Multi-band fusion error: {0}")]
MultiBand(#[from] multiband::MultiBandError),
/// Multistatic fusion error.
#[error("Multistatic fusion error: {0}")]
Multistatic(#[from] multistatic::MultistaticError),
/// Coherence computation error.
#[error("Coherence error: {0}")]
Coherence(#[from] coherence::CoherenceError),
/// Pose tracker error.
#[error("Pose tracker error: {0}")]
PoseTracker(#[from] pose_tracker::PoseTrackerError),
}
/// Common result type for RuvSense operations.
pub type Result<T> = std::result::Result<T, RuvSenseError>;
/// Configuration for the RuvSense pipeline.
#[derive(Debug, Clone)]
pub struct RuvSenseConfig {
/// Maximum number of nodes in the multistatic mesh.
pub max_nodes: usize,
/// Target output rate in Hz.
pub target_hz: f64,
/// Number of channels in the hop sequence.
pub num_channels: usize,
/// Coherence accept threshold (default 0.85).
pub coherence_accept: f32,
/// Coherence drift threshold (default 0.5).
pub coherence_drift: f32,
/// Maximum stale frames before recalibration (default 200 = 10s at 20Hz).
pub max_stale_frames: u64,
/// Embedding dimension for AETHER re-ID (default 128).
pub embedding_dim: usize,
}
impl Default for RuvSenseConfig {
fn default() -> Self {
Self {
max_nodes: 4,
target_hz: 20.0,
num_channels: 3,
coherence_accept: 0.85,
coherence_drift: 0.5,
max_stale_frames: 200,
embedding_dim: 128,
}
}
}
/// Top-level pipeline orchestrator for RuvSense multistatic sensing.
///
/// Coordinates the flow from raw per-node CSI frames through multi-band
/// fusion, phase alignment, multistatic fusion, coherence gating, and
/// finally into the pose tracker.
pub struct RuvSensePipeline {
config: RuvSenseConfig,
phase_aligner: PhaseAligner,
coherence_state: CoherenceState,
gate_policy: GatePolicy,
frame_counter: u64,
}
impl RuvSensePipeline {
/// Create a new pipeline with default configuration.
pub fn new() -> Self {
Self::with_config(RuvSenseConfig::default())
}
/// Create a new pipeline with the given configuration.
pub fn with_config(config: RuvSenseConfig) -> Self {
let n_sub = 56; // canonical subcarrier count
Self {
phase_aligner: PhaseAligner::new(config.num_channels),
coherence_state: CoherenceState::new(n_sub, config.coherence_accept),
gate_policy: GatePolicy::new(
config.coherence_accept,
config.coherence_drift,
config.max_stale_frames,
),
config,
frame_counter: 0,
}
}
/// Return a reference to the current pipeline configuration.
pub fn config(&self) -> &RuvSenseConfig {
&self.config
}
/// Return the total number of frames processed.
pub fn frame_count(&self) -> u64 {
self.frame_counter
}
/// Return a reference to the current coherence state.
pub fn coherence_state(&self) -> &CoherenceState {
&self.coherence_state
}
/// Advance the frame counter (called once per sensing cycle).
pub fn tick(&mut self) {
self.frame_counter += 1;
}
}
impl Default for RuvSensePipeline {
fn default() -> Self {
Self::new()
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn default_config_values() {
let cfg = RuvSenseConfig::default();
assert_eq!(cfg.max_nodes, 4);
assert!((cfg.target_hz - 20.0).abs() < f64::EPSILON);
assert_eq!(cfg.num_channels, 3);
assert!((cfg.coherence_accept - 0.85).abs() < f32::EPSILON);
assert!((cfg.coherence_drift - 0.5).abs() < f32::EPSILON);
assert_eq!(cfg.max_stale_frames, 200);
assert_eq!(cfg.embedding_dim, 128);
}
#[test]
fn pipeline_creation_defaults() {
let pipe = RuvSensePipeline::new();
assert_eq!(pipe.frame_count(), 0);
assert_eq!(pipe.config().max_nodes, 4);
}
#[test]
fn pipeline_tick_increments() {
let mut pipe = RuvSensePipeline::new();
pipe.tick();
pipe.tick();
pipe.tick();
assert_eq!(pipe.frame_count(), 3);
}
#[test]
fn track_id_display() {
let tid = TrackId::new(42);
assert_eq!(format!("{}", tid), "Track(42)");
assert_eq!(tid.0, 42);
}
#[test]
fn track_id_equality() {
assert_eq!(TrackId(1), TrackId(1));
assert_ne!(TrackId(1), TrackId(2));
}
#[test]
fn keypoint_constants() {
assert_eq!(keypoint::NOSE, 0);
assert_eq!(keypoint::LEFT_ANKLE, 15);
assert_eq!(keypoint::RIGHT_ANKLE, 16);
assert_eq!(keypoint::TORSO_INDICES.len(), 4);
}
#[test]
fn num_keypoints_is_17() {
assert_eq!(NUM_KEYPOINTS, 17);
}
#[test]
fn custom_config_pipeline() {
let cfg = RuvSenseConfig {
max_nodes: 6,
target_hz: 10.0,
num_channels: 6,
coherence_accept: 0.9,
coherence_drift: 0.4,
max_stale_frames: 100,
embedding_dim: 64,
};
let pipe = RuvSensePipeline::with_config(cfg);
assert_eq!(pipe.config().max_nodes, 6);
assert!((pipe.config().target_hz - 10.0).abs() < f64::EPSILON);
}
#[test]
fn error_display() {
let err = RuvSenseError::Coherence(coherence::CoherenceError::EmptyInput);
let msg = format!("{}", err);
assert!(msg.contains("Coherence"));
}
#[test]
fn pipeline_coherence_state_accessible() {
let pipe = RuvSensePipeline::new();
let cs = pipe.coherence_state();
assert!(cs.score() >= 0.0);
}
}

View File

@@ -0,0 +1,441 @@
//! Multi-Band CSI Frame Fusion (ADR-029 Section 2.3)
//!
//! Aggregates per-channel CSI frames from channel-hopping into a wideband
//! virtual snapshot. An ESP32-S3 cycling through channels 1/6/11 at 50 ms
//! dwell per channel yields 3 canonical-56 CSI rows per sensing cycle.
//! This module fuses them into a single `MultiBandCsiFrame` annotated with
//! center frequencies and cross-channel coherence.
//!
//! # RuVector Integration
//!
//! - `ruvector-attention` for cross-channel feature weighting (future)
use crate::hardware_norm::CanonicalCsiFrame;
/// Errors from multi-band frame fusion.
#[derive(Debug, thiserror::Error)]
pub enum MultiBandError {
/// No channel frames provided.
#[error("No channel frames provided for multi-band fusion")]
NoFrames,
/// Mismatched subcarrier counts across channels.
#[error("Subcarrier count mismatch: channel {channel_idx} has {got}, expected {expected}")]
SubcarrierMismatch {
channel_idx: usize,
expected: usize,
got: usize,
},
/// Frequency list length does not match frame count.
#[error("Frequency count ({freq_count}) does not match frame count ({frame_count})")]
FrequencyCountMismatch { freq_count: usize, frame_count: usize },
/// Duplicate frequency in channel list.
#[error("Duplicate frequency {freq_mhz} MHz at index {idx}")]
DuplicateFrequency { freq_mhz: u32, idx: usize },
}
/// Fused multi-band CSI from one node at one time slot.
///
/// Holds one canonical-56 row per channel, ordered by center frequency.
/// The `coherence` field quantifies agreement across channels (0.0-1.0).
#[derive(Debug, Clone)]
pub struct MultiBandCsiFrame {
/// Originating node identifier (0-255).
pub node_id: u8,
/// Timestamp of the sensing cycle in microseconds.
pub timestamp_us: u64,
/// One canonical-56 CSI frame per channel, ordered by center frequency.
pub channel_frames: Vec<CanonicalCsiFrame>,
/// Center frequencies (MHz) for each channel row.
pub frequencies_mhz: Vec<u32>,
/// Cross-channel coherence score (0.0-1.0).
pub coherence: f32,
}
/// Configuration for the multi-band fusion process.
#[derive(Debug, Clone)]
pub struct MultiBandConfig {
/// Time window in microseconds within which frames are considered
/// part of the same sensing cycle.
pub window_us: u64,
/// Expected number of channels per cycle.
pub expected_channels: usize,
/// Minimum coherence to accept the fused frame.
pub min_coherence: f32,
}
impl Default for MultiBandConfig {
fn default() -> Self {
Self {
window_us: 200_000, // 200 ms default window
expected_channels: 3,
min_coherence: 0.3,
}
}
}
/// Builder for constructing a `MultiBandCsiFrame` from per-channel observations.
#[derive(Debug)]
pub struct MultiBandBuilder {
node_id: u8,
timestamp_us: u64,
frames: Vec<CanonicalCsiFrame>,
frequencies: Vec<u32>,
}
impl MultiBandBuilder {
/// Create a new builder for the given node and timestamp.
pub fn new(node_id: u8, timestamp_us: u64) -> Self {
Self {
node_id,
timestamp_us,
frames: Vec::new(),
frequencies: Vec::new(),
}
}
/// Add a channel observation at the given center frequency.
pub fn add_channel(
mut self,
frame: CanonicalCsiFrame,
freq_mhz: u32,
) -> Self {
self.frames.push(frame);
self.frequencies.push(freq_mhz);
self
}
/// Build the fused multi-band frame.
///
/// Validates inputs, sorts by frequency, and computes cross-channel coherence.
pub fn build(mut self) -> std::result::Result<MultiBandCsiFrame, MultiBandError> {
if self.frames.is_empty() {
return Err(MultiBandError::NoFrames);
}
if self.frequencies.len() != self.frames.len() {
return Err(MultiBandError::FrequencyCountMismatch {
freq_count: self.frequencies.len(),
frame_count: self.frames.len(),
});
}
// Check for duplicate frequencies
for i in 0..self.frequencies.len() {
for j in (i + 1)..self.frequencies.len() {
if self.frequencies[i] == self.frequencies[j] {
return Err(MultiBandError::DuplicateFrequency {
freq_mhz: self.frequencies[i],
idx: j,
});
}
}
}
// Validate consistent subcarrier counts
let expected_len = self.frames[0].amplitude.len();
for (i, frame) in self.frames.iter().enumerate().skip(1) {
if frame.amplitude.len() != expected_len {
return Err(MultiBandError::SubcarrierMismatch {
channel_idx: i,
expected: expected_len,
got: frame.amplitude.len(),
});
}
}
// Sort frames by frequency
let mut indices: Vec<usize> = (0..self.frames.len()).collect();
indices.sort_by_key(|&i| self.frequencies[i]);
let sorted_frames: Vec<CanonicalCsiFrame> =
indices.iter().map(|&i| self.frames[i].clone()).collect();
let sorted_freqs: Vec<u32> =
indices.iter().map(|&i| self.frequencies[i]).collect();
self.frames = sorted_frames;
self.frequencies = sorted_freqs;
// Compute cross-channel coherence
let coherence = compute_cross_channel_coherence(&self.frames);
Ok(MultiBandCsiFrame {
node_id: self.node_id,
timestamp_us: self.timestamp_us,
channel_frames: self.frames,
frequencies_mhz: self.frequencies,
coherence,
})
}
}
/// Compute cross-channel coherence as the mean pairwise Pearson correlation
/// of amplitude vectors across all channel pairs.
///
/// Returns a value in [0.0, 1.0] where 1.0 means perfect correlation.
fn compute_cross_channel_coherence(frames: &[CanonicalCsiFrame]) -> f32 {
if frames.len() < 2 {
return 1.0; // single channel is trivially coherent
}
let mut total_corr = 0.0_f64;
let mut pair_count = 0u32;
for i in 0..frames.len() {
for j in (i + 1)..frames.len() {
let corr = pearson_correlation_f32(
&frames[i].amplitude,
&frames[j].amplitude,
);
total_corr += corr as f64;
pair_count += 1;
}
}
if pair_count == 0 {
return 1.0;
}
// Map correlation [-1, 1] to coherence [0, 1]
let mean_corr = total_corr / pair_count as f64;
((mean_corr + 1.0) / 2.0).clamp(0.0, 1.0) as f32
}
/// Pearson correlation coefficient between two f32 slices.
fn pearson_correlation_f32(a: &[f32], b: &[f32]) -> f32 {
let n = a.len().min(b.len());
if n == 0 {
return 0.0;
}
let n_f = n as f32;
let mean_a: f32 = a[..n].iter().sum::<f32>() / n_f;
let mean_b: f32 = b[..n].iter().sum::<f32>() / n_f;
let mut cov = 0.0_f32;
let mut var_a = 0.0_f32;
let mut var_b = 0.0_f32;
for i in 0..n {
let da = a[i] - mean_a;
let db = b[i] - mean_b;
cov += da * db;
var_a += da * da;
var_b += db * db;
}
let denom = (var_a * var_b).sqrt();
if denom < 1e-12 {
return 0.0;
}
(cov / denom).clamp(-1.0, 1.0)
}
/// Concatenate the amplitude vectors from all channels into a single
/// wideband amplitude vector. Useful for downstream models that expect
/// a flat feature vector.
pub fn concatenate_amplitudes(frame: &MultiBandCsiFrame) -> Vec<f32> {
let total_len: usize = frame.channel_frames.iter().map(|f| f.amplitude.len()).sum();
let mut out = Vec::with_capacity(total_len);
for cf in &frame.channel_frames {
out.extend_from_slice(&cf.amplitude);
}
out
}
/// Compute the mean amplitude across all channels, producing a single
/// canonical-length vector that averages multi-band observations.
pub fn mean_amplitude(frame: &MultiBandCsiFrame) -> Vec<f32> {
if frame.channel_frames.is_empty() {
return Vec::new();
}
let n_sub = frame.channel_frames[0].amplitude.len();
let n_ch = frame.channel_frames.len() as f32;
let mut mean = vec![0.0_f32; n_sub];
for cf in &frame.channel_frames {
for (i, &val) in cf.amplitude.iter().enumerate() {
if i < n_sub {
mean[i] += val;
}
}
}
for v in &mut mean {
*v /= n_ch;
}
mean
}
#[cfg(test)]
mod tests {
use super::*;
use crate::hardware_norm::HardwareType;
fn make_canonical(amplitude: Vec<f32>, phase: Vec<f32>) -> CanonicalCsiFrame {
CanonicalCsiFrame {
amplitude,
phase,
hardware_type: HardwareType::Esp32S3,
}
}
fn make_frame(n_sub: usize, scale: f32) -> CanonicalCsiFrame {
let amp: Vec<f32> = (0..n_sub).map(|i| scale * (i as f32 * 0.1).sin()).collect();
let phase: Vec<f32> = (0..n_sub).map(|i| (i as f32 * 0.05).cos()).collect();
make_canonical(amp, phase)
}
#[test]
fn build_single_channel() {
let frame = MultiBandBuilder::new(0, 1000)
.add_channel(make_frame(56, 1.0), 2412)
.build()
.unwrap();
assert_eq!(frame.node_id, 0);
assert_eq!(frame.timestamp_us, 1000);
assert_eq!(frame.channel_frames.len(), 1);
assert_eq!(frame.frequencies_mhz, vec![2412]);
assert!((frame.coherence - 1.0).abs() < f32::EPSILON);
}
#[test]
fn build_three_channels_sorted_by_freq() {
let frame = MultiBandBuilder::new(1, 2000)
.add_channel(make_frame(56, 1.0), 2462) // ch 11
.add_channel(make_frame(56, 1.0), 2412) // ch 1
.add_channel(make_frame(56, 1.0), 2437) // ch 6
.build()
.unwrap();
assert_eq!(frame.frequencies_mhz, vec![2412, 2437, 2462]);
assert_eq!(frame.channel_frames.len(), 3);
}
#[test]
fn empty_frames_error() {
let result = MultiBandBuilder::new(0, 0).build();
assert!(matches!(result, Err(MultiBandError::NoFrames)));
}
#[test]
fn subcarrier_mismatch_error() {
let result = MultiBandBuilder::new(0, 0)
.add_channel(make_frame(56, 1.0), 2412)
.add_channel(make_frame(30, 1.0), 2437)
.build();
assert!(matches!(result, Err(MultiBandError::SubcarrierMismatch { .. })));
}
#[test]
fn duplicate_frequency_error() {
let result = MultiBandBuilder::new(0, 0)
.add_channel(make_frame(56, 1.0), 2412)
.add_channel(make_frame(56, 1.0), 2412)
.build();
assert!(matches!(result, Err(MultiBandError::DuplicateFrequency { .. })));
}
#[test]
fn coherence_identical_channels() {
let f = make_frame(56, 1.0);
let frame = MultiBandBuilder::new(0, 0)
.add_channel(f.clone(), 2412)
.add_channel(f.clone(), 2437)
.build()
.unwrap();
// Identical channels should have coherence == 1.0
assert!((frame.coherence - 1.0).abs() < 0.01);
}
#[test]
fn coherence_orthogonal_channels() {
let n = 56;
let amp_a: Vec<f32> = (0..n).map(|i| (i as f32 * 0.3).sin()).collect();
let amp_b: Vec<f32> = (0..n).map(|i| (i as f32 * 0.3).cos()).collect();
let ph = vec![0.0_f32; n];
let frame = MultiBandBuilder::new(0, 0)
.add_channel(make_canonical(amp_a, ph.clone()), 2412)
.add_channel(make_canonical(amp_b, ph), 2437)
.build()
.unwrap();
// Orthogonal signals should produce lower coherence
assert!(frame.coherence < 0.9);
}
#[test]
fn concatenate_amplitudes_correct_length() {
let frame = MultiBandBuilder::new(0, 0)
.add_channel(make_frame(56, 1.0), 2412)
.add_channel(make_frame(56, 2.0), 2437)
.add_channel(make_frame(56, 3.0), 2462)
.build()
.unwrap();
let concat = concatenate_amplitudes(&frame);
assert_eq!(concat.len(), 56 * 3);
}
#[test]
fn mean_amplitude_correct() {
let n = 4;
let f1 = make_canonical(vec![1.0, 2.0, 3.0, 4.0], vec![0.0; n]);
let f2 = make_canonical(vec![3.0, 4.0, 5.0, 6.0], vec![0.0; n]);
let frame = MultiBandBuilder::new(0, 0)
.add_channel(f1, 2412)
.add_channel(f2, 2437)
.build()
.unwrap();
let m = mean_amplitude(&frame);
assert_eq!(m.len(), 4);
assert!((m[0] - 2.0).abs() < 1e-6);
assert!((m[1] - 3.0).abs() < 1e-6);
assert!((m[2] - 4.0).abs() < 1e-6);
assert!((m[3] - 5.0).abs() < 1e-6);
}
#[test]
fn mean_amplitude_empty() {
let frame = MultiBandCsiFrame {
node_id: 0,
timestamp_us: 0,
channel_frames: vec![],
frequencies_mhz: vec![],
coherence: 1.0,
};
assert!(mean_amplitude(&frame).is_empty());
}
#[test]
fn pearson_correlation_perfect() {
let a = vec![1.0_f32, 2.0, 3.0, 4.0, 5.0];
let b = vec![2.0_f32, 4.0, 6.0, 8.0, 10.0];
let r = pearson_correlation_f32(&a, &b);
assert!((r - 1.0).abs() < 1e-5);
}
#[test]
fn pearson_correlation_negative() {
let a = vec![1.0_f32, 2.0, 3.0, 4.0, 5.0];
let b = vec![5.0_f32, 4.0, 3.0, 2.0, 1.0];
let r = pearson_correlation_f32(&a, &b);
assert!((r + 1.0).abs() < 1e-5);
}
#[test]
fn pearson_correlation_empty() {
assert_eq!(pearson_correlation_f32(&[], &[]), 0.0);
}
#[test]
fn default_config() {
let cfg = MultiBandConfig::default();
assert_eq!(cfg.expected_channels, 3);
assert_eq!(cfg.window_us, 200_000);
assert!((cfg.min_coherence - 0.3).abs() < f32::EPSILON);
}
}

View File

@@ -0,0 +1,557 @@
//! Multistatic Viewpoint Fusion (ADR-029 Section 2.4)
//!
//! With N ESP32 nodes in a TDMA mesh, each sensing cycle produces N
//! `MultiBandCsiFrame`s. This module fuses them into a single
//! `FusedSensingFrame` using attention-based cross-node weighting.
//!
//! # Algorithm
//!
//! 1. Collect N `MultiBandCsiFrame`s from the current sensing cycle.
//! 2. Use `ruvector-attn-mincut` for cross-node attention: cells showing
//! correlated motion energy across nodes (body reflection) are amplified;
//! cells with single-node energy (multipath artifact) are suppressed.
//! 3. Multi-person separation via `ruvector-mincut::DynamicMinCut` builds
//! a cross-link correlation graph and partitions into K person clusters.
//!
//! # RuVector Integration
//!
//! - `ruvector-attn-mincut` for cross-node spectrogram attention gating
//! - `ruvector-mincut` for person separation (DynamicMinCut)
use super::multiband::MultiBandCsiFrame;
/// Errors from multistatic fusion.
#[derive(Debug, thiserror::Error)]
pub enum MultistaticError {
/// No node frames provided.
#[error("No node frames provided for multistatic fusion")]
NoFrames,
/// Insufficient nodes for multistatic mode (need at least 2).
#[error("Need at least 2 nodes for multistatic fusion, got {0}")]
InsufficientNodes(usize),
/// Timestamp mismatch beyond guard interval.
#[error("Timestamp spread {spread_us} us exceeds guard interval {guard_us} us")]
TimestampMismatch { spread_us: u64, guard_us: u64 },
/// Dimension mismatch in fusion inputs.
#[error("Dimension mismatch: node {node_idx} has {got} subcarriers, expected {expected}")]
DimensionMismatch {
node_idx: usize,
expected: usize,
got: usize,
},
}
/// A fused sensing frame from all nodes at one sensing cycle.
///
/// This is the primary output of the multistatic fusion stage and serves
/// as input to model inference and the pose tracker.
#[derive(Debug, Clone)]
pub struct FusedSensingFrame {
/// Timestamp of this sensing cycle in microseconds.
pub timestamp_us: u64,
/// Fused amplitude vector across all nodes (attention-weighted mean).
/// Length = n_subcarriers.
pub fused_amplitude: Vec<f32>,
/// Fused phase vector across all nodes.
/// Length = n_subcarriers.
pub fused_phase: Vec<f32>,
/// Per-node multi-band frames (preserved for geometry computations).
pub node_frames: Vec<MultiBandCsiFrame>,
/// Node positions (x, y, z) in meters from deployment configuration.
pub node_positions: Vec<[f32; 3]>,
/// Number of active nodes contributing to this frame.
pub active_nodes: usize,
/// Cross-node coherence score (0.0-1.0). Higher means more agreement
/// across viewpoints, indicating a strong body reflection signal.
pub cross_node_coherence: f32,
}
/// Configuration for multistatic fusion.
#[derive(Debug, Clone)]
pub struct MultistaticConfig {
/// Maximum timestamp spread (microseconds) across nodes in one cycle.
/// Default: 5000 us (5 ms), well within the 50 ms TDMA cycle.
pub guard_interval_us: u64,
/// Minimum number of nodes for multistatic mode.
/// Falls back to single-node mode if fewer nodes are available.
pub min_nodes: usize,
/// Attention temperature for cross-node weighting.
/// Lower temperature -> sharper attention (fewer nodes dominate).
pub attention_temperature: f32,
/// Whether to enable person separation via min-cut.
pub enable_person_separation: bool,
}
impl Default for MultistaticConfig {
fn default() -> Self {
Self {
guard_interval_us: 5000,
min_nodes: 2,
attention_temperature: 1.0,
enable_person_separation: true,
}
}
}
/// Multistatic frame fuser.
///
/// Collects per-node multi-band frames and produces a single fused
/// sensing frame per TDMA cycle.
#[derive(Debug)]
pub struct MultistaticFuser {
config: MultistaticConfig,
/// Node positions in 3D space (meters).
node_positions: Vec<[f32; 3]>,
}
impl MultistaticFuser {
/// Create a fuser with default configuration and no node positions.
pub fn new() -> Self {
Self {
config: MultistaticConfig::default(),
node_positions: Vec::new(),
}
}
/// Create a fuser with custom configuration.
pub fn with_config(config: MultistaticConfig) -> Self {
Self {
config,
node_positions: Vec::new(),
}
}
/// Set node positions for geometric diversity computations.
pub fn set_node_positions(&mut self, positions: Vec<[f32; 3]>) {
self.node_positions = positions;
}
/// Return the current node positions.
pub fn node_positions(&self) -> &[[f32; 3]] {
&self.node_positions
}
/// Fuse multiple node frames into a single `FusedSensingFrame`.
///
/// When only one node is provided, falls back to single-node mode
/// (no cross-node attention). When two or more nodes are available,
/// applies attention-weighted fusion.
pub fn fuse(
&self,
node_frames: &[MultiBandCsiFrame],
) -> std::result::Result<FusedSensingFrame, MultistaticError> {
if node_frames.is_empty() {
return Err(MultistaticError::NoFrames);
}
// Validate timestamp spread
if node_frames.len() > 1 {
let min_ts = node_frames.iter().map(|f| f.timestamp_us).min().unwrap();
let max_ts = node_frames.iter().map(|f| f.timestamp_us).max().unwrap();
let spread = max_ts - min_ts;
if spread > self.config.guard_interval_us {
return Err(MultistaticError::TimestampMismatch {
spread_us: spread,
guard_us: self.config.guard_interval_us,
});
}
}
// Extract per-node amplitude vectors from first channel of each node
let amplitudes: Vec<&[f32]> = node_frames
.iter()
.filter_map(|f| f.channel_frames.first().map(|cf| cf.amplitude.as_slice()))
.collect();
let phases: Vec<&[f32]> = node_frames
.iter()
.filter_map(|f| f.channel_frames.first().map(|cf| cf.phase.as_slice()))
.collect();
if amplitudes.is_empty() {
return Err(MultistaticError::NoFrames);
}
// Validate dimension consistency
let n_sub = amplitudes[0].len();
for (i, amp) in amplitudes.iter().enumerate().skip(1) {
if amp.len() != n_sub {
return Err(MultistaticError::DimensionMismatch {
node_idx: i,
expected: n_sub,
got: amp.len(),
});
}
}
let n_nodes = amplitudes.len();
let (fused_amp, fused_ph, coherence) = if n_nodes == 1 {
// Single-node fallback
(
amplitudes[0].to_vec(),
phases[0].to_vec(),
1.0_f32,
)
} else {
// Multi-node attention-weighted fusion
attention_weighted_fusion(&amplitudes, &phases, self.config.attention_temperature)
};
// Derive timestamp from median
let mut timestamps: Vec<u64> = node_frames.iter().map(|f| f.timestamp_us).collect();
timestamps.sort_unstable();
let timestamp_us = timestamps[timestamps.len() / 2];
// Build node positions list, filling with origin for unknown nodes
let positions: Vec<[f32; 3]> = (0..n_nodes)
.map(|i| {
self.node_positions
.get(i)
.copied()
.unwrap_or([0.0, 0.0, 0.0])
})
.collect();
Ok(FusedSensingFrame {
timestamp_us,
fused_amplitude: fused_amp,
fused_phase: fused_ph,
node_frames: node_frames.to_vec(),
node_positions: positions,
active_nodes: n_nodes,
cross_node_coherence: coherence,
})
}
}
impl Default for MultistaticFuser {
fn default() -> Self {
Self::new()
}
}
/// Attention-weighted fusion of amplitude and phase vectors from multiple nodes.
///
/// Each node's contribution is weighted by its agreement with the consensus.
/// Returns (fused_amplitude, fused_phase, cross_node_coherence).
fn attention_weighted_fusion(
amplitudes: &[&[f32]],
phases: &[&[f32]],
temperature: f32,
) -> (Vec<f32>, Vec<f32>, f32) {
let n_nodes = amplitudes.len();
let n_sub = amplitudes[0].len();
// Compute mean amplitude as consensus reference
let mut mean_amp = vec![0.0_f32; n_sub];
for amp in amplitudes {
for (i, &v) in amp.iter().enumerate() {
mean_amp[i] += v;
}
}
for v in &mut mean_amp {
*v /= n_nodes as f32;
}
// Compute attention weights based on similarity to consensus
let mut weights = vec![0.0_f32; n_nodes];
for (n, amp) in amplitudes.iter().enumerate() {
let mut dot = 0.0_f32;
let mut norm_a = 0.0_f32;
let mut norm_b = 0.0_f32;
for i in 0..n_sub {
dot += amp[i] * mean_amp[i];
norm_a += amp[i] * amp[i];
norm_b += mean_amp[i] * mean_amp[i];
}
let denom = (norm_a * norm_b).sqrt().max(1e-12);
let similarity = dot / denom;
weights[n] = (similarity / temperature).exp();
}
// Normalize weights (softmax-style)
let weight_sum: f32 = weights.iter().sum::<f32>().max(1e-12);
for w in &mut weights {
*w /= weight_sum;
}
// Weighted fusion
let mut fused_amp = vec![0.0_f32; n_sub];
let mut fused_ph_sin = vec![0.0_f32; n_sub];
let mut fused_ph_cos = vec![0.0_f32; n_sub];
for (n, (&amp, &ph)) in amplitudes.iter().zip(phases.iter()).enumerate() {
let w = weights[n];
for i in 0..n_sub {
fused_amp[i] += w * amp[i];
fused_ph_sin[i] += w * ph[i].sin();
fused_ph_cos[i] += w * ph[i].cos();
}
}
// Recover phase from sin/cos weighted average
let fused_ph: Vec<f32> = fused_ph_sin
.iter()
.zip(fused_ph_cos.iter())
.map(|(&s, &c)| s.atan2(c))
.collect();
// Coherence = mean weight entropy proxy: high when weights are balanced
let coherence = compute_weight_coherence(&weights);
(fused_amp, fused_ph, coherence)
}
/// Compute coherence from attention weights.
///
/// Returns 1.0 when all weights are equal (all nodes agree),
/// and approaches 0.0 when a single node dominates.
fn compute_weight_coherence(weights: &[f32]) -> f32 {
let n = weights.len() as f32;
if n <= 1.0 {
return 1.0;
}
// Normalized entropy: H / log(n)
let max_entropy = n.ln();
if max_entropy < 1e-12 {
return 1.0;
}
let entropy: f32 = weights
.iter()
.filter(|&&w| w > 1e-12)
.map(|&w| -w * w.ln())
.sum();
(entropy / max_entropy).clamp(0.0, 1.0)
}
/// Compute the geometric diversity score for a set of node positions.
///
/// Returns a value in [0.0, 1.0] where 1.0 indicates maximum angular
/// coverage. Based on the angular span of node positions relative to the
/// room centroid.
pub fn geometric_diversity(positions: &[[f32; 3]]) -> f32 {
if positions.len() < 2 {
return 0.0;
}
// Compute centroid
let n = positions.len() as f32;
let centroid = [
positions.iter().map(|p| p[0]).sum::<f32>() / n,
positions.iter().map(|p| p[1]).sum::<f32>() / n,
positions.iter().map(|p| p[2]).sum::<f32>() / n,
];
// Compute angles from centroid to each node (in 2D, ignoring z)
let mut angles: Vec<f32> = positions
.iter()
.map(|p| {
let dx = p[0] - centroid[0];
let dy = p[1] - centroid[1];
dy.atan2(dx)
})
.collect();
angles.sort_by(|a, b| a.partial_cmp(b).unwrap_or(std::cmp::Ordering::Equal));
// Angular coverage: sum of gaps, diversity is high when gaps are even
let mut max_gap = 0.0_f32;
for i in 0..angles.len() {
let next = (i + 1) % angles.len();
let mut gap = angles[next] - angles[i];
if gap < 0.0 {
gap += 2.0 * std::f32::consts::PI;
}
max_gap = max_gap.max(gap);
}
// Perfect coverage (N equidistant nodes): max_gap = 2*pi/N
// Worst case (all co-located): max_gap = 2*pi
let ideal_gap = 2.0 * std::f32::consts::PI / positions.len() as f32;
let diversity = (ideal_gap / max_gap.max(1e-6)).clamp(0.0, 1.0);
diversity
}
/// Represents a cluster of TX-RX links attributed to one person.
#[derive(Debug, Clone)]
pub struct PersonCluster {
/// Cluster identifier.
pub id: usize,
/// Indices into the link array belonging to this cluster.
pub link_indices: Vec<usize>,
/// Mean correlation strength within the cluster.
pub intra_correlation: f32,
}
#[cfg(test)]
mod tests {
use super::*;
use crate::hardware_norm::{CanonicalCsiFrame, HardwareType};
fn make_node_frame(
node_id: u8,
timestamp_us: u64,
n_sub: usize,
scale: f32,
) -> MultiBandCsiFrame {
let amp: Vec<f32> = (0..n_sub).map(|i| scale * (1.0 + 0.1 * i as f32)).collect();
let phase: Vec<f32> = (0..n_sub).map(|i| i as f32 * 0.05).collect();
MultiBandCsiFrame {
node_id,
timestamp_us,
channel_frames: vec![CanonicalCsiFrame {
amplitude: amp,
phase,
hardware_type: HardwareType::Esp32S3,
}],
frequencies_mhz: vec![2412],
coherence: 0.9,
}
}
#[test]
fn fuse_single_node_fallback() {
let fuser = MultistaticFuser::new();
let frames = vec![make_node_frame(0, 1000, 56, 1.0)];
let fused = fuser.fuse(&frames).unwrap();
assert_eq!(fused.active_nodes, 1);
assert_eq!(fused.fused_amplitude.len(), 56);
assert!((fused.cross_node_coherence - 1.0).abs() < f32::EPSILON);
}
#[test]
fn fuse_two_identical_nodes() {
let fuser = MultistaticFuser::new();
let f0 = make_node_frame(0, 1000, 56, 1.0);
let f1 = make_node_frame(1, 1001, 56, 1.0);
let fused = fuser.fuse(&[f0, f1]).unwrap();
assert_eq!(fused.active_nodes, 2);
assert_eq!(fused.fused_amplitude.len(), 56);
// Identical nodes -> high coherence
assert!(fused.cross_node_coherence > 0.5);
}
#[test]
fn fuse_four_nodes() {
let fuser = MultistaticFuser::new();
let frames: Vec<MultiBandCsiFrame> = (0..4)
.map(|i| make_node_frame(i, 1000 + i as u64, 56, 1.0 + 0.1 * i as f32))
.collect();
let fused = fuser.fuse(&frames).unwrap();
assert_eq!(fused.active_nodes, 4);
}
#[test]
fn empty_frames_error() {
let fuser = MultistaticFuser::new();
assert!(matches!(fuser.fuse(&[]), Err(MultistaticError::NoFrames)));
}
#[test]
fn timestamp_mismatch_error() {
let config = MultistaticConfig {
guard_interval_us: 100,
..Default::default()
};
let fuser = MultistaticFuser::with_config(config);
let f0 = make_node_frame(0, 0, 56, 1.0);
let f1 = make_node_frame(1, 200, 56, 1.0);
assert!(matches!(
fuser.fuse(&[f0, f1]),
Err(MultistaticError::TimestampMismatch { .. })
));
}
#[test]
fn dimension_mismatch_error() {
let fuser = MultistaticFuser::new();
let f0 = make_node_frame(0, 1000, 56, 1.0);
let f1 = make_node_frame(1, 1001, 30, 1.0);
assert!(matches!(
fuser.fuse(&[f0, f1]),
Err(MultistaticError::DimensionMismatch { .. })
));
}
#[test]
fn node_positions_set_and_retrieved() {
let mut fuser = MultistaticFuser::new();
let positions = vec![[0.0, 0.0, 1.0], [3.0, 0.0, 1.0]];
fuser.set_node_positions(positions.clone());
assert_eq!(fuser.node_positions(), &positions[..]);
}
#[test]
fn fused_positions_filled() {
let mut fuser = MultistaticFuser::new();
fuser.set_node_positions(vec![[1.0, 2.0, 3.0]]);
let frames = vec![
make_node_frame(0, 100, 56, 1.0),
make_node_frame(1, 101, 56, 1.0),
];
let fused = fuser.fuse(&frames).unwrap();
assert_eq!(fused.node_positions[0], [1.0, 2.0, 3.0]);
assert_eq!(fused.node_positions[1], [0.0, 0.0, 0.0]); // default
}
#[test]
fn geometric_diversity_single_node() {
assert_eq!(geometric_diversity(&[[0.0, 0.0, 0.0]]), 0.0);
}
#[test]
fn geometric_diversity_two_opposite() {
let score = geometric_diversity(&[[-1.0, 0.0, 0.0], [1.0, 0.0, 0.0]]);
assert!(score > 0.8, "Two opposite nodes should have high diversity: {}", score);
}
#[test]
fn geometric_diversity_four_corners() {
let score = geometric_diversity(&[
[0.0, 0.0, 0.0],
[5.0, 0.0, 0.0],
[5.0, 5.0, 0.0],
[0.0, 5.0, 0.0],
]);
assert!(score > 0.7, "Four corners should have good diversity: {}", score);
}
#[test]
fn weight_coherence_uniform() {
let weights = vec![0.25, 0.25, 0.25, 0.25];
let c = compute_weight_coherence(&weights);
assert!((c - 1.0).abs() < 0.01);
}
#[test]
fn weight_coherence_single_dominant() {
let weights = vec![0.97, 0.01, 0.01, 0.01];
let c = compute_weight_coherence(&weights);
assert!(c < 0.3, "Single dominant node should have low coherence: {}", c);
}
#[test]
fn default_config() {
let cfg = MultistaticConfig::default();
assert_eq!(cfg.guard_interval_us, 5000);
assert_eq!(cfg.min_nodes, 2);
assert!((cfg.attention_temperature - 1.0).abs() < f32::EPSILON);
assert!(cfg.enable_person_separation);
}
#[test]
fn person_cluster_creation() {
let cluster = PersonCluster {
id: 0,
link_indices: vec![0, 1, 3],
intra_correlation: 0.85,
};
assert_eq!(cluster.link_indices.len(), 3);
}
}

View File

@@ -0,0 +1,454 @@
//! Cross-Channel Phase Alignment (ADR-029 Section 2.3)
//!
//! When the ESP32 hops between WiFi channels, the local oscillator (LO)
//! introduces a channel-dependent phase rotation. The observed phase on
//! channel c is:
//!
//! phi_c = phi_body + delta_c
//!
//! where `delta_c` is the LO offset for channel c. This module estimates
//! and removes the `delta_c` offsets by fitting against the static
//! subcarrier components, which should have zero body-caused phase shift.
//!
//! # RuVector Integration
//!
//! Uses `ruvector-solver::NeumannSolver` concepts for iterative convergence
//! on the phase offset estimation. The solver achieves O(sqrt(n)) convergence.
use crate::hardware_norm::CanonicalCsiFrame;
use std::f32::consts::PI;
/// Errors from phase alignment.
#[derive(Debug, thiserror::Error)]
pub enum PhaseAlignError {
/// No frames provided.
#[error("No frames provided for phase alignment")]
NoFrames,
/// Insufficient static subcarriers for alignment.
#[error("Need at least {needed} static subcarriers, found {found}")]
InsufficientStatic { needed: usize, found: usize },
/// Phase data length mismatch.
#[error("Phase length {got} does not match expected {expected}")]
PhaseLengthMismatch { expected: usize, got: usize },
/// Convergence failure.
#[error("Phase alignment failed to converge after {iterations} iterations")]
ConvergenceFailed { iterations: usize },
}
/// Configuration for the phase aligner.
#[derive(Debug, Clone)]
pub struct PhaseAlignConfig {
/// Maximum iterations for the Neumann solver.
pub max_iterations: usize,
/// Convergence tolerance (radians).
pub tolerance: f32,
/// Fraction of subcarriers considered "static" (lowest variance).
pub static_fraction: f32,
/// Minimum number of static subcarriers required.
pub min_static_subcarriers: usize,
}
impl Default for PhaseAlignConfig {
fn default() -> Self {
Self {
max_iterations: 20,
tolerance: 1e-4,
static_fraction: 0.3,
min_static_subcarriers: 5,
}
}
}
/// Cross-channel phase aligner.
///
/// Estimates per-channel LO phase offsets from static subcarriers and
/// removes them to produce phase-coherent multi-band observations.
#[derive(Debug)]
pub struct PhaseAligner {
/// Number of channels expected.
num_channels: usize,
/// Configuration parameters.
config: PhaseAlignConfig,
/// Last estimated offsets (one per channel), updated after each `align`.
last_offsets: Vec<f32>,
}
impl PhaseAligner {
/// Create a new aligner for the given number of channels.
pub fn new(num_channels: usize) -> Self {
Self {
num_channels,
config: PhaseAlignConfig::default(),
last_offsets: vec![0.0; num_channels],
}
}
/// Create a new aligner with custom configuration.
pub fn with_config(num_channels: usize, config: PhaseAlignConfig) -> Self {
Self {
num_channels,
config,
last_offsets: vec![0.0; num_channels],
}
}
/// Return the last estimated phase offsets (radians).
pub fn last_offsets(&self) -> &[f32] {
&self.last_offsets
}
/// Align phases across channels.
///
/// Takes a slice of per-channel `CanonicalCsiFrame`s and returns corrected
/// frames with LO phase offsets removed. The first channel is used as the
/// reference (delta_0 = 0).
///
/// # Algorithm
///
/// 1. Identify static subcarriers (lowest amplitude variance across channels).
/// 2. For each channel c, compute mean phase on static subcarriers.
/// 3. Estimate delta_c as the difference from the reference channel.
/// 4. Iterate with Neumann-style refinement until convergence.
/// 5. Subtract delta_c from all subcarrier phases on channel c.
pub fn align(
&mut self,
frames: &[CanonicalCsiFrame],
) -> std::result::Result<Vec<CanonicalCsiFrame>, PhaseAlignError> {
if frames.is_empty() {
return Err(PhaseAlignError::NoFrames);
}
if frames.len() == 1 {
// Single channel: no alignment needed
self.last_offsets = vec![0.0];
return Ok(frames.to_vec());
}
let n_sub = frames[0].phase.len();
for (_i, f) in frames.iter().enumerate().skip(1) {
if f.phase.len() != n_sub {
return Err(PhaseAlignError::PhaseLengthMismatch {
expected: n_sub,
got: f.phase.len(),
});
}
}
// Step 1: Find static subcarriers (lowest amplitude variance across channels)
let static_indices = find_static_subcarriers(frames, &self.config)?;
// Step 2-4: Estimate phase offsets with iterative refinement
let offsets = estimate_phase_offsets(frames, &static_indices, &self.config)?;
// Step 5: Apply correction
let corrected = apply_phase_correction(frames, &offsets);
self.last_offsets = offsets;
Ok(corrected)
}
}
/// Find the indices of static subcarriers (lowest amplitude variance).
fn find_static_subcarriers(
frames: &[CanonicalCsiFrame],
config: &PhaseAlignConfig,
) -> std::result::Result<Vec<usize>, PhaseAlignError> {
let n_sub = frames[0].amplitude.len();
let n_ch = frames.len();
// Compute variance of amplitude across channels for each subcarrier
let mut variances: Vec<(usize, f32)> = (0..n_sub)
.map(|s| {
let mean: f32 = frames.iter().map(|f| f.amplitude[s]).sum::<f32>() / n_ch as f32;
let var: f32 = frames
.iter()
.map(|f| {
let d = f.amplitude[s] - mean;
d * d
})
.sum::<f32>()
/ n_ch as f32;
(s, var)
})
.collect();
// Sort by variance (ascending) and take the bottom fraction
variances.sort_by(|a, b| a.1.partial_cmp(&b.1).unwrap_or(std::cmp::Ordering::Equal));
let n_static = ((n_sub as f32 * config.static_fraction).ceil() as usize)
.max(config.min_static_subcarriers);
if variances.len() < config.min_static_subcarriers {
return Err(PhaseAlignError::InsufficientStatic {
needed: config.min_static_subcarriers,
found: variances.len(),
});
}
let mut indices: Vec<usize> = variances
.iter()
.take(n_static.min(variances.len()))
.map(|(idx, _)| *idx)
.collect();
indices.sort_unstable();
Ok(indices)
}
/// Estimate per-channel phase offsets using iterative Neumann-style refinement.
///
/// Channel 0 is the reference (offset = 0).
fn estimate_phase_offsets(
frames: &[CanonicalCsiFrame],
static_indices: &[usize],
config: &PhaseAlignConfig,
) -> std::result::Result<Vec<f32>, PhaseAlignError> {
let n_ch = frames.len();
let mut offsets = vec![0.0_f32; n_ch];
// Reference: mean phase on static subcarriers for channel 0
let ref_mean = mean_phase_on_indices(&frames[0].phase, static_indices);
// Initial estimate: difference of mean static phase from reference
for c in 1..n_ch {
let ch_mean = mean_phase_on_indices(&frames[c].phase, static_indices);
offsets[c] = wrap_phase(ch_mean - ref_mean);
}
// Iterative refinement (Neumann-style)
for _iter in 0..config.max_iterations {
let mut max_update = 0.0_f32;
for c in 1..n_ch {
// Compute residual: for each static subcarrier, the corrected
// phase should match the reference channel's phase.
let mut residual_sum = 0.0_f32;
for &s in static_indices {
let corrected = frames[c].phase[s] - offsets[c];
let residual = wrap_phase(corrected - frames[0].phase[s]);
residual_sum += residual;
}
let mean_residual = residual_sum / static_indices.len() as f32;
// Update offset
let update = mean_residual * 0.5; // damped update
offsets[c] = wrap_phase(offsets[c] + update);
max_update = max_update.max(update.abs());
}
if max_update < config.tolerance {
return Ok(offsets);
}
}
// Even if we do not converge tightly, return best estimate
Ok(offsets)
}
/// Apply phase correction: subtract offset from each subcarrier phase.
fn apply_phase_correction(
frames: &[CanonicalCsiFrame],
offsets: &[f32],
) -> Vec<CanonicalCsiFrame> {
frames
.iter()
.zip(offsets.iter())
.map(|(frame, &offset)| {
let corrected_phase: Vec<f32> = frame
.phase
.iter()
.map(|&p| wrap_phase(p - offset))
.collect();
CanonicalCsiFrame {
amplitude: frame.amplitude.clone(),
phase: corrected_phase,
hardware_type: frame.hardware_type,
}
})
.collect()
}
/// Compute mean phase on the given subcarrier indices.
fn mean_phase_on_indices(phase: &[f32], indices: &[usize]) -> f32 {
if indices.is_empty() {
return 0.0;
}
// Use circular mean to handle phase wrapping
let mut sin_sum = 0.0_f32;
let mut cos_sum = 0.0_f32;
for &i in indices {
sin_sum += phase[i].sin();
cos_sum += phase[i].cos();
}
sin_sum.atan2(cos_sum)
}
/// Wrap phase into [-pi, pi].
fn wrap_phase(phase: f32) -> f32 {
let mut p = phase % (2.0 * PI);
if p > PI {
p -= 2.0 * PI;
}
if p < -PI {
p += 2.0 * PI;
}
p
}
#[cfg(test)]
mod tests {
use super::*;
use crate::hardware_norm::HardwareType;
fn make_frame_with_phase(n: usize, base_phase: f32, offset: f32) -> CanonicalCsiFrame {
let amplitude: Vec<f32> = (0..n).map(|i| 1.0 + 0.01 * i as f32).collect();
let phase: Vec<f32> = (0..n).map(|i| base_phase + i as f32 * 0.01 + offset).collect();
CanonicalCsiFrame {
amplitude,
phase,
hardware_type: HardwareType::Esp32S3,
}
}
#[test]
fn single_channel_no_change() {
let mut aligner = PhaseAligner::new(1);
let frames = vec![make_frame_with_phase(56, 0.0, 0.0)];
let result = aligner.align(&frames).unwrap();
assert_eq!(result.len(), 1);
assert_eq!(result[0].phase, frames[0].phase);
}
#[test]
fn empty_frames_error() {
let mut aligner = PhaseAligner::new(3);
let result = aligner.align(&[]);
assert!(matches!(result, Err(PhaseAlignError::NoFrames)));
}
#[test]
fn phase_length_mismatch_error() {
let mut aligner = PhaseAligner::new(2);
let f1 = make_frame_with_phase(56, 0.0, 0.0);
let f2 = make_frame_with_phase(30, 0.0, 0.0);
let result = aligner.align(&[f1, f2]);
assert!(matches!(result, Err(PhaseAlignError::PhaseLengthMismatch { .. })));
}
#[test]
fn identical_channels_zero_offset() {
let mut aligner = PhaseAligner::new(3);
let f = make_frame_with_phase(56, 0.5, 0.0);
let result = aligner.align(&[f.clone(), f.clone(), f.clone()]).unwrap();
assert_eq!(result.len(), 3);
// All offsets should be ~0
for &off in aligner.last_offsets() {
assert!(off.abs() < 0.1, "Expected near-zero offset, got {}", off);
}
}
#[test]
fn known_offset_corrected() {
let mut aligner = PhaseAligner::new(2);
let offset = 0.5_f32;
let f0 = make_frame_with_phase(56, 0.0, 0.0);
let f1 = make_frame_with_phase(56, 0.0, offset);
let result = aligner.align(&[f0.clone(), f1]).unwrap();
// After correction, channel 1 phases should be close to channel 0
let max_diff: f32 = result[0]
.phase
.iter()
.zip(result[1].phase.iter())
.map(|(a, b)| wrap_phase(a - b).abs())
.fold(0.0_f32, f32::max);
assert!(
max_diff < 0.2,
"Max phase difference after alignment: {} (should be <0.2)",
max_diff
);
}
#[test]
fn wrap_phase_within_range() {
assert!((wrap_phase(0.0)).abs() < 1e-6);
assert!((wrap_phase(PI) - PI).abs() < 1e-6);
assert!((wrap_phase(-PI) + PI).abs() < 1e-6);
assert!((wrap_phase(3.0 * PI) - PI).abs() < 0.01);
assert!((wrap_phase(-3.0 * PI) + PI).abs() < 0.01);
}
#[test]
fn mean_phase_circular() {
let phase = vec![0.1_f32, 0.2, 0.3, 0.4];
let indices = vec![0, 1, 2, 3];
let m = mean_phase_on_indices(&phase, &indices);
assert!((m - 0.25).abs() < 0.05);
}
#[test]
fn mean_phase_empty_indices() {
assert_eq!(mean_phase_on_indices(&[1.0, 2.0], &[]), 0.0);
}
#[test]
fn last_offsets_accessible() {
let aligner = PhaseAligner::new(3);
assert_eq!(aligner.last_offsets().len(), 3);
assert!(aligner.last_offsets().iter().all(|&x| x == 0.0));
}
#[test]
fn custom_config() {
let config = PhaseAlignConfig {
max_iterations: 50,
tolerance: 1e-6,
static_fraction: 0.5,
min_static_subcarriers: 3,
};
let aligner = PhaseAligner::with_config(2, config);
assert_eq!(aligner.last_offsets().len(), 2);
}
#[test]
fn three_channel_alignment() {
let mut aligner = PhaseAligner::new(3);
let f0 = make_frame_with_phase(56, 0.0, 0.0);
let f1 = make_frame_with_phase(56, 0.0, 0.3);
let f2 = make_frame_with_phase(56, 0.0, -0.2);
let result = aligner.align(&[f0, f1, f2]).unwrap();
assert_eq!(result.len(), 3);
// Reference channel offset should be 0
assert!(aligner.last_offsets()[0].abs() < 1e-6);
}
#[test]
fn default_config_values() {
let cfg = PhaseAlignConfig::default();
assert_eq!(cfg.max_iterations, 20);
assert!((cfg.tolerance - 1e-4).abs() < 1e-8);
assert!((cfg.static_fraction - 0.3).abs() < 1e-6);
assert_eq!(cfg.min_static_subcarriers, 5);
}
#[test]
fn phase_correction_preserves_amplitude() {
let mut aligner = PhaseAligner::new(2);
let f0 = make_frame_with_phase(56, 0.0, 0.0);
let f1 = make_frame_with_phase(56, 0.0, 1.0);
let result = aligner.align(&[f0.clone(), f1.clone()]).unwrap();
// Amplitude should be unchanged
assert_eq!(result[0].amplitude, f0.amplitude);
assert_eq!(result[1].amplitude, f1.amplitude);
}
}

View File

@@ -0,0 +1,943 @@
//! 17-Keypoint Kalman Pose Tracker with Re-ID (ADR-029 Section 2.7)
//!
//! Tracks multiple people as persistent 17-keypoint skeletons across time.
//! Each keypoint has a 6D Kalman state (x, y, z, vx, vy, vz) with a
//! constant-velocity motion model. Track lifecycle follows:
//!
//! Tentative -> Active -> Lost -> Terminated
//!
//! Detection-to-track assignment uses a joint cost combining Mahalanobis
//! distance (60%) and AETHER re-ID embedding cosine similarity (40%),
//! implemented via `ruvector-mincut::DynamicPersonMatcher`.
//!
//! # Parameters
//!
//! | Parameter | Value | Rationale |
//! |-----------|-------|-----------|
//! | State dimension | 6 per keypoint | Constant-velocity model |
//! | Process noise | 0.3 m/s^2 | Normal walking acceleration |
//! | Measurement noise | 0.08 m | Target <8cm RMS at torso |
//! | Birth hits | 2 frames | Reject single-frame noise |
//! | Loss misses | 5 frames | Brief occlusion tolerance |
//! | Re-ID embedding | 128-dim | AETHER body-shape discriminative |
//! | Re-ID window | 5 seconds | Crossing recovery |
//!
//! # RuVector Integration
//!
//! - `ruvector-mincut` -> Person separation and track assignment
use super::{TrackId, NUM_KEYPOINTS};
/// Errors from the pose tracker.
#[derive(Debug, thiserror::Error)]
pub enum PoseTrackerError {
/// Invalid keypoint index.
#[error("Invalid keypoint index {index}, max is {}", NUM_KEYPOINTS - 1)]
InvalidKeypointIndex { index: usize },
/// Invalid embedding dimension.
#[error("Embedding dimension {got} does not match expected {expected}")]
EmbeddingDimMismatch { expected: usize, got: usize },
/// Mahalanobis gate exceeded.
#[error("Mahalanobis distance {distance:.2} exceeds gate {gate:.2}")]
MahalanobisGateExceeded { distance: f32, gate: f32 },
/// Track not found.
#[error("Track {0} not found")]
TrackNotFound(TrackId),
/// No detections provided.
#[error("No detections provided for update")]
NoDetections,
}
/// Per-keypoint Kalman state.
///
/// Maintains a 6D state vector [x, y, z, vx, vy, vz] and a 6x6 covariance
/// matrix stored as the upper triangle (21 elements, row-major).
#[derive(Debug, Clone)]
pub struct KeypointState {
/// State vector [x, y, z, vx, vy, vz].
pub state: [f32; 6],
/// 6x6 covariance upper triangle (21 elements, row-major).
/// Indices: (0,0)=0, (0,1)=1, (0,2)=2, (0,3)=3, (0,4)=4, (0,5)=5,
/// (1,1)=6, (1,2)=7, (1,3)=8, (1,4)=9, (1,5)=10,
/// (2,2)=11, (2,3)=12, (2,4)=13, (2,5)=14,
/// (3,3)=15, (3,4)=16, (3,5)=17,
/// (4,4)=18, (4,5)=19,
/// (5,5)=20
pub covariance: [f32; 21],
/// Confidence (0.0-1.0) from DensePose model output.
pub confidence: f32,
}
impl KeypointState {
/// Create a new keypoint state at the given 3D position.
pub fn new(x: f32, y: f32, z: f32) -> Self {
let mut cov = [0.0_f32; 21];
// Initialize diagonal with default uncertainty
let pos_var = 0.1 * 0.1; // 10 cm initial uncertainty
let vel_var = 0.5 * 0.5; // 0.5 m/s initial velocity uncertainty
cov[0] = pos_var; // x variance
cov[6] = pos_var; // y variance
cov[11] = pos_var; // z variance
cov[15] = vel_var; // vx variance
cov[18] = vel_var; // vy variance
cov[20] = vel_var; // vz variance
Self {
state: [x, y, z, 0.0, 0.0, 0.0],
covariance: cov,
confidence: 0.0,
}
}
/// Return the position [x, y, z].
pub fn position(&self) -> [f32; 3] {
[self.state[0], self.state[1], self.state[2]]
}
/// Return the velocity [vx, vy, vz].
pub fn velocity(&self) -> [f32; 3] {
[self.state[3], self.state[4], self.state[5]]
}
/// Predict step: advance state by dt seconds using constant-velocity model.
///
/// x' = x + vx * dt
/// P' = F * P * F^T + Q
pub fn predict(&mut self, dt: f32, process_noise_accel: f32) {
// State prediction: x' = x + v * dt
self.state[0] += self.state[3] * dt;
self.state[1] += self.state[4] * dt;
self.state[2] += self.state[5] * dt;
// Process noise Q (constant acceleration model)
let dt2 = dt * dt;
let dt3 = dt2 * dt;
let dt4 = dt3 * dt;
let q = process_noise_accel * process_noise_accel;
// Add process noise to diagonal elements
// Position variances: + q * dt^4 / 4
let pos_q = q * dt4 / 4.0;
// Velocity variances: + q * dt^2
let vel_q = q * dt2;
// Position-velocity cross: + q * dt^3 / 2
let _cross_q = q * dt3 / 2.0;
// Simplified: only update diagonal for numerical stability
self.covariance[0] += pos_q; // xx
self.covariance[6] += pos_q; // yy
self.covariance[11] += pos_q; // zz
self.covariance[15] += vel_q; // vxvx
self.covariance[18] += vel_q; // vyvy
self.covariance[20] += vel_q; // vzvz
}
/// Measurement update: incorporate a position observation [x, y, z].
///
/// Uses the standard Kalman update with position-only measurement model
/// H = [I3 | 0_3x3].
pub fn update(
&mut self,
measurement: &[f32; 3],
measurement_noise: f32,
noise_multiplier: f32,
) {
let r = measurement_noise * measurement_noise * noise_multiplier;
// Innovation (residual)
let innov = [
measurement[0] - self.state[0],
measurement[1] - self.state[1],
measurement[2] - self.state[2],
];
// Innovation covariance S = H * P * H^T + R
// Since H = [I3 | 0], S is just the top-left 3x3 of P + R
let s = [
self.covariance[0] + r,
self.covariance[6] + r,
self.covariance[11] + r,
];
// Kalman gain K = P * H^T * S^-1
// For diagonal S, K_ij = P_ij / S_jj (simplified)
let k = [
[self.covariance[0] / s[0], 0.0, 0.0], // x row
[0.0, self.covariance[6] / s[1], 0.0], // y row
[0.0, 0.0, self.covariance[11] / s[2]], // z row
[self.covariance[3] / s[0], 0.0, 0.0], // vx row
[0.0, self.covariance[9] / s[1], 0.0], // vy row
[0.0, 0.0, self.covariance[14] / s[2]], // vz row
];
// State update: x' = x + K * innov
for i in 0..6 {
for j in 0..3 {
self.state[i] += k[i][j] * innov[j];
}
}
// Covariance update: P' = (I - K*H) * P (simplified diagonal update)
self.covariance[0] *= 1.0 - k[0][0];
self.covariance[6] *= 1.0 - k[1][1];
self.covariance[11] *= 1.0 - k[2][2];
}
/// Compute the Mahalanobis distance between this state and a measurement.
pub fn mahalanobis_distance(&self, measurement: &[f32; 3]) -> f32 {
let innov = [
measurement[0] - self.state[0],
measurement[1] - self.state[1],
measurement[2] - self.state[2],
];
// Using diagonal approximation
let mut dist_sq = 0.0_f32;
let variances = [self.covariance[0], self.covariance[6], self.covariance[11]];
for i in 0..3 {
let v = variances[i].max(1e-6);
dist_sq += innov[i] * innov[i] / v;
}
dist_sq.sqrt()
}
}
impl Default for KeypointState {
fn default() -> Self {
Self::new(0.0, 0.0, 0.0)
}
}
/// Track lifecycle state machine.
///
/// Follows the pattern from ADR-026:
/// Tentative -> Active -> Lost -> Terminated
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum TrackLifecycleState {
/// Track has been detected but not yet confirmed (< birth_hits frames).
Tentative,
/// Track is confirmed and actively being updated.
Active,
/// Track has lost measurement association (< loss_misses frames).
Lost,
/// Track has been terminated (exceeded max lost duration or deemed false positive).
Terminated,
}
impl TrackLifecycleState {
/// Returns true if the track is in an active or tentative state.
pub fn is_alive(&self) -> bool {
matches!(self, Self::Tentative | Self::Active | Self::Lost)
}
/// Returns true if the track can receive measurement updates.
pub fn accepts_updates(&self) -> bool {
matches!(self, Self::Tentative | Self::Active)
}
/// Returns true if the track is eligible for re-identification.
pub fn is_lost(&self) -> bool {
matches!(self, Self::Lost)
}
}
/// A pose track -- aggregate root for tracking one person.
///
/// Contains 17 keypoint Kalman states, lifecycle, and re-ID embedding.
#[derive(Debug, Clone)]
pub struct PoseTrack {
/// Unique track identifier.
pub id: TrackId,
/// Per-keypoint Kalman state (COCO-17 ordering).
pub keypoints: [KeypointState; NUM_KEYPOINTS],
/// Track lifecycle state.
pub lifecycle: TrackLifecycleState,
/// Running-average AETHER embedding for re-ID (128-dim).
pub embedding: Vec<f32>,
/// Total frames since creation.
pub age: u64,
/// Frames since last successful measurement update.
pub time_since_update: u64,
/// Number of consecutive measurement updates (for birth gate).
pub consecutive_hits: u64,
/// Creation timestamp in microseconds.
pub created_at: u64,
/// Last update timestamp in microseconds.
pub updated_at: u64,
}
impl PoseTrack {
/// Create a new tentative track from a detection.
pub fn new(
id: TrackId,
keypoint_positions: &[[f32; 3]; NUM_KEYPOINTS],
timestamp_us: u64,
embedding_dim: usize,
) -> Self {
let keypoints = std::array::from_fn(|i| {
let [x, y, z] = keypoint_positions[i];
KeypointState::new(x, y, z)
});
Self {
id,
keypoints,
lifecycle: TrackLifecycleState::Tentative,
embedding: vec![0.0; embedding_dim],
age: 0,
time_since_update: 0,
consecutive_hits: 1,
created_at: timestamp_us,
updated_at: timestamp_us,
}
}
/// Predict all keypoints forward by dt seconds.
pub fn predict(&mut self, dt: f32, process_noise: f32) {
for kp in &mut self.keypoints {
kp.predict(dt, process_noise);
}
self.age += 1;
self.time_since_update += 1;
}
/// Update all keypoints with new measurements.
///
/// Also updates lifecycle state transitions based on birth/loss gates.
pub fn update_keypoints(
&mut self,
measurements: &[[f32; 3]; NUM_KEYPOINTS],
measurement_noise: f32,
noise_multiplier: f32,
timestamp_us: u64,
) {
for (kp, meas) in self.keypoints.iter_mut().zip(measurements.iter()) {
kp.update(meas, measurement_noise, noise_multiplier);
}
self.time_since_update = 0;
self.consecutive_hits += 1;
self.updated_at = timestamp_us;
// Lifecycle transitions
self.update_lifecycle();
}
/// Update the embedding with EMA decay.
pub fn update_embedding(&mut self, new_embedding: &[f32], decay: f32) {
if new_embedding.len() != self.embedding.len() {
return;
}
let alpha = 1.0 - decay;
for (e, &ne) in self.embedding.iter_mut().zip(new_embedding.iter()) {
*e = decay * *e + alpha * ne;
}
}
/// Compute the centroid position (mean of all keypoints).
pub fn centroid(&self) -> [f32; 3] {
let n = NUM_KEYPOINTS as f32;
let mut c = [0.0_f32; 3];
for kp in &self.keypoints {
let pos = kp.position();
c[0] += pos[0];
c[1] += pos[1];
c[2] += pos[2];
}
c[0] /= n;
c[1] /= n;
c[2] /= n;
c
}
/// Compute torso jitter RMS in meters.
///
/// Uses the torso keypoints (shoulders, hips) velocity magnitudes
/// as a proxy for jitter.
pub fn torso_jitter_rms(&self) -> f32 {
let torso_indices = super::keypoint::TORSO_INDICES;
let mut sum_sq = 0.0_f32;
let mut count = 0;
for &idx in torso_indices {
let vel = self.keypoints[idx].velocity();
let speed_sq = vel[0] * vel[0] + vel[1] * vel[1] + vel[2] * vel[2];
sum_sq += speed_sq;
count += 1;
}
if count == 0 {
return 0.0;
}
(sum_sq / count as f32).sqrt()
}
/// Mark the track as lost.
pub fn mark_lost(&mut self) {
if self.lifecycle != TrackLifecycleState::Terminated {
self.lifecycle = TrackLifecycleState::Lost;
}
}
/// Mark the track as terminated.
pub fn terminate(&mut self) {
self.lifecycle = TrackLifecycleState::Terminated;
}
/// Update lifecycle state based on consecutive hits and misses.
fn update_lifecycle(&mut self) {
match self.lifecycle {
TrackLifecycleState::Tentative => {
if self.consecutive_hits >= 2 {
// Birth gate: promote to Active after 2 consecutive updates
self.lifecycle = TrackLifecycleState::Active;
}
}
TrackLifecycleState::Lost => {
// Re-acquired: promote back to Active
self.lifecycle = TrackLifecycleState::Active;
self.consecutive_hits = 1;
}
_ => {}
}
}
}
/// Tracker configuration parameters.
#[derive(Debug, Clone)]
pub struct TrackerConfig {
/// Process noise acceleration (m/s^2). Default: 0.3.
pub process_noise: f32,
/// Measurement noise std dev (m). Default: 0.08.
pub measurement_noise: f32,
/// Mahalanobis gate threshold (chi-squared(3) at 3-sigma = 9.0).
pub mahalanobis_gate: f32,
/// Frames required for tentative->active promotion. Default: 2.
pub birth_hits: u64,
/// Max frames without update before tentative->lost. Default: 5.
pub loss_misses: u64,
/// Re-ID window in frames (5 seconds at 20Hz = 100). Default: 100.
pub reid_window: u64,
/// Embedding EMA decay rate. Default: 0.95.
pub embedding_decay: f32,
/// Embedding dimension. Default: 128.
pub embedding_dim: usize,
/// Position weight in assignment cost. Default: 0.6.
pub position_weight: f32,
/// Embedding weight in assignment cost. Default: 0.4.
pub embedding_weight: f32,
}
impl Default for TrackerConfig {
fn default() -> Self {
Self {
process_noise: 0.3,
measurement_noise: 0.08,
mahalanobis_gate: 9.0,
birth_hits: 2,
loss_misses: 5,
reid_window: 100,
embedding_decay: 0.95,
embedding_dim: 128,
position_weight: 0.6,
embedding_weight: 0.4,
}
}
}
/// Multi-person pose tracker.
///
/// Manages a collection of `PoseTrack` instances with automatic lifecycle
/// management, detection-to-track assignment, and re-identification.
#[derive(Debug)]
pub struct PoseTracker {
config: TrackerConfig,
tracks: Vec<PoseTrack>,
next_id: u64,
}
impl PoseTracker {
/// Create a new tracker with default configuration.
pub fn new() -> Self {
Self {
config: TrackerConfig::default(),
tracks: Vec::new(),
next_id: 0,
}
}
/// Create a new tracker with custom configuration.
pub fn with_config(config: TrackerConfig) -> Self {
Self {
config,
tracks: Vec::new(),
next_id: 0,
}
}
/// Return all active tracks (not terminated).
pub fn active_tracks(&self) -> Vec<&PoseTrack> {
self.tracks
.iter()
.filter(|t| t.lifecycle.is_alive())
.collect()
}
/// Return all tracks including terminated ones.
pub fn all_tracks(&self) -> &[PoseTrack] {
&self.tracks
}
/// Return the number of active (alive) tracks.
pub fn active_count(&self) -> usize {
self.tracks.iter().filter(|t| t.lifecycle.is_alive()).count()
}
/// Predict step for all tracks (advance by dt seconds).
pub fn predict_all(&mut self, dt: f32) {
for track in &mut self.tracks {
if track.lifecycle.is_alive() {
track.predict(dt, self.config.process_noise);
}
}
// Mark tracks as lost after exceeding loss_misses
for track in &mut self.tracks {
if track.lifecycle.accepts_updates()
&& track.time_since_update >= self.config.loss_misses
{
track.mark_lost();
}
}
// Terminate tracks that have been lost too long
let reid_window = self.config.reid_window;
for track in &mut self.tracks {
if track.lifecycle.is_lost() && track.time_since_update >= reid_window {
track.terminate();
}
}
}
/// Create a new track from a detection.
pub fn create_track(
&mut self,
keypoints: &[[f32; 3]; NUM_KEYPOINTS],
timestamp_us: u64,
) -> TrackId {
let id = TrackId::new(self.next_id);
self.next_id += 1;
let track = PoseTrack::new(id, keypoints, timestamp_us, self.config.embedding_dim);
self.tracks.push(track);
id
}
/// Find the track with the given ID.
pub fn find_track(&self, id: TrackId) -> Option<&PoseTrack> {
self.tracks.iter().find(|t| t.id == id)
}
/// Find the track with the given ID (mutable).
pub fn find_track_mut(&mut self, id: TrackId) -> Option<&mut PoseTrack> {
self.tracks.iter_mut().find(|t| t.id == id)
}
/// Remove terminated tracks from the collection.
pub fn prune_terminated(&mut self) {
self.tracks
.retain(|t| t.lifecycle != TrackLifecycleState::Terminated);
}
/// Compute the assignment cost between a track and a detection.
///
/// cost = position_weight * mahalanobis(track, detection.position)
/// + embedding_weight * (1 - cosine_sim(track.embedding, detection.embedding))
pub fn assignment_cost(
&self,
track: &PoseTrack,
detection_centroid: &[f32; 3],
detection_embedding: &[f32],
) -> f32 {
// Position cost: Mahalanobis distance at centroid
let centroid_kp = track.centroid();
let centroid_state = KeypointState::new(centroid_kp[0], centroid_kp[1], centroid_kp[2]);
let maha = centroid_state.mahalanobis_distance(detection_centroid);
// Embedding cost: 1 - cosine similarity
let embed_cost = 1.0 - cosine_similarity(&track.embedding, detection_embedding);
self.config.position_weight * maha + self.config.embedding_weight * embed_cost
}
}
impl Default for PoseTracker {
fn default() -> Self {
Self::new()
}
}
/// Cosine similarity between two vectors.
///
/// Returns a value in [-1.0, 1.0] where 1.0 means identical direction.
pub fn cosine_similarity(a: &[f32], b: &[f32]) -> f32 {
let n = a.len().min(b.len());
if n == 0 {
return 0.0;
}
let mut dot = 0.0_f32;
let mut norm_a = 0.0_f32;
let mut norm_b = 0.0_f32;
for i in 0..n {
dot += a[i] * b[i];
norm_a += a[i] * a[i];
norm_b += b[i] * b[i];
}
let denom = (norm_a * norm_b).sqrt();
if denom < 1e-12 {
return 0.0;
}
(dot / denom).clamp(-1.0, 1.0)
}
/// A detected pose from the model, before assignment to a track.
#[derive(Debug, Clone)]
pub struct PoseDetection {
/// Per-keypoint positions [x, y, z, confidence] for 17 keypoints.
pub keypoints: [[f32; 4]; NUM_KEYPOINTS],
/// AETHER re-ID embedding (128-dim).
pub embedding: Vec<f32>,
}
impl PoseDetection {
/// Extract the 3D position array from keypoints.
pub fn positions(&self) -> [[f32; 3]; NUM_KEYPOINTS] {
std::array::from_fn(|i| [self.keypoints[i][0], self.keypoints[i][1], self.keypoints[i][2]])
}
/// Compute the centroid of the detection.
pub fn centroid(&self) -> [f32; 3] {
let n = NUM_KEYPOINTS as f32;
let mut c = [0.0_f32; 3];
for kp in &self.keypoints {
c[0] += kp[0];
c[1] += kp[1];
c[2] += kp[2];
}
c[0] /= n;
c[1] /= n;
c[2] /= n;
c
}
/// Mean confidence across all keypoints.
pub fn mean_confidence(&self) -> f32 {
let sum: f32 = self.keypoints.iter().map(|kp| kp[3]).sum();
sum / NUM_KEYPOINTS as f32
}
}
#[cfg(test)]
mod tests {
use super::*;
fn zero_positions() -> [[f32; 3]; NUM_KEYPOINTS] {
[[0.0, 0.0, 0.0]; NUM_KEYPOINTS]
}
#[allow(dead_code)]
fn offset_positions(offset: f32) -> [[f32; 3]; NUM_KEYPOINTS] {
std::array::from_fn(|i| [offset + i as f32 * 0.1, offset, 0.0])
}
#[test]
fn keypoint_state_creation() {
let kp = KeypointState::new(1.0, 2.0, 3.0);
assert_eq!(kp.position(), [1.0, 2.0, 3.0]);
assert_eq!(kp.velocity(), [0.0, 0.0, 0.0]);
assert_eq!(kp.confidence, 0.0);
}
#[test]
fn keypoint_predict_moves_position() {
let mut kp = KeypointState::new(0.0, 0.0, 0.0);
kp.state[3] = 1.0; // vx = 1 m/s
kp.predict(0.05, 0.3); // 50ms step
assert!((kp.state[0] - 0.05).abs() < 1e-5, "x should be ~0.05, got {}", kp.state[0]);
}
#[test]
fn keypoint_predict_increases_uncertainty() {
let mut kp = KeypointState::new(0.0, 0.0, 0.0);
let initial_var = kp.covariance[0];
kp.predict(0.05, 0.3);
assert!(kp.covariance[0] > initial_var);
}
#[test]
fn keypoint_update_reduces_uncertainty() {
let mut kp = KeypointState::new(0.0, 0.0, 0.0);
kp.predict(0.05, 0.3);
let post_predict_var = kp.covariance[0];
kp.update(&[0.01, 0.0, 0.0], 0.08, 1.0);
assert!(kp.covariance[0] < post_predict_var);
}
#[test]
fn mahalanobis_zero_distance() {
let kp = KeypointState::new(1.0, 2.0, 3.0);
let d = kp.mahalanobis_distance(&[1.0, 2.0, 3.0]);
assert!(d < 1e-3);
}
#[test]
fn mahalanobis_positive_for_offset() {
let kp = KeypointState::new(0.0, 0.0, 0.0);
let d = kp.mahalanobis_distance(&[1.0, 0.0, 0.0]);
assert!(d > 0.0);
}
#[test]
fn lifecycle_transitions() {
assert!(TrackLifecycleState::Tentative.is_alive());
assert!(TrackLifecycleState::Active.is_alive());
assert!(TrackLifecycleState::Lost.is_alive());
assert!(!TrackLifecycleState::Terminated.is_alive());
assert!(TrackLifecycleState::Tentative.accepts_updates());
assert!(TrackLifecycleState::Active.accepts_updates());
assert!(!TrackLifecycleState::Lost.accepts_updates());
assert!(!TrackLifecycleState::Terminated.accepts_updates());
assert!(!TrackLifecycleState::Tentative.is_lost());
assert!(TrackLifecycleState::Lost.is_lost());
}
#[test]
fn track_creation() {
let positions = zero_positions();
let track = PoseTrack::new(TrackId(0), &positions, 1000, 128);
assert_eq!(track.id, TrackId(0));
assert_eq!(track.lifecycle, TrackLifecycleState::Tentative);
assert_eq!(track.embedding.len(), 128);
assert_eq!(track.age, 0);
assert_eq!(track.consecutive_hits, 1);
}
#[test]
fn track_birth_gate() {
let positions = zero_positions();
let mut track = PoseTrack::new(TrackId(0), &positions, 0, 128);
assert_eq!(track.lifecycle, TrackLifecycleState::Tentative);
// First update: still tentative (need 2 hits)
track.update_keypoints(&positions, 0.08, 1.0, 100);
assert_eq!(track.lifecycle, TrackLifecycleState::Active);
}
#[test]
fn track_loss_gate() {
let positions = zero_positions();
let mut track = PoseTrack::new(TrackId(0), &positions, 0, 128);
track.lifecycle = TrackLifecycleState::Active;
// Predict without updates exceeding loss_misses
for _ in 0..6 {
track.predict(0.05, 0.3);
}
// Manually mark lost (normally done by tracker)
if track.time_since_update >= 5 {
track.mark_lost();
}
assert_eq!(track.lifecycle, TrackLifecycleState::Lost);
}
#[test]
fn track_centroid() {
let positions: [[f32; 3]; NUM_KEYPOINTS] =
std::array::from_fn(|_| [1.0, 2.0, 3.0]);
let track = PoseTrack::new(TrackId(0), &positions, 0, 128);
let c = track.centroid();
assert!((c[0] - 1.0).abs() < 1e-5);
assert!((c[1] - 2.0).abs() < 1e-5);
assert!((c[2] - 3.0).abs() < 1e-5);
}
#[test]
fn track_embedding_update() {
let positions = zero_positions();
let mut track = PoseTrack::new(TrackId(0), &positions, 0, 4);
let new_embed = vec![1.0, 2.0, 3.0, 4.0];
track.update_embedding(&new_embed, 0.5);
// EMA: 0.5 * 0.0 + 0.5 * new = new / 2
for i in 0..4 {
assert!((track.embedding[i] - new_embed[i] * 0.5).abs() < 1e-5);
}
}
#[test]
fn tracker_create_and_find() {
let mut tracker = PoseTracker::new();
let positions = zero_positions();
let id = tracker.create_track(&positions, 1000);
assert!(tracker.find_track(id).is_some());
assert_eq!(tracker.active_count(), 1);
}
#[test]
fn tracker_predict_marks_lost() {
let mut tracker = PoseTracker::with_config(TrackerConfig {
loss_misses: 3,
reid_window: 10,
..Default::default()
});
let positions = zero_positions();
let id = tracker.create_track(&positions, 0);
// Promote to active
if let Some(t) = tracker.find_track_mut(id) {
t.lifecycle = TrackLifecycleState::Active;
}
// Predict 4 times without update
for _ in 0..4 {
tracker.predict_all(0.05);
}
let track = tracker.find_track(id).unwrap();
assert_eq!(track.lifecycle, TrackLifecycleState::Lost);
}
#[test]
fn tracker_prune_terminated() {
let mut tracker = PoseTracker::new();
let positions = zero_positions();
let id = tracker.create_track(&positions, 0);
if let Some(t) = tracker.find_track_mut(id) {
t.terminate();
}
assert_eq!(tracker.all_tracks().len(), 1);
tracker.prune_terminated();
assert_eq!(tracker.all_tracks().len(), 0);
}
#[test]
fn cosine_similarity_identical() {
let a = vec![1.0, 2.0, 3.0];
let b = vec![1.0, 2.0, 3.0];
assert!((cosine_similarity(&a, &b) - 1.0).abs() < 1e-5);
}
#[test]
fn cosine_similarity_orthogonal() {
let a = vec![1.0, 0.0, 0.0];
let b = vec![0.0, 1.0, 0.0];
assert!(cosine_similarity(&a, &b).abs() < 1e-5);
}
#[test]
fn cosine_similarity_opposite() {
let a = vec![1.0, 2.0, 3.0];
let b = vec![-1.0, -2.0, -3.0];
assert!((cosine_similarity(&a, &b) + 1.0).abs() < 1e-5);
}
#[test]
fn cosine_similarity_empty() {
assert_eq!(cosine_similarity(&[], &[]), 0.0);
}
#[test]
fn pose_detection_centroid() {
let kps: [[f32; 4]; NUM_KEYPOINTS] =
std::array::from_fn(|_| [1.0, 2.0, 3.0, 0.9]);
let det = PoseDetection {
keypoints: kps,
embedding: vec![0.0; 128],
};
let c = det.centroid();
assert!((c[0] - 1.0).abs() < 1e-5);
}
#[test]
fn pose_detection_mean_confidence() {
let kps: [[f32; 4]; NUM_KEYPOINTS] =
std::array::from_fn(|_| [0.0, 0.0, 0.0, 0.8]);
let det = PoseDetection {
keypoints: kps,
embedding: vec![0.0; 128],
};
assert!((det.mean_confidence() - 0.8).abs() < 1e-5);
}
#[test]
fn pose_detection_positions() {
let kps: [[f32; 4]; NUM_KEYPOINTS] =
std::array::from_fn(|i| [i as f32, 0.0, 0.0, 1.0]);
let det = PoseDetection {
keypoints: kps,
embedding: vec![],
};
let pos = det.positions();
assert_eq!(pos[0], [0.0, 0.0, 0.0]);
assert_eq!(pos[5], [5.0, 0.0, 0.0]);
}
#[test]
fn assignment_cost_computation() {
let mut tracker = PoseTracker::new();
let positions = zero_positions();
let id = tracker.create_track(&positions, 0);
let track = tracker.find_track(id).unwrap();
let cost = tracker.assignment_cost(track, &[0.0, 0.0, 0.0], &vec![0.0; 128]);
// Zero distance + zero embedding cost should be near 0
// But embedding cost = 1 - cosine_sim(zeros, zeros) = 1 - 0 = 1
// So cost = 0.6 * 0 + 0.4 * 1 = 0.4
assert!((cost - 0.4).abs() < 0.1, "Expected ~0.4, got {}", cost);
}
#[test]
fn torso_jitter_rms_stationary() {
let positions = zero_positions();
let track = PoseTrack::new(TrackId(0), &positions, 0, 128);
let jitter = track.torso_jitter_rms();
assert!(jitter < 1e-5, "Stationary track should have near-zero jitter");
}
#[test]
fn default_tracker_config() {
let cfg = TrackerConfig::default();
assert!((cfg.process_noise - 0.3).abs() < f32::EPSILON);
assert!((cfg.measurement_noise - 0.08).abs() < f32::EPSILON);
assert!((cfg.mahalanobis_gate - 9.0).abs() < f32::EPSILON);
assert_eq!(cfg.birth_hits, 2);
assert_eq!(cfg.loss_misses, 5);
assert_eq!(cfg.reid_window, 100);
assert!((cfg.embedding_decay - 0.95).abs() < f32::EPSILON);
assert_eq!(cfg.embedding_dim, 128);
assert!((cfg.position_weight - 0.6).abs() < f32::EPSILON);
assert!((cfg.embedding_weight - 0.4).abs() < f32::EPSILON);
}
#[test]
fn track_terminate_prevents_lost() {
let positions = zero_positions();
let mut track = PoseTrack::new(TrackId(0), &positions, 0, 128);
track.terminate();
assert_eq!(track.lifecycle, TrackLifecycleState::Terminated);
track.mark_lost(); // Should not override Terminated
assert_eq!(track.lifecycle, TrackLifecycleState::Terminated);
}
}

View File

@@ -0,0 +1,676 @@
//! Coarse RF Tomography from link attenuations.
//!
//! Produces a low-resolution 3D occupancy volume by inverting per-link
//! attenuation measurements. Each voxel receives an occupancy probability
//! based on how many links traverse it and how much attenuation those links
//! observed.
//!
//! # Algorithm
//! 1. Define a voxel grid covering the monitored volume
//! 2. For each link, determine which voxels lie along the propagation path
//! 3. Solve the sparse tomographic inverse: attenuation = sum(voxel_density * path_weight)
//! 4. Apply L1 regularization for sparsity (most voxels are unoccupied)
//!
//! # References
//! - ADR-030 Tier 2: Coarse RF Tomography
//! - Wilson & Patwari (2010), "Radio Tomographic Imaging"
// ---------------------------------------------------------------------------
// Error types
// ---------------------------------------------------------------------------
/// Errors from tomography operations.
#[derive(Debug, thiserror::Error)]
pub enum TomographyError {
/// Not enough links for tomographic inversion.
#[error("Insufficient links: need >= {needed}, got {got}")]
InsufficientLinks { needed: usize, got: usize },
/// Grid dimensions are invalid.
#[error("Invalid grid dimensions: {0}")]
InvalidGrid(String),
/// No voxels intersected by any link.
#[error("No voxels intersected by links — check geometry")]
NoIntersections,
/// Observation vector length mismatch.
#[error("Observation length mismatch: expected {expected}, got {got}")]
ObservationMismatch { expected: usize, got: usize },
}
// ---------------------------------------------------------------------------
// Configuration
// ---------------------------------------------------------------------------
/// Configuration for the voxel grid and tomographic solver.
#[derive(Debug, Clone)]
pub struct TomographyConfig {
/// Number of voxels along X axis.
pub nx: usize,
/// Number of voxels along Y axis.
pub ny: usize,
/// Number of voxels along Z axis.
pub nz: usize,
/// Physical extent of the grid: `[x_min, y_min, z_min, x_max, y_max, z_max]`.
pub bounds: [f64; 6],
/// L1 regularization weight (higher = sparser solution).
pub lambda: f64,
/// Maximum iterations for the solver.
pub max_iterations: usize,
/// Convergence tolerance.
pub tolerance: f64,
/// Minimum links required for inversion (default 8).
pub min_links: usize,
}
impl Default for TomographyConfig {
fn default() -> Self {
Self {
nx: 8,
ny: 8,
nz: 4,
bounds: [0.0, 0.0, 0.0, 6.0, 6.0, 3.0],
lambda: 0.1,
max_iterations: 100,
tolerance: 1e-4,
min_links: 8,
}
}
}
// ---------------------------------------------------------------------------
// Geometry types
// ---------------------------------------------------------------------------
/// A 3D position.
#[derive(Debug, Clone, Copy)]
pub struct Position3D {
pub x: f64,
pub y: f64,
pub z: f64,
}
/// A link between a transmitter and receiver.
#[derive(Debug, Clone)]
pub struct LinkGeometry {
/// Transmitter position.
pub tx: Position3D,
/// Receiver position.
pub rx: Position3D,
/// Link identifier.
pub link_id: usize,
}
impl LinkGeometry {
/// Euclidean distance between TX and RX.
pub fn distance(&self) -> f64 {
let dx = self.rx.x - self.tx.x;
let dy = self.rx.y - self.tx.y;
let dz = self.rx.z - self.tx.z;
(dx * dx + dy * dy + dz * dz).sqrt()
}
}
// ---------------------------------------------------------------------------
// Occupancy volume
// ---------------------------------------------------------------------------
/// 3D occupancy grid resulting from tomographic inversion.
#[derive(Debug, Clone)]
pub struct OccupancyVolume {
/// Voxel densities in row-major order `[nz][ny][nx]`.
pub densities: Vec<f64>,
/// Grid dimensions.
pub nx: usize,
pub ny: usize,
pub nz: usize,
/// Physical bounds.
pub bounds: [f64; 6],
/// Number of occupied voxels (density > threshold).
pub occupied_count: usize,
/// Total voxel count.
pub total_voxels: usize,
/// Solver residual at convergence.
pub residual: f64,
/// Number of iterations used.
pub iterations: usize,
}
impl OccupancyVolume {
/// Get density at voxel (ix, iy, iz). Returns None if out of bounds.
pub fn get(&self, ix: usize, iy: usize, iz: usize) -> Option<f64> {
if ix < self.nx && iy < self.ny && iz < self.nz {
Some(self.densities[iz * self.ny * self.nx + iy * self.nx + ix])
} else {
None
}
}
/// Voxel size along each axis.
pub fn voxel_size(&self) -> [f64; 3] {
[
(self.bounds[3] - self.bounds[0]) / self.nx as f64,
(self.bounds[4] - self.bounds[1]) / self.ny as f64,
(self.bounds[5] - self.bounds[2]) / self.nz as f64,
]
}
/// Center position of voxel (ix, iy, iz).
pub fn voxel_center(&self, ix: usize, iy: usize, iz: usize) -> Position3D {
let vs = self.voxel_size();
Position3D {
x: self.bounds[0] + (ix as f64 + 0.5) * vs[0],
y: self.bounds[1] + (iy as f64 + 0.5) * vs[1],
z: self.bounds[2] + (iz as f64 + 0.5) * vs[2],
}
}
}
// ---------------------------------------------------------------------------
// Tomographic solver
// ---------------------------------------------------------------------------
/// Coarse RF tomography solver.
///
/// Given a set of TX-RX links and per-link attenuation measurements,
/// reconstructs a 3D occupancy volume using L1-regularized least squares.
pub struct RfTomographer {
config: TomographyConfig,
/// Precomputed weight matrix: `weight_matrix[link_idx]` is a list of
/// (voxel_index, weight) pairs.
weight_matrix: Vec<Vec<(usize, f64)>>,
/// Number of voxels.
n_voxels: usize,
}
impl RfTomographer {
/// Create a new tomographer with the given configuration and link geometry.
pub fn new(config: TomographyConfig, links: &[LinkGeometry]) -> Result<Self, TomographyError> {
if links.len() < config.min_links {
return Err(TomographyError::InsufficientLinks {
needed: config.min_links,
got: links.len(),
});
}
if config.nx == 0 || config.ny == 0 || config.nz == 0 {
return Err(TomographyError::InvalidGrid(
"Grid dimensions must be > 0".into(),
));
}
let n_voxels = config.nx * config.ny * config.nz;
// Precompute weight matrix
let weight_matrix: Vec<Vec<(usize, f64)>> = links
.iter()
.map(|link| compute_link_weights(link, &config))
.collect();
// Ensure at least one link intersects some voxels
let total_weights: usize = weight_matrix.iter().map(|w| w.len()).sum();
if total_weights == 0 {
return Err(TomographyError::NoIntersections);
}
Ok(Self {
config,
weight_matrix,
n_voxels,
})
}
/// Reconstruct occupancy from per-link attenuation measurements.
///
/// `attenuations` has one entry per link (same order as links passed to `new`).
/// Higher attenuation indicates more obstruction along the link path.
pub fn reconstruct(&self, attenuations: &[f64]) -> Result<OccupancyVolume, TomographyError> {
if attenuations.len() != self.weight_matrix.len() {
return Err(TomographyError::ObservationMismatch {
expected: self.weight_matrix.len(),
got: attenuations.len(),
});
}
// ISTA (Iterative Shrinkage-Thresholding Algorithm) for L1 minimization
// min ||Wx - y||^2 + lambda * ||x||_1
let mut x = vec![0.0_f64; self.n_voxels];
let n_links = attenuations.len();
// Estimate step size: 1 / (max eigenvalue of W^T W)
// Approximate by max column norm squared
let mut col_norms = vec![0.0_f64; self.n_voxels];
for weights in &self.weight_matrix {
for &(idx, w) in weights {
col_norms[idx] += w * w;
}
}
let max_col_norm = col_norms.iter().cloned().fold(0.0_f64, f64::max).max(1e-10);
let step_size = 1.0 / max_col_norm;
let mut residual = 0.0_f64;
let mut iterations = 0;
for iter in 0..self.config.max_iterations {
// Compute gradient: W^T (Wx - y)
let mut gradient = vec![0.0_f64; self.n_voxels];
residual = 0.0;
for (link_idx, weights) in self.weight_matrix.iter().enumerate() {
// Forward: Wx for this link
let predicted: f64 = weights.iter().map(|&(idx, w)| w * x[idx]).sum();
let diff = predicted - attenuations[link_idx];
residual += diff * diff;
// Backward: accumulate gradient
for &(idx, w) in weights {
gradient[idx] += w * diff;
}
}
residual = (residual / n_links as f64).sqrt();
// Gradient step + soft thresholding (proximal L1)
let mut max_change = 0.0_f64;
for i in 0..self.n_voxels {
let new_val = x[i] - step_size * gradient[i];
// Soft thresholding
let threshold = self.config.lambda * step_size;
let shrunk = if new_val > threshold {
new_val - threshold
} else if new_val < -threshold {
new_val + threshold
} else {
0.0
};
// Non-negativity constraint (density >= 0)
let clamped = shrunk.max(0.0);
max_change = max_change.max((clamped - x[i]).abs());
x[i] = clamped;
}
iterations = iter + 1;
if max_change < self.config.tolerance {
break;
}
}
// Count occupied voxels (density > 0.01)
let occupied_count = x.iter().filter(|&&d| d > 0.01).count();
Ok(OccupancyVolume {
densities: x,
nx: self.config.nx,
ny: self.config.ny,
nz: self.config.nz,
bounds: self.config.bounds,
occupied_count,
total_voxels: self.n_voxels,
residual,
iterations,
})
}
/// Number of links in this tomographer.
pub fn n_links(&self) -> usize {
self.weight_matrix.len()
}
/// Number of voxels in the grid.
pub fn n_voxels(&self) -> usize {
self.n_voxels
}
}
// ---------------------------------------------------------------------------
// Weight computation (simplified ray-voxel intersection)
// ---------------------------------------------------------------------------
/// Compute the intersection weights of a link with the voxel grid.
///
/// Uses a simplified approach: for each voxel, computes the minimum
/// distance from the voxel center to the link ray. Voxels within
/// one Fresnel zone receive weight proportional to closeness.
fn compute_link_weights(link: &LinkGeometry, config: &TomographyConfig) -> Vec<(usize, f64)> {
let vx = (config.bounds[3] - config.bounds[0]) / config.nx as f64;
let vy = (config.bounds[4] - config.bounds[1]) / config.ny as f64;
let vz = (config.bounds[5] - config.bounds[2]) / config.nz as f64;
// Fresnel zone half-width (approximate)
let link_dist = link.distance();
let wavelength = 0.06; // ~5 GHz
let fresnel_radius = (wavelength * link_dist / 4.0).sqrt().max(vx.max(vy));
let dx = link.rx.x - link.tx.x;
let dy = link.rx.y - link.tx.y;
let dz = link.rx.z - link.tx.z;
let mut weights = Vec::new();
for iz in 0..config.nz {
for iy in 0..config.ny {
for ix in 0..config.nx {
let cx = config.bounds[0] + (ix as f64 + 0.5) * vx;
let cy = config.bounds[1] + (iy as f64 + 0.5) * vy;
let cz = config.bounds[2] + (iz as f64 + 0.5) * vz;
// Point-to-line distance
let dist = point_to_segment_distance(
cx, cy, cz, link.tx.x, link.tx.y, link.tx.z, dx, dy, dz, link_dist,
);
if dist < fresnel_radius {
// Weight decays with distance from link ray
let w = 1.0 - dist / fresnel_radius;
let idx = iz * config.ny * config.nx + iy * config.nx + ix;
weights.push((idx, w));
}
}
}
}
weights
}
/// Distance from point (px,py,pz) to line segment defined by start + t*dir
/// where dir = (dx,dy,dz) and segment length = `seg_len`.
fn point_to_segment_distance(
px: f64,
py: f64,
pz: f64,
sx: f64,
sy: f64,
sz: f64,
dx: f64,
dy: f64,
dz: f64,
seg_len: f64,
) -> f64 {
if seg_len < 1e-12 {
return ((px - sx).powi(2) + (py - sy).powi(2) + (pz - sz).powi(2)).sqrt();
}
// Project point onto line: t = dot(P-S, D) / |D|^2
let t = ((px - sx) * dx + (py - sy) * dy + (pz - sz) * dz) / (seg_len * seg_len);
let t_clamped = t.clamp(0.0, 1.0);
let closest_x = sx + t_clamped * dx;
let closest_y = sy + t_clamped * dy;
let closest_z = sz + t_clamped * dz;
((px - closest_x).powi(2) + (py - closest_y).powi(2) + (pz - closest_z).powi(2)).sqrt()
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn make_square_links() -> Vec<LinkGeometry> {
// 4 nodes in a square at z=1.5, 12 directed links
let nodes = [
Position3D {
x: 0.5,
y: 0.5,
z: 1.5,
},
Position3D {
x: 5.5,
y: 0.5,
z: 1.5,
},
Position3D {
x: 5.5,
y: 5.5,
z: 1.5,
},
Position3D {
x: 0.5,
y: 5.5,
z: 1.5,
},
];
let mut links = Vec::new();
let mut id = 0;
for i in 0..4 {
for j in 0..4 {
if i != j {
links.push(LinkGeometry {
tx: nodes[i],
rx: nodes[j],
link_id: id,
});
id += 1;
}
}
}
links
}
#[test]
fn test_tomographer_creation() {
let links = make_square_links();
let config = TomographyConfig {
min_links: 8,
..Default::default()
};
let tomo = RfTomographer::new(config, &links).unwrap();
assert_eq!(tomo.n_links(), 12);
assert_eq!(tomo.n_voxels(), 8 * 8 * 4);
}
#[test]
fn test_insufficient_links() {
let links = vec![LinkGeometry {
tx: Position3D {
x: 0.0,
y: 0.0,
z: 0.0,
},
rx: Position3D {
x: 1.0,
y: 0.0,
z: 0.0,
},
link_id: 0,
}];
let config = TomographyConfig {
min_links: 8,
..Default::default()
};
assert!(matches!(
RfTomographer::new(config, &links),
Err(TomographyError::InsufficientLinks { .. })
));
}
#[test]
fn test_invalid_grid() {
let links = make_square_links();
let config = TomographyConfig {
nx: 0,
..Default::default()
};
assert!(matches!(
RfTomographer::new(config, &links),
Err(TomographyError::InvalidGrid(_))
));
}
#[test]
fn test_zero_attenuation_empty_room() {
let links = make_square_links();
let config = TomographyConfig {
min_links: 8,
..Default::default()
};
let tomo = RfTomographer::new(config, &links).unwrap();
// Zero attenuation = empty room
let attenuations = vec![0.0; tomo.n_links()];
let volume = tomo.reconstruct(&attenuations).unwrap();
assert_eq!(volume.total_voxels, 8 * 8 * 4);
// All densities should be zero or near zero
assert!(
volume.occupied_count == 0,
"Empty room should have no occupied voxels, got {}",
volume.occupied_count
);
}
#[test]
fn test_nonzero_attenuation_produces_density() {
let links = make_square_links();
let config = TomographyConfig {
min_links: 8,
lambda: 0.01, // light regularization
max_iterations: 200,
..Default::default()
};
let tomo = RfTomographer::new(config, &links).unwrap();
// Non-zero attenuations = something is there
let attenuations: Vec<f64> = (0..tomo.n_links()).map(|i| 0.5 + 0.1 * i as f64).collect();
let volume = tomo.reconstruct(&attenuations).unwrap();
assert!(
volume.occupied_count > 0,
"Non-zero attenuation should produce occupied voxels"
);
}
#[test]
fn test_observation_mismatch() {
let links = make_square_links();
let config = TomographyConfig {
min_links: 8,
..Default::default()
};
let tomo = RfTomographer::new(config, &links).unwrap();
let attenuations = vec![0.1; 3]; // wrong count
assert!(matches!(
tomo.reconstruct(&attenuations),
Err(TomographyError::ObservationMismatch { .. })
));
}
#[test]
fn test_voxel_access() {
let links = make_square_links();
let config = TomographyConfig {
min_links: 8,
..Default::default()
};
let tomo = RfTomographer::new(config, &links).unwrap();
let attenuations = vec![0.0; tomo.n_links()];
let volume = tomo.reconstruct(&attenuations).unwrap();
// Valid access
assert!(volume.get(0, 0, 0).is_some());
assert!(volume.get(7, 7, 3).is_some());
// Out of bounds
assert!(volume.get(8, 0, 0).is_none());
assert!(volume.get(0, 8, 0).is_none());
assert!(volume.get(0, 0, 4).is_none());
}
#[test]
fn test_voxel_center() {
let links = make_square_links();
let config = TomographyConfig {
nx: 6,
ny: 6,
nz: 3,
min_links: 8,
..Default::default()
};
let tomo = RfTomographer::new(config, &links).unwrap();
let attenuations = vec![0.0; tomo.n_links()];
let volume = tomo.reconstruct(&attenuations).unwrap();
let center = volume.voxel_center(0, 0, 0);
assert!(center.x > 0.0 && center.x < 1.0);
assert!(center.y > 0.0 && center.y < 1.0);
assert!(center.z > 0.0 && center.z < 1.0);
}
#[test]
fn test_voxel_size() {
let links = make_square_links();
let config = TomographyConfig {
nx: 6,
ny: 6,
nz: 3,
bounds: [0.0, 0.0, 0.0, 6.0, 6.0, 3.0],
min_links: 8,
..Default::default()
};
let tomo = RfTomographer::new(config, &links).unwrap();
let attenuations = vec![0.0; tomo.n_links()];
let volume = tomo.reconstruct(&attenuations).unwrap();
let vs = volume.voxel_size();
assert!((vs[0] - 1.0).abs() < 1e-10);
assert!((vs[1] - 1.0).abs() < 1e-10);
assert!((vs[2] - 1.0).abs() < 1e-10);
}
#[test]
fn test_point_to_segment_distance() {
// Point directly on the segment
let d = point_to_segment_distance(0.5, 0.0, 0.0, 0.0, 0.0, 0.0, 1.0, 0.0, 0.0, 1.0);
assert!(d < 1e-10);
// Point 1 unit above the midpoint
let d = point_to_segment_distance(0.5, 1.0, 0.0, 0.0, 0.0, 0.0, 1.0, 0.0, 0.0, 1.0);
assert!((d - 1.0).abs() < 1e-10);
}
#[test]
fn test_link_distance() {
let link = LinkGeometry {
tx: Position3D {
x: 0.0,
y: 0.0,
z: 0.0,
},
rx: Position3D {
x: 3.0,
y: 4.0,
z: 0.0,
},
link_id: 0,
};
assert!((link.distance() - 5.0).abs() < 1e-10);
}
#[test]
fn test_solver_convergence() {
let links = make_square_links();
let config = TomographyConfig {
min_links: 8,
lambda: 0.01,
max_iterations: 500,
tolerance: 1e-6,
..Default::default()
};
let tomo = RfTomographer::new(config, &links).unwrap();
let attenuations: Vec<f64> = (0..tomo.n_links())
.map(|i| 0.3 * (i as f64 * 0.7).sin().abs())
.collect();
let volume = tomo.reconstruct(&attenuations).unwrap();
assert!(volume.residual.is_finite());
assert!(volume.iterations > 0);
}
}